owl  

ATHENA

MINERALOGY


Systematic List of Minerals

List sorted according to Strunz 10 th ed. (pending). Strunz Br: courtesy D. Barthelmy

mlevy


* ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Metals and Intermetallic Alloys
Copper-cupalite family
ALUMINIUM Al C
COPPER Cu C
GOLD Au C
LEAD Pb C
NICKEL Ni C
SILVER Ag H
SILVER Ag C/H
AURICUPRIDE Cu3Au O
CUPROAURIDE Cu3Au C
TETRAAURICUPRIDE AuCu Q
ANYUIITE Au(Pb,Sb)2 Q
KHATYRKITE (Cu,Zn)Al2 Q
NOVODNEPRITE AuPb3 Q
CUPALITE (Cu,Zn)Al O
HUNCHUNITE (Au,Ag)2Pb C
Zinc-brass family
CADMIUM Cd H
RHENIUM Re H (?)
TITANIUM Ti H
ZINC Zn H
ZHANGHENGITE (Cu,Zn,Fe,Al,Cr) C
DANBAITE CuZn2 C
TONGXINITE Cu2Zn C
Indium-tin family
INDIUM In Q
TIN Sn Q
SOROSITE Cu(Sn,Sb) H
YUANJIANGITE AuSn H
Mercury-amalgam family
AURIHYDRARGYRUMITE Au6Hg5 H
MERCURY Hg R
BELENDORFFITE Cu7Hg6 R ps C
KOLYMITE Cu7Hg6 C
SCHACHNERITE Ag1,1Hg0,9 H
PARASCHACHNERITE Ag3Hg2 O
LUANHEITE Ag3Hg H
EUGENITE Ag11Hg2 C
MOSCHELLANDSBERGITE Ag2Hg3 C
WEISHANITE (Au,Ag)3Hg2 H
POTARITE PdHg Q
LEADAMALGAM HgPb2 Q
Iron-chromium family
KAMACITE alpha-(Fe,Ni) C
TUNGSTEN W C
IRON Fe C
CHROMIUM Cr C
TAENITE (Ni,Fe) C
TETRATAENITE FeNi Q
FERCHROMIDE Cr3Fe1-x (x=0,6) C
CHROMFERIDE Fe3Cr1-x (x=0,6) C
WAIRAUITE CoFe C
AWARUITE Ni2Fe to Ni3Fe H
JEDWABITE Fe7(Ta,Nb)3 H
MANGANESE Mn C
VANADIUM V C
Platinum group elements
OSMIUM (Os,Ir) H
RUTHENIRIDOSMINE (Ir,Os,Ru) H
RUTHENIUM (Ru,Ir,Os) H
IRIDIUM (Ir,Os,Ru) C
PALLADIUM (Pd,Pt) C
PLATINUM Pt C
RHODIUM (Rh,Pt) C
PGE-metal alloys
GARUTIITE (Ni,Fe,Ir) H
HEXAFERRUM (Fe,Ru,Os,Ir) H
RUSTENBURGITE (Pt,Pd)3Sn C
ZVYAGINTSEVITE (Pd,Pt,Au)3(Pb,Sn) C
ATOKITE (Pd,Pt)3Sn C
TAIMYRITE (Pd,Cu,Pt)3Sn O
TATYANAITE (Pt,Pd,Cu)9Cu3Sn4 O
PAOLOVITE Pd2Sn O
PLUMBOPALLADINITE Pd3Pb2 H
STANNOPALLADINITE (Pd,Cu)3Sn2 H
CABRIITE Pd2SnCu O
CHENGDEITE Ir3Fe C
ISOFERROPLATINUM (Pt,Pd)3(Fe,Cu) C
TULAMEENITE Pt2CuFe Q
TETRAFERROPLATINUM PtFe Q
FERRONICKELPLATINUM Pt(Ni,Fe) Q
HONGSHIITE PtCu R
SKAERGAARDITE PdCu C
YIXUNITE Pt3In C
DAMIAOITE PtIn2 C
NIGGLIITE PtSn H
BORTNIKOVITE Pd3Cu3Zn Q
NIELSENITE PdCu3 Q
Miscellaneous Elements, alloys
DECAGONITE Al71Ni24Fe5 Icosaedre
MITROFANOVITE Pt3Te4 R
ORTHOCUPROPLATINUM Pt3Cu O
TOMAMAEITE Cu3Pt C
BRONZE Cu1,2Sn H
Metallic Carbides, Silicides, Nitrides and Phosphides
Carbides
COHENITE (Fe,Ni,Co)3C O
HAXONITE (FeNi)23C6 C
ISOVITE (Cr,Fe)23C6 C
TONGBAITE Cr3C2 O
KHAMRABAEVITE (Ti,V,Fe)C C
NIOBOCARBIDE (Nb,Ta)C C
TANTALCARBIDE (Ta,Nb)C C
QUSONGITE WC H
YARLONGITE (Cr,Fe,Ni)9C4 H
EDSCOTTITE Fe5C2 M
Silicides
MAVLYANOVITE (Mn,Fe)5Si3 H
SUESSITE (Fe,Ni)3Si C
PERRYITE (Ni,Fe)8(Si,P)3 H
NAQUITE FeSi C
LINZHIITE FeSi2 Q
LUOBUSAITE Fe3Si7 O
GUPEIITE Fe3Si C
HAPKEITE Fe2Si C
XIFENGITE Fe5Si3 H
BROWNLEEITE MnSi C
ZANGBOITE TiFeSi2 O
CARLETONMOOREITE Ni3Si C
Nitrides
ROALDITE Fe4N C
SIDERAZOT Fe3N1,33 H
CARLSBERGITE CrN C
OSBORNITE TiN C
QINGSONGITE BN C
OREILLYITE Cr2N R
Phosphides
NICKELPHOSPHIDE (Ni,Fe)3P Q
SCHREIBERSITE (Fe,Ni)3P Q
BARRINGERITE (Fe,Ni)2P H
MONIPITE MoNiP H
ALLABOGDANITE (Fe,Ni)2P O
FLORENSKYITE Fe(Ti,Ni)P O
ANDREYIVANOVITE Fe(Cr,Fe)P O
MELLINIITE (Ni,Fe)4P C
MURASHKOITE FeP O
ZHIQINITE TiSi2 O
GRAMMATIKOPOULOSITE NiVP O
BADENGZHUITE TiP H
ZUKTAMRURITE FeP2 O
TRANSJORDANITE Ni2P H
NEGEVITE NiP2 C
HALAMISHITE Ni5P4 H
NICKOLAYITE FeMoP O
Metalloids and Nonmetals
Arsenic group elements
STIBARSEN SbAs R
ANTIMONY Sb R
BISMUTH Bi R
ARSENIC As R
ARSENOLAMPRITE As O
PARARSENOLAMPRITE As O
PARADOCRASITE Sb2(Sb,As)2 M
Carbon-silicon family
GRAPHITE C H/R
CHAOITE C H
FULLERITE C60 Q
DIAMOND C C
LONSDALEITE C H
SILICON Si C
Sulfur-selenium-iodine
SULPHUR S O
ROSICKYITE gamma-S M
SELENIUM Se R
TELLURIUM Te R
SULPHUR-Beta S M
Nonmetallic Carbides and Nitrides
Nonmetallic carbides
NORILSKITE (Pd,Ag)7Pb4 R
Nonmetallic nitrides
NIERITE Si3N4 R
SINOITE Si2N2O O
Unclassified Strunz ELEMENTS, metals and intermetallic alloys; metalloids and nonmetals; carbides, silicides, nitrides, phosphides
Elements, etc. unclassified
KANGJINLAITE Ti11Si10 Q
WENJIITE Ti10SixPy (x+y between 6 and 7) H
MOISSANITE SiC H/R
PALLADOSILICIDE Pd2Si H
TSIKOURASITE Mo3Ni2P1+x (x smaller than 0,25) C
STOLPERITE AlCu C
POLEKHOVSKYITE MoNiP2 H
PALLADOGERMANIDE Pd2Ge H
ORISHCHINITE Ni2P O
NISNITE Ni3Sn C
NAZAROVITE Ni12P5 Q
UAKITITE VN C
ICOSAHEDRITE Al63Cu24Fe13 ps C
HOLLISTERITE Al3Fe Q
MICHITOSHIITE-(Cu) Rh(Cu1-xGex) C
JINGSUIITE TiB2 H
STEINHARDITE Al C
KISHONITE VH2 C
KITAGOHAITE Pt7Cu C
KRYACHKOITE (Al,Cu)6(Fe,Cu) O
KUFAHRITE PtPb H
HEXAMOLYBDENUM (Mo,Ru,Fe,Ir,Os) H
* SULFIDES and SULFOSALTS, selenides, tellurides; arsenides, antimonides, bismuthides; sulfarsenites, sulfantimonites, sulfbismuthites, etc.
Alloys
Alloys of metalloids with Cu, Ag, Au
ALGODONITE Cu6As H
DOMEYKITE Cu3As C
KOUTEKITE Cu5As2 H
NOVAKITE (Cu,Ag)21As10 M ps Q
CUPROSTIBITE Cu2(Sb,Tl) Q
KUTINAITE (K,Tl)0,25Cu14Ag6As6,75 Q
ALLARGENTUM Ag1-xSbx H
DYSCRASITE Ag3Sb O
MALDONITE Au2Bi C
STISTAITE SnSb C
DOMEYKITE-Beta Cu3-xAs C
Ni-metalloid alloys
ORCELITE Ni5-xAs2 (x about 0,25) H
MAUCHERITE Ni11As8 Q
DIENERITE Ni3As C
Alloys of metalloids with PGE
ATHENEITE Pd2(As0,75Hg0,25) H
VINCENTITE (Pd,Pt)3(As,Sb,Te) (?)
STILLWATERITE Pd8As3 H
MERTIEITE-II Pd8Sb2,5As0,5 R
ARSENOPALLADINITE Pd8(As,Sb)3 A
ISOMERTIEITE Pd11Sb2As2 C
MIESSIITE Pd11Te2Se2 C
MERTIEITE-I Pd11(Sb,As)4 ps H
STIBIOPALLADINITE Pd5Sb2 H
PALARSTANIDE Pd8(Sn,As)3 H
MENSHIKOVITE Pd3Ni2As3 H
PALLADOARSENIDE Pd2As M
RHODARSENIDE (Rh,Pd)2As O
PALLADODYMITE (Pd,Rh)2As O
NALDRETTITE Pd2Sb O
MAJAKITE PdNiAs H
PALLADOBISMUTHARSENIDE Pd2(As,Bi) O
POLKANOVITE (Rh,Ni)12As7 H
GENKINITE (Pt,Pd)4Sb3 Q
UNGAVAITE Pd4Sb3 Q
POLARITE Pd(Bi,Pb) O
FROODITE PdBi2 M
IRIDARSENITE (Ir,Ru)As2 M
BORISHANSKIITE Pd1+x(As,Pb)2 (x=0-0,2) O
TORNROOSITE Pd11As2Te2 C
VITEITE Pd5InAs Q
Metal Sulfides, M: S > 1: 1 (mainly 2: 1)
With Cu, Ag, Au
CHALCOCITE Cu2S M
ROXBYITE Cu9S5 M
DJURLEITE Cu31S16 M
GEERITE Cu8S5 ps C
ANILITE Cu7S4 O
DIGENITE Cu9S5 C
BORNITE Cu5FeS4 O ps C
BELLIDOITE Cu2Se Q
BERZELIANITE Cu2Se C
UMANGITE Cu3Se2 Q
ATHABASCAITE Cu5Se4 O
RICKARDITE Cu7Te5 O ps Q
WEISSITE Cu2-xTe H ps C
ACANTHITE Ag2S M
MCKINSTRYITE (Ag,Cu)2S O
STROMEYERITE AgCuS O
JALPAITE Ag3CuS2 Q
SELENOJALPAITE CuAg3Se2 Q
EUCAIRITE CuAgSe O
AGUILARITE Ag4SeS O
NAUMANNITE Ag2Se O ps C
CHENGUODAITE Ag9FeTe2S4 O
HESSITE Ag2Te M
CERVELLEITE Ag4TeS C
HENRYITE (Cu,Ag)3,4Te2 C
STUTZITE Ag7Te4 H
ARGYRODITE Ag8GeS6 O ps C
CANFIELDITE Ag8SnS6 O ps C
PUTZITE (Cu,Ag)8GeS6 C
PENZHINITE (Ag,Cu)4Au(S,Se)4 H
UYTENBOGAARDTITE Ag3AuS2 Q
PETROVSKAITE AuAg(S,Se) M
FISCHESSERITE Ag3AuSe2 C
PETZITE Ag3AuTe2 C
BEZSMERTNOVITE Au4Cu(Te,Pb) O
BILIBINSKITE Au3Cu2PbTe2 ps C
BOGDANOVITE (Au,Te,Pb)3(Cu,Fe) C
GACHINGITE Au(Te1-xSex) (x between 0,2 and 0,5) O
DZIERZANOWSKITE CaCu2S2 R
ALBURNITE Ag8GeTe2S4 C
SPRYITE Ag8(As++3+0,5As+++++0,5)S6 O
With Ni
HEAZLEWOODITE Ni3S2 R
OREGONITE Ni2FeAs2 H
VOZHMINITE (Ni,Co)4(As,Sb)S2 H
ARSENOHAUCHECORNITE Ni9BiAsS8 Q
BISMUTOHAUCHECORNITE Ni9Bi2S8 Q
HAUCHECORNITE Ni9Bi(Sb,Bi)S8 Q
TELLUROHAUCHECORNITE Ni9BiTeS8 Q
TUCEKITE Ni9Sb2S8 Q
ARGENTOPENTLANDITE Ag(Fe,Ni)8S8 C
SUGAKIITE Cu(Fe,Ni)8S8 Q
SHADLUNITE (Pb,Cd)(Fe,Cu)8S8 C
PENTLANDITE (Fe,Ni)9S8 C
MANGANOSHADLUNITE (Mn,Pb,Cd)(Cu,Fe)8S8 C
KHARAELAKHITE (Pt,Cu,Pb,Fe,Ni)9S8 O
GODLEVSKITE (Ni,Fe)7S6 O
COBALTPENTLANDITE (Co,Ni,Fe)9S8 C
GEFFROYITE (Ag,Cu,Fe)9(Se,S)8 C
SAMANIITE Cu2(Fe,Ni)7S8 Q
HOROMANITE (Fe,Ni,Co,Cu)9S8 Q
OBERTHURITE Rh3Ni32S32 C
With Rh, Pd, Pt, etc.
PALLADSEITE Pd17Se15 C
MIASSITE Rh17S15 C
OOSTERBOSCHITE (Pd,Cu)7Se3 O
CHRISSTANLEYITE Ag2Pd3Se4 M
JAGUEITE Cu2Pd3Se4 M
KEITHCONNITE Pd20Te7 R
VASILITE (Pd,Cu)16(S,Te)7 C
TELLUROPALLADINITE Pd9Te4 M
LUBEROITE Pt5Se4 M
OULANKAITE (Pd,Pt)5(Cu,Fe)4SnTe2S2 Q
TELARGPALITE (Pd,Ag)3(Te,Bi) C
TEMAGAMITE Pd3HgTe3 O
SOPCHEITE Ag4Pd3Te4 O
LAFLAMMEITE Pd3Pb2S2 M
TISCHENDORFITE Pd8Hg3Se9 O
COLDWELLITE Pt3Ag2S C
With Hg, Tl
IMITERITE Ag2HgS2 M
GORTDRUMITE Cu24Fe2Hg9S23 A
DANIELSITE (Cu,Ag)14HgS8 O
BALKANITE Cu9Ag5HgS8 O
DONHARRISITE Ni8Hg3S9 M
CARLINITE Tl2S R
BUKOVITE Tl2Cu3FeSe4 Q
MURUNSKITE K2Cu3FeS4 Q
THALCUSITE TlCu3FeS4 Q
ROHAITE Tl2Cu8,5Sb2S4 O
CHALCOTHALLITE (Tl,K)2Cu5,5(Fe,Ag)SbS4 O ps Q
SABATIERITE Cu6TlSe4 O
CROOKESITE Cu7(Tl,Ag)Se4 Q
BRODTKORBITE Cu2HgSe2 M
With Pb (Bi)
BETEKHTINITE Cu10(Fe,Pb)S6 O
FURUTOBEITE (Cu,Ag)6PbS4 M
RHODPLUMSITE Pb2Rh3S2 R
SHANDITE Pb2Ni3S2 R ps C
PARKERITE Ni3(Bi,Pb)2S2 M
SCHLEMAITE (Cu,Ag)6(Pb,Bi)Se4 M
PASAVAITE Pd3Pb2Te2 O
Metal Sulfides, M: S = 1: 1 (and similar)
With Cu
COVELLITE CuS H
KLOCKMANNITE CuSe H
SPIONKOPITE Cu39S28 H
YARROWITE Cu9S8 H
NUKUNDAMITE (Cu,Fe)4S4 H
CALVERTITE Cu5Ge0,5S4 C
With Zn, Fe, Cu, Ag, etc.
AGMANTINITE Ag2MnSnS4 O
HAWLEYITE CdS C
TIEMANNITE HgSe C
STILLEITE ZnSe C
SPHALERITE (Zn,Fe)S C
METACINNABAR HgS C
COLORADOITE HgTe C
RUDASHEVSKYITE (Fe,Zn)S C
SAKURAIITE (Cu,Zn,Fe)3(In,Sn)S4 Q
POLHEMUSITE (Zn,Hg)S Q ps C
LAFORETITE AgInS2 Q
LENAITE AgFeS2 Q
ROQUESITE CuInS2 Q
ESKEBORNITE CuFeSe2 Q
CHALCOPYRITE CuFeS2 Q
GALLITE CuGaS2 Q
MOOIHOEKITE Cu9Fe9S16 Q
PUTORANITE Cu16-18(Fe,Ni)18-19S32 C
TALNAKHITE Cu9(Fe,Ni)8S16 C
HAYCOCKITE Cu4Fe5S8 O
IDAITE Cu5FeS6 H
VELIKITE Cu2HgSnS4 Q
STANNITE Cu2FeSnS4 Q
PIRQUITASITE Ag2ZnSnS4 Q
KESTERITE Cu2(Zn,Fe)SnS4 Q
HOCARTITE Ag2FeSnS4 Q
FERROKESTERITE Cu2(Fe,Zn)SnS4 Q
CERNYITE Cu2CdSnS4 Q
KURAMITE Cu3SnS4 Q
MOHITE Cu2SnS3 A
STANNOIDITE Cu8(Fe,Zn)3Sn2S12 O
CHATKALITE Cu6Fe++Sn2S8 Q
MAWSONITE Cu+6Fe+++2Sn++++S8 Q
STIBIOCOLUSITE Cu26V2(Sb,Sn,As)6S32 C
COLUSITE Cu26V2(As,Sn,Sb)6S32 C
OVAMBOITE Cu10(Fe,Zn,Cu)3W(Ge,As)3S16 C
NEKRASOVITE Cu26V2(Sn,As,Sb)6S32 C
GERMANITE Cu26Fe4Ge4S32 C
GERMANOCOLUSITE Cu26V2(Ge,As)6S32 C
MAIKAINITE Cu10(Fe,Cu)3Mo(Ge,As)3S16 C
RENIERITE (Cu,Zn)11(Ge,As)2Fe4S16 Q ps C
VINCIENNITE Cu10Fe4Sn(As,Sb)S16 Q ps C
POLKOVICITE (Fe,Pb)3(Ge,Fe)1-xS4 C
MOROZEVICZITE (Pb,Fe)3Ge1-xS4 C
KIDDCREEKITE Cu6SnWS8 C
HEMUSITE Cu+4Cu++Sn++++Mo++++S8 C
CATAMARCAITE Cu6GeWS8 H
LAUTITE CuAsS O
BUSECKITE (Fe,Zn,Mn)S H
CADMOSELITE CdSe H
GREENOCKITE CdS H
RAMBERGITE gamma-MnS H
WURTZITE (Zn,Fe)S H
CUBANITE CuFe2S3 O
ISOCUBANITE CuFe2S3 C
PICOTPAULITE TlFe2S3 O
RAGUINITE TlFeS2 O ps H
ARGENTOPYRITE AgFe2S3 O
STERNBERGITE AgFe2S3 O
SULVANITE Cu3VS4 C
VULCANITE CuTe O
EMPRESSITE AgTe O
MUTHMANNITE (Ag,Au)Te O (?)
BROWNEITE MnS C
ISHIHARAITE (Cu,Ga,Fe,In,Zn)S C
LINGBAOITE AgTe3 R
With Ni, Fe, Co, PGE, etc.
CROWNINGSHIELDITE (Ni0,9Fe0,10)S H
JAIPURITE CoS H
NICKELINE NiAs H
ZLATOGORITE CuNiSb2 R
SUDBURYITE (Pd,Ni)Sb H
STUMPFLITE Pt(Sb,Bi) H
SOBOLEVSKITE Pd(Bi,Te) H/M
SEDERHOLMITE beta-NiSe H
KOTULSKITE Pd(Te,Bi) H
LANGISITE (Co,Ni)As H
FREBOLDITE CoSe H
BREITHAUPTITE NiSb H
ACHAVALITE FeSe R
PYRRHOTITE Fe1-xS (x=0-0,17) M/H
SMYTHITE (Fe,Ni)9S11 or (Fe,Ni)13S16 R
TROILITE FeS H
MODDERITE (Co,Fe)As O (?)
RUTHENARSENITE (Ru,Ni)As O
CHEREPANOVITE RhAs O
WESTERVELDITE (Fe,Ni,Co)As O
MAKINENITE gamma-NiSe R
MILLERITE NiS R
MACKINAWITE (Fe,Ni)9S8 Q
HEXATESTIBIOPANICKELITE (Ni,Pd)(Te,Sb) H
VAVRINITE Ni2SbTe2 H
BRAGGITE (Pt,Pd,Ni)S Q
VYSOTSKITE (Pd,Ni)S Q
COOPERITE (Pt,Pd,Ni)S Q
MINAKAWAITE RhSb O
With Sn, Pb, Hg, etc.
HERZENBERGITE SnS O
TEALLITE PbSnS2 O
ALABANDITE Mn++S C
ALTAITE PbTe C
CLAUSTHALITE PbSe C
GALENA PbS C
KEILITE (Fe,Mg)S C
NININGERITE (Mg,Fe++,Mn)S C
OLDHAMITE (Ca,Mg,Fe,Mn)S C
CINNABAR HgS R
HYPERCINNABAR HgS H
Metal Sulfides, M: S = 3 :4 and 2:3
WILKMANITE Ni3Se4 M
M:S = 3:4
BORNHARDTITE Co++Co+++2Se4 C
INDITE Fe++In2S4 C
XINGZHONGITE (Pb,Cu,Fe)(Ir,Pt,Rh)2S4 C
VIOLARITE Fe++Ni+++2S4 C
TYRRELLITE (Cu,Co,Ni)3Se4 C
TRUSTEDTITE Ni3Se4 C
SIEGENITE (Ni,Co)3S4 C
POLYDYMITE NiNi2S4 C
MALANITE Cu(Pt,Ir)2S4 C
LINNAEITE Co++Co+++2S4 C
KALININITE ZnCr2S4 C
FLORENSOVITE (Cu,Zn)(Cr,Sb)2S4 C
FLETCHERITE Cu(Ni,Co)2S4 C
FERRORHODSITE (Fe,Cu)(Rh,Pt,Ir)2S4 C
DAUBREELITE Fe++Cr2S4 C
CUPRORHODSITE CuRh2S4 C
CUPROKALININITE Cu(Cr+++Cr++++)S4 C
CUPROIRIDSITE Cu(Ir+++Ir++++)S4 C
CARROLLITE Cu(Co,Ni)2S4 C
CADMOINDITE CdIn2S4 C
GREIGITE Fe++Fe+++2S4 C
RHODOSTANNITE Cu2FeSn3S8 Q
TOYOHAITE Ag2FeSn3S8 Q
HEIDEITE (Fe,Cr)1+x(Ti,Fe)2S4 M
BREZINAITE Cr3S4 M
INAGLYITE PbCu3(Ir,Pt)8S16 H
KONDERITE PbCu3(Rh,Pt,Ir)8S16 H
KINGSTONITE (Rh,Ir,Pt)3S4 M
ZOLENSKYITE FeCr2S4 M
GRIMMITE NiCo2S4 C
JOEGOLDSTEINITE MnCr2S4 C
NICKELTYRRELLITE CuNi2Se4 C
ZAYKOVITE Rh3Se4 M
M:S = 2:3
ANTIMONSELITE Sb2Se3 O
BISMUTHINITE Bi2S3 O
GUANAJUATITE Bi2Se3 O
METASTIBNITE Sb2S3 am.
PAAKKONENITE Sb2AsS2 M
STIBNITE Sb2S3 O
OTTEMANNITE Sn2S3 O
SUREDAITE PbSnS3 O
BOWIEITE (Rh,Ir,Pt)1,77S3 O
KASHINITE (Ir,Rh)2S3 O
MONTBRAYITE (Au,Ag,Sb,Bi,Pb)23(TeSb,Bi,Pb)38 A
EDGARITE FeNb3S6 H
TARKIANITE (Cu,Fe)(Re,Mo)4S8 C
CAMERONITE Cu5-x(Cu,Ag)3+xTe10 (x = 0,43) Q
Variable M:S
SKIPPENITE Bi2Se2Te R
SZTROKAYITE Bi3TeS2  
TELLURANTIMONY Sb2Te3 R
TELLUROBISMUTHITE Bi2Te3 R
TELLURONEVSKITE Bi3Te(Se,S)2 R
TETRADYMITE Bi2Te2S R
PILSENITE Bi4Te3 R
VIHORLATITE Bi24Se17Te4 R
PROTOJOSEITE Bi3(Te,S)2 H
TSUMOITE BiTe R
HEDLEYITE Bi7Te3 R
SULPHOTSUMOITE Bi3Te2S R
BAKSANITE Bi6(Te2S3) R
PARAGUANAJUATITE Bi2(Se,S)3 R
IKUNOLITE Bi4(S,Se)3 R
INGODITE Bi(S,Te) H
JOSEITE-B Bi4Te2S R
KAWAZULITE Bi2(Te,Se,S)3 R
LAITAKARITE Bi4(Se,S)3 R
NEVSKITE Bi(Se,S) R
HITACHIITE Pb5Bi2Te2S6, R
Metal Sulfides, M: S <= 1:2
M:S = 1:2 - With Cu, Ag, Au
SYLVANITE (Au,Ag)2Te4 M
CALAVERITE AuTe2 M
KOSTOVITE CuAuTe4 O
KRENNERITE Au3AgTe8 O
MERENSKYITE (Pd,Pt)(Te,Bi)2 R
MELONITE NiTe2 R
SHUANGFENGITE IrTe2 R
SUDOVIKOVITE PtSe2 R
KITKAITE NiTeSe R
BERNDTITE SnS2 R/H
MONCHEITE (Pt,Pd)(Te,Bi)2 R
VERBEEKITE PdSe2 M
TUNGSTENITE WS2 H/R
DRYSDALLITE Mo(Se,S)2 H
JORDISITE MoS2 am.
MOLYBDENITE MoS2 H/R
MOLYBDENITE-3R MoS2 R
M:S = 1:2, with Fe, Co, Ni, PGE, etc.
BOWLESITE PtSnS O
GEVERSITE Pt(Sb,Bi)2 C
VILLAMANINITE (Cu,Ni,Co,Fe)S2 C
VAESITE NiS2 C
TROGTALITE CoSe2 C
SPERRYLITE PtAs2 C
PYRITE FeS2 C
PENROSEITE (Ni,Co,Cu)Se2 C
LAURITE RuS2 C
KRUTAITE CuSe2 C
GAOTAIITE Ir3Te8 C
FUKUCHILITE (Cu,Fe)S2 C
ERLICHMANITE OsS2 C
DZHARKENITE FeSe2 C
CATTIERITE CoS2 C
AUROSTIBITE AuSb2 C
HAUERITE MnS2 C
INSIZWAITE Pt(Bi,Sb)2 C
BAMBOLLAITE Cu(Se,Te)2 Q
MATTAGAMITE CoTe2 O
MARCASITE FeS2 O
KULLERUDITE NiSe2 O
FROHBERGITE FeTe2 O
FERROSELITE FeSe2 O
ALLOCLASITE (Co,Fe)AsS M
GLAUCODOT (Co,Fe)AsS O ps C
COSTIBITE CoSbS O
PARACOSTIBITE CoSbS O
PARARAMMELSBERGITE NiAs2 O
OENITE CoSbAs O
ANDUOITE (Ru,Os)As2 O
CLINOSAFFLORITE (Co,Fe,Ni)As2 M
LOLLINGITE FeAs2 O
NISBITE NiSb2 O
OMEIITE (Os,Ru)As2 O
RAMMELSBERGITE NiAs2 O
SAFFLORITE (Co,Fe++)As2 O
SEINAJOKITE (Fe,Ni)(Sb,As)2 O
PAXITE Cu2As3 M ps O
ARSENOPYRITE FeAsS M ps O
RUARSITE RuAsS M
GUDMUNDITE FeSbS M
OSARSITE (Os,Ru)AsS M
MAYINGITE IrBiTe C
HOLLINGWORTHITE (Rh,Pt,Pd)AsS C
WILLYAMITE (Co,Ni)SbS M/A
ULLMANNITE NiSbS A ps C
TOLOVKITE IrSbS C
TESTIBIOPALLADITE Pd(Sb,Te)Te C
PLATARSITE (Pt,Rh,Ru)AsS C
PADMAITE PdBiSe C
MILOTAITE PdSbSe C
MICHENERITE (Pd,Pt)BiTe C
MASLOVITE (Pt,Pd)(Bi,Te)2 C
KRUTOVITE NiAs2 C
KALUNGAITE PdAsSe C
IRARSITE (Ir,Ru,Rh,Pt)AsS C
GERSDORFFITE NiAsS C
COBALTITE CoAsS C
CHANGCHENGITE IrBiS C
JOLLIFFEITE (Ni,Co)AsSe C
URVANTSEVITE Pd(Bi,Pb)2 Q
RHENIITE ReS2 A ps H
PETRICEKITE CuSe2 O
M:S = 1:>2
SKUTTERUDITE (Co,Ni)As3-x C
FERROSKUTTERUDITE (FeCo)As3 C
KIEFTITE CoSb3 C
NICKELSKUTTERUDITE (Ni,Co,Fe)As3 C
PATRONITE VS4 M
Sulfides of arsenic, alkalies; sulfides with halide, oxide, hydroxide, H2O
With As, (Sb), S
DURANUSITE As4S O
DIMORPHITE As4S3 O
REALGAR AsS M
PARAREALGAR AsS M
ALACRANITE As8S9 M
UZONITE As4S5 M
LAPHAMITE As2(Se,S)3 M
ORPIMENT As2S3 M
GETCHELLITE AsSbS3 M
WAKABAYASHILITE As4(As,Sb)6S14 M
BONAZZIITE As4S4 M
ANORPIMENT As2S3 A
With alkalies (without Cl, etc.)
SCHOLLHORNITE Na0,3CrS2.H2O R
CASWELLSILVERITE NaCrS2 R
CRONUSITE Ca0,2(H2O)2CrS2 R
CHVILEVAITE Na(Cu,Fe,Zn)2S2 H
ORICKITE 2CuFeS2.H2O H
PAUTOVITE CsFe2S3 O
RASVUMITE KFe2S3 O
COLIMAITE K3VS4 O
With Cl, Br, I (halide-sulfides)
THALFENISITE (Tl,K)6Na(Fe,Ni,Cu)25S26Cl C
OWENSITE (Ba,Pb)6(Cu,Fe,Ni)25S27 C
DJERFISHERITE K6(Cu,Fe,Ni)24S26Cl C
Cu-DJERFISHERITE K6(Cu,Fe)25S26Cl C
BARTONITE K3Fe10S14 Q
CHLORBARTONITE K6Fe24S26(Cl,S) Q
LAVRENTIEVITE Hg3S2(Cl,Br)2 M/A
ARZAKITE Hg3S2(Br,Cl)2 M/A
CORDEROITE Hg3S2Cl2 C
KENHSUITE gamma-Hg3S2Cl2 O
GRECHISHCHEVITE Hg3S2(Br,Cl,I)2 Q
RADTKEITE Hg3S2ClI O
CAPGARONNITE HgSAg(Cl,Br,I) O
ILTISITE HgSAg(Cl,Br) H
PERROUDITE Hg5Ag4S5(I,Br)2Cl2 O
DEMICHELEITE-(Cl) BiS(Cl,Br)5 O ps Q
DEMICHELEITE-(Br) BiS(Br,Cl)5 O ps Q
ZOHARITE (Ba,K)6(Fe,Cu,Ni)25S27 C
GMALIMITE K6[]Fe++24S27 C
DEMICHELEITE-(I) BiS(I,Br)5 O ps Q
HANAUERITE AgHgSI O
With O, OH, H2O
KERMESITE Sb2S2O A ps M
VIAENEITE (Fe,Pb)4S8O M
ERDITE NaFeS2.2H2O M
COYOTEITE NaFe3S5.2H2O A
VALLERIITE 4(Fe,Cu)S.3(Mg,Al)(OH)2 H
YUSHKINITE VS2(Mg,Al)(OH)2 H
HAAPALAITE 4(Fe,Ni)S.3(Mg,Fe++)(OH)2 H
TOCHILINITE 2(Fe,Ni,Cu)S.1-2(Mg,Fe,Al,Ca)(OH,CO3)1-2 A
WILHELMRAMSAYITE Cu3FeS3.2H2O O
VYALSOVITE FeS.Ca(OH)2.Al(OH)3 O
BAZHENOVITE CaS5.CaS2O3.6Ca(OH)2.20H2O M
FERROVALLERIITE (Fe,Cu)4S4.3[Fe++(OH)2] R
Sulfarsenites, sulfantimonites, sulfbismuthites
Neso-sulfarsenites, etc. without additional S
PROUSTITE Ag3AsS3 R
PYRARGYRITE Ag3SbS3 R
PYROSTILPNITE Ag3SbS3 M
XANTHOCONITE Ag3AsS3 M
SAMSONITE Ag4MnSb2S6 M
SKINNERITE Cu3SbS3 M
WITTICHENITE Cu3BiS3 O
MALYSHEVITE PdCuBiS3 O
LAPIEITE CuNiSbS3 O
MUCKEITE CuNiBiS3 O
LISIGUANGITE CuPtBiS3 O
NOWACKIITE Cu6Zn3As4S12 R
AKTASHITE Cu6Hg3As4S12 A
GRUZDEVITE Cu6Hg3Sb4S12 R
LAFFITTITE AgHgAsS3 M
ROUTHIERITE TlCu(Hg,Zn)2(As,Sb)2S6 Q
STALDERITE (Tl,Cu)(Zn,Fe,Hg)2As2S6 Q
ERNIGGLIITE Tl2SnAs2S6 H
BOURNONITE PbCuSbS3 O
SELIGMANNITE PbCuAsS3 O
SOUCEKITE PbCuBi(S,Se)3 O
FERROSTALDERITE Tl(Cu,Ag)(Fe,Zn)2As2S6 M
RALPHCANNONITE AgZn2TlAs2S6 Q ps C
CERROMOJONITE CuPbBiSe3 O
ARSICCIOITE AgHg2Tl(As,Sb)2S6 Q
BYTIZITE Cu3SbSe3 O
ROTERBARITE PdBiCuSe3 O
ECKERITE Ag2CuAsS3 M
Neso-sulfarsenites, etc. with additional S
TETRAHEDRITE-(Ni) Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 Cu6(Cu4Ni2)Sb4S13 C
TENNANTITE-(Ni) Cu6(Cu4Ni2)As4S13 C
STIBIOGOLDFIELDITE Cu6Cu6(Sb2Te2)S13 C
HAKITE-(Hg) Cu6(Cu4Hg2)Sb4Se13 C
HAKITE-(Zn) Cu6(Cu4Zn2)Sb4Se13 C
KENOARGENTOTENNANTITE-(Fe) Ag6(Cu4Fe2)As4S12[] C
POSEPNYITE (Cu+3[]3)(Hg++4Cu+2)Sb4Se12(Se0,5[]0,5) C
ROZHDESTVENSKAYAITE-(Fe) Ag6(Ag4Fe2)Sb4S13 C
ROZHDESTVENSKAYAITE-(Zn) Ag6(Ag4Zn2)Sb4S13 C
TENNANTITE-(Cu) Cu6(Cu4Cu2)As4S13 C
TENNANTITE-(Hg) Cu6(Cu4Hg2)As4S13 C
HAKITE-(Fe) Cu6(Cu4Fe2)Sb4Se13 C
ARGENTOTETRAHEDRITE-(Fe) Ag6(Cu4Fe2)Sb4S13 C
ROZHDESTVENSKAYAITE-(Hg) Ag6(Ag4Hg2)Sb4S13 C
HAKITE-(Cu) Cu6(Cu4Cu2)Sb4Se13 C
HAKITE-(Cd) Cu6(Cu4Cd2)Sb4Se13 C
GOLDFIELDITE (Cu4[]2)Cu6Te4S13 C
GIRAUDITE-(Zn) Cu6(Cu4Zn2)As4Se13 C
GIRAUDITE-(Hg) Cu6(Cu4Hg2)As4Se13 C
GIRAUDITE-(Fe) Cu6(Cu4Fe2)As4Se13 C
GIRAUDITE-(Cu) Cu6(Cu4Cu2)As4Se13 C
ARGENTOTETRAHEDRITE-(Hg) Ag6(Cu4Hg2)Sb4S13 C
TENNANTITE-(Mn) Cu6(Cu4Mn2)As4S13 C
ARGENTOTETRAHEDRITE-(Cd) Ag6(Cu4Cd2)Sb4S13 C
ARGENTOTENNANTITE-(Zn) Ag6(Cu4Zn2)As4S13 C
ARGENTOTENNANTITE-(Fe) Ag6(Cu4Fe2)As4S13 C
ARGENTOTETRAHEDRITE-(Zn) Ag6(Cu4Zn2)Sb4S12S C
TETRAHEDRITE-(Cu) Cu6(Cu4Cu2)Sb4S13 C
TETRAHEDRITE-(Hg) Cu6(Cu4Hg2)Sb4S13 C
TETRAHEDRITE-(Mn) Cu6(Cu4Mn2)Sb4S13 C
TETRAHEDRITE-(Zn) Cu6(Cu4Zn2)Sb4S13 C
ZVESTOVITE-(Zn) Ag6(Ag4Zn2)As4S13 C
TETRAHEDRITE-(Cd) Cu6(Cu4Cd2)Sb4S13 C
SELENOSTEPHANITE Ag5Sb(Se,S)4 O
STEPHANITE Ag5SbS4 O
CUPROPOLYBASITE Ag9Cu7(Sb,As)2S11 R
SELENOPOLYBASITE Cu(Ag,Cu)6Ag9(Sb,As)2(S,Se)9Se2 R
PEARCEITE [(Ag8CuS4)][(AgCu)6(As,Sb)2S7] M
CUPROPEARCEITE Ag9Cu7(As,Sb)2S11 R
POLYBASITE [(Ag8CuS4)][(AgCu)6(Sb,As)2S7] M ps H
GALKHAITE (Cs,Tl)(Hg,Cu,Zn)6(As,Sb)4S12 C
POSEPNYITE (Cu+++[]3)(Hg++4Cu+2)Sb4Se12(Se0,5[]0,5) C
ARGENTOPEARCEITE Ag16As2S11 A
Poly-sulfarsenites
HATCHITE (Pb,Tl)2AgAs2S5 A
WALLISITE PbTl(Cu,Ag)As2S5 A
SINNERITE Cu6As4S9 A
WATANABEITE Cu4(As,Sb)2S5 O ps C
SIMONITE TlHgAs3S6 M
MANGANOQUADRATITE AgMnAsS3 Q
QUADRATITE Ag(Cd,Pb)(As,Sb)S3 Q
SMITHITE AgAsS2 M
TRECHMANNITE AgAsS2 R
ALEKSITE PbBi2Te2S2 R
KOCHKARITE PbBi4Te7 R
POUBAITE PbBi2(Te,S)2Se2 R
RUCKLIDGEITE (Bi,Pb)3Te4 R
SADDLEBACKITE Pb2Bi2Te2S3 H
BABKINITE Pb2Bi2(S,Se)3 R
TVALCHRELIDZEITE Hg3SbAsS3 A
MUTNOVSKITE Pb2AsS3(I,Cl,Br) O
Sulfosalts of SnS archetype
With Cu, Ag, Fe (without Pb)
EMPLECTITE CuBiS2 O
CHALCOSTIBITE CuSbS2 O
MIARGYRITE AgSbS2 M
BERTHIERITE FeSb2S4 O
CLERITE MnSb2S4 O
GARAVELLITE FeSbBiS4 O
ARAMAYOITE Ag3Sb2BiS6 A
BAUMSTARKITE Ag3Sb2SbS6 A
With Cu, Ag, Fe, Sn and Pb
SALZBURGITE Cu1,6Pb1,6Bi6,4S12 O
PAARITE Cu1,7Pb1,7Bi6,3S12 O
LINDSTROMITE Cu3Pb3Bi7S15 O
KRUPKAITE PbCuBi3S6 O
HAMMARITE Pb2Cu2Bi4S9 O
GLADITE CuPbBi5S9 O
FRIEDRICHITE Pb5Cu5Bi7S18 O
PEKOITE PbCuBi11(S,Se)18 O
AIKINITE PbCuBiS3 O
EMILITE Cu2,68Pb2,68Bi5,32S12 O
MENEGHINITE Pb13CuSb7S24 O
JASKOLSKIITE Pb2+xCux(Sb,Bi)2-xS5 (x=0,2) O
KOBELLITE Pb22Cu4(Bi,Sb)30S69 O
TINTINAITE Pb22Cu+4(Sb,Bi)30S69 O
GIESSENITE 2(Cu2Pb26(Bi,Sb)20S57) M
IZOKLAKEITE Pb27(Cu,Fe)2(Sb,Bi)19S57 O
ECLARITE Pb9(Cu,Fe)Bi12S28 O
JAMESONITE Pb4FeSb6S14 M
BENAVIDESITE Pb4(Mn,Fe)Sb6S14 M
NAGYAGITE (Au,Te)3Pb3(Pb,Sb,Bi)3S6 M
BUCKHORNITE AuTe2Pb2BiS3 O
MUSEUMITE AuTe2Pb5SbS12 M
BERRYITE Cu3Ag2Pb3Bi7S16 M
LITOCHLEBITE PbAg2Bi4Se8 M
WATKINSONITE Cu2PbBi4Se8 M
CARDUCCIITE Pb6Ag(As,Sb)9S20 M
BARIKAITE Pb10Ag3As11Sb8S40 M
PHILROTHITE TlAs3S5 M
DEKATRIASARTORITE TlPb58As97S204 M
ENNEASARTORITE Tl6Pb32As70S140 M
HENDEKASARTORITE Tl2Pb48As82S172 M
HEPTASARTORITE Tl7Pb22As55S108 M
HYRSLITE Pb8As10Sb6S32 M
With only Pb
GUETTARDITE Pb(Sb,As)2S4 M
SARTORITE PbAs2S4 M
TWINNITE Pb(Sb,As)2S4 O
ARGENTOBAUMHAUERITE Ag1,5Pb22As33,5S72 A
BAUMHAUERITE Pb3As4S9 A
LIVEINGITE Pb9As13S28 M
DUFRENOYSITE Pb2As2S5 M
RATHITE (Pb,Tl)3As5S10 M
VEENITE Pb2(Sb,As)2S5 O
CHABOURNEITE AgzTl8-x-zPb4+2xSb40-x-yAsyS68 A
DALNEGROITE Tl5-xPb2x(As,Sb)21-xS34 A
PARAPIERROTITE Tl(Sb,As)5S8 M
PIERROTITE Tl2Sb6As4S16 O
MARUMOITE Pb8As10S23 M ps O
FULOPPITE Pb3Sb8S15 M
PLAGIONITE Pb5Sb8S17 M
HETEROMORPHITE Pb7Sb8S19 M
RAYITE (Ag,Tl)2Pb8Sb8S21 M
SEMSEYITE Pb9Sb8S21 M
BOULANGERITE Pb5Sb4S11 M
FALKMANITE Pb5Sb4S11 M
ROBINSONITE Pb4Sb6S13 A
MOELOITE Pb6Sb6S14(S3) O
DADSONITE Pb23Sb25S60Cl A ps M
ZOUBEKITE AgPb4Sb4S10 O
OWYHEEITE Pb7Ag2(Sb,Bi)8S20 O
PARASTERRYITE Pb20Ag4(Sb,As)24S58 M
BERNARLOTTIITE Pb6As5Sb3S18 A
ARGENTOLIVEINGITE Ag3+xPb36-2xAs51+xS112 A
ECRINSITE AgTl3Pb4As11Sb9S36 A
INCOMSARTORITE Tl6Pb144As246S516 M
LOPATKAITE Pb5Sb3AsS11 M
POLLONEITE AgPb46As26Sb23S120 M
ARGENTODUFRENOYSITE Ag3Pb26As35S80 A
With Tl
WEISSBERGITE TlSbS2 A
LORANDITE TlAsS2 M
CHRISTITE TlHgAsS3 M
JANKOVICITE Tl5Sb9(As,Sb)4S22 A
REBULITE Tl5Sb5As8S22 M
IMHOFITE Tl6CuAs16S40 M
EDENHARTERITE TlPbAs3S6 O
JENTSCHITE TlPbAs2SbS6 M
HUTCHINSONITE (Pb,Tl)2As5S9 O
BERNARDITE Tl(As,Sb)5S8 M
SICHERITE TlAg2(As,Sb)3S6 O
GABRIELITE Tl2AgCu2As3S7 A ps H
BOSCARDINITE (Tl,Ag)Pb4Sb7As2S18 A
With alkalies, H2O
GERSTLEYITE Na2(Sb,As)8S13.2H2O M
AMBRINOITE (K,NH4)2(As,Sb)8S13.H2O A
With SnS and PbS archetype structure units
VRBAITE Tl4Hg3Sb2As8S20 O
ABRAMOVITE Pb2SnInBiS7 A ps Q
CYLINDRITE Pb4Fe++Sn++++4Sb+++2S16 A
LEVYCLAUDITE Pb8Sn7Cu3(Bi,Sb)3S28 M ps Q/H
FRANCKEITE (Pb,Sn++)6Sn++++2FeSb2S14 A
COIRAITE (Pb,Sn++)12,5Fe++Sn++++5As3S28 M ps Q/H
LENGENBACHITE Pb6(Ag,Cu)2As4S13 A
Sulfosalts of PbS archetype
Galena derivatives with little or no Pb
DANTOPAITE (Ag,Cu)5(Bi,Pb)13S22 M
CUPROMAKOPAVONITE Cu8Ag3Pb4Bi19S38 M
CUPROPAVONITE AgPbCu2Bi5S10 M
PAVONITE (Ag,Cu)(Bi,Pb)3S5 M
GRUMIPLUCITE HgBi2S4 M
KUDRIAVITE (Cd,Pb)Bi2S4 M
CUPROMAKOVICKYITE Cu4AgPb2Bi9S18 M
MAKOVICKYITE (Ag,Cu)1,5(Bi,Pb)5,5S9 M
BENJAMINITE (Ag,Cu)3(Bi,Pb)7S12 M
MUMMEITE Cu0,58Ag3,11Pb1,10Bi6,65S13 M
BORODAEVITE Ag5(Bi,Sb)9S16 M
MOZGOVAITE PbBi4(S,Se)7 O
LIVINGSTONITE HgSb4S6(S2) M
CUPROBISMUTITE Cu10Bi12S23 M
KUPCIKITE Cu3,4Fe0,6Bi5S10 M
HODRUSITE Cu8Bi12S22 M
PIZGRISCHITE Cu14(Cu,Fe)PbBi17S35 M
PADERAITE AgPb2Cu6Bi11S22 M
CUBOARGYRITE AgSbS2 C
SCHAPBACHITE AgBiS2 C
BOHDANOWICZITE AgBiSe2 H
MATILDITE AgBiS2 H
VOLYNSKITE AgBiTe2 O
LUBORZAKITE Mn2AsSbS5 M
Galena derivatives, with Pb
DIAPHORITE Pb2Ag3Sb3S8 M
COSALITE Pb2Bi2S5 O
MARRITE PbAgAsS3 M
FREIESLEBENITE AgPbSbS3 M
CANNIZZARITE Pb4Bi5S11 M
WITTITE Pb3Bi4(S,Se)9 M
ANGELAITE Cu2AgPbBiS4 M
JUNOITE Pb3Cu2Bi8(S,Se)16 M
FELBERTALITE Cu2(Pb,Ag)6Bi8S19 M
NORDSTROMITE Pb3CuBi7(S10Se4) M
PROUDITE (Pb,Cu)8Bi9-10(S,Se)22 M
NUFFIELDITE Pb2Cu(Pb,Bi)Bi2S7 O
WEIBULLITE (Pb,Ag)6Bi8(S,Se)18 O
NEYITE Pb7(Cu,Ag)2Bi6S17 M
CUPRONEYITE Cu7Pb27Bi25S68 M
ROUXELITE Cu2HgPb22Sb28S64(O,S)2 M
GEOCRONITE Pb14(Sb,As)6S23 M
JORDANITE Pb14(As,Sb)6S23 M
KIRKIITE Pb10Bi3As3S19 O/M
TSUGARUITE Pb28As15S50Cl O
ZINKENITE Pb9Sb22S42 H
SCAINIITE Pb14Sb30S54O5 M
PILLAITE Pb9Sb10S23ClO0,5 M
PELLOUXITE (Cu,Ag)2Pb21Sb23S55OCl M
CHOVANITE Pb14,6Sb14,4S36O0,2 M
TUBULITE Ag2Pb22Sb20S53 M
LILLIANITE Pb3Bi2S6 O
XILINGOLITE Pb3Bi2S6 M
UCHUCCHACUAITE AgPb3MnSb5S12 M ps O
GUSTAVITE PbAgBi3S O
VIKINGITE Ag5Pb8Bi13S30 M
TREASURITE Ag7Pb6Bi15S32 M
ROSHCHINITE Ag19Pb10Sb51S96 or Pb(Ag,Cu)2(Sb,As)5S10 O
FIZELYITE Ag5Pb14Sb21S48 M
ANDORITE IV Pb18Ag15Sb47S96 M
RAMDOHRITE Pb5,9Fe0,1Mn0,1In0,1Cd0,2Ag2,8Sb10,8S24 M
ASCHAMALMITE Pb6Bi2S9 M
ESKIMOITE Ag7Pb10Bi15S36 M
HEYROVSKYITE Pb10AgBi5S18 O
OURAYITE Ag3Pb4Bi5S13 O
SCHIRMERITE PbAgBi3S6 - Pb3Ag1,5Bi3,5S9 O
USTARASITE Pb(Bi,Sb)6S10 O (?)
GRATONITE Pb9As4S15 R
MARRUCCIITE Pb16Hg3Sb18S46 M ps H
VURROITE Pb10Sn(Bi,As)11S27Cl3 ps O
STAROCESKEITE Ag0,70Pb1,60(Bi1,35Sb1,35)S6 O
OSCARKEMPFFITE Ag10Pb4(Sb17Bi9)S48 O
MENCHETTIITE Pb5Ag2Mn3As4Sb6S24 M
TERRYWALLACEITE AgPb(Sb,Bi)3S6 M
JASROUXITE Ag16Pb4(Sb24As16)S72 A
CLINOOSCARKEMPFFITE Ag15Pb6Sb21Bi18S72 M
OYONITE Ag3Mn2Pb4Sb7As4S24 M
ANDORITE VI PbAgSb3S6 O
ANDREADINIITE CuAg7HgPb7Sb24S48 M
ARSENQUATRANDORITE Ag17,6Pb12,8Sb38,1As11,5S96 M
ERZWIESITE Ag8Pb12Bi16S40 O
Galena derivatives, with Tl
ELLISITE Tl3AsS3 R
GILLULYITE Tl2(As,Sb)8S13 M
GALENOBISMUTITE PbBi2S4 O
Sulfarsenates, Sulfantimonates
Sulfarsenates with (As,Sb)S4 tetrahedra
ENARGITE Cu3AsS4 O
PETRUKITE (Cu,Fe,Zn)2(Sn,In)S4 O
BARQUILLITE Cu2(Cd,Fe)GeS4 Q
BRIARTITE Cu2(Zn,Fe)GeS4 Q
FAMATINITE Cu3SbS4 Q
LUZONITE Cu3AsS4 Q
PERMINGEATITE Cu3SbSe4 Q
FANGITE Tl3AsS4 O
Sulfarsenates with additional S
BILLINGSLEYITE Ag7AsS6 C
Unclassified Sulfosalts
Without essential Pb
DERVILLITE Ag2AsS2 M
DAOMANITE CuPtAsS2 O
VAUGHANITE TlHgSb4S7 A
CRIDDLEITE TlAg2Au3Sb10S10 M ps Q
FETTELITE Ag164HgAs4S15 R ps H
CHAMEANITE (Cu,Fe)4As(Se,S)4 C
ARCUBISITE Ag6CuBiS4 (?)
MGRIITE Cu3AsSe3 C
BENLEONARDITE Ag15Cu(Sb,As)2S7Te4 Q
TSNIGRIITE Ag9SbTe3(S,Se)3 M
BOROVSKITE Pd3SbTe4 C
JONASSONITE Au(Bi,Pb)5S4 M
AUERBAKHITE MnTl2As2S5 O
BIAGIONIITE Tl2SbS2 M
GLADKOVSKYITE MnTlAs3S6 A
With essential Pb
MIHARAITE PbCu4FeBiS6 O
STERRYITE Ag2Pb10(Sb,As)12S29 O
SORBYITE Pb19(Sb,As)20S49 M
PLAYFAIRITE Pb16Sb18S43 M
MADOCITE Pb17(Sb,As)16S41 O
LAUNAYITE Pb22Sb26S61 M
ARDAITE Pb19Sb13S35Cl7 M
LAROSITE (Cu,Ag)21(Pb,Bi)2S13 O
MAZZETTIITE Ag3HgPbSbTe5 O
PETROVICITE PbHgCu3BiSe5 O
CRERARITE (Pt,Pb)Bi3(S,Se)4-x (x=0,7) C
CIRIOTTIITE Cu(Cu,Ag)3Pb19(Sb,As)22(As2)S56 M
Oxysulfosalts
Oxysulfosalts of Alkalies and Alkali Earths
CETINEITE (K,Na)3-3,5(Sb2O3)(SbS3)(OH)x.2,5-3H2O (x = less than 0,5) H
OTTENSITE Na3(Sb2O3)3(SbS3).3H2O H
SARABAUITE CaSb10O10S6 M
Sulfides, etc. unclassified
SHIMENITE Tl5Sb21-yAsyS34 (y between 9 and 10) A
DEWITITE AgzTl10-x-zPb2xSb42-x-yAsyS68 A
RADVANICEITE GeS2 M
TAMURAITE Ir5Fe10S16 R
SLUZHENIKINITE Pd15(Sb7-xSnx) (x between 3 and 4) M
KENOARGENTOTETRAHEDRITE-(Zn) Ag6(Cu4Zn2)Sb4S12[] C
MAKOTOITE Ag12(Cu3Au)S8 R
STIBIOGOLDFIELDITE Cu6Cu6(Sb2Te2)S13 C
PRIBRAMITE CuSbSe2 O
PROTOCHABOURNEITE Tl4-xPb2+2xSb20-x-yAsyS34 A
PYRADOKETOSITE Ag3SbS3 M
RABERITE Tl5Ag4As6SbS15 A
ZNAMENSKYITE Pb4In2Bi4S13 O
RATHITE IV (Pb,Tl)3As5S10  
POKHODYASHINITE Cu2Tl3Sb5As2S13 A
RICHARDSOLLYITE TlPbAsS3 M
MERELANIITE Mo4Pb4VSbS15 A (?)
RUMOIITE AuSn2 O
ZINCOBRIARTITE Cu2(Zn,Fe)(Ge,Ga)S4 Q
PANSKYITE Pd9Ag2Pb2S4 Q
PAMPALOITE AuSbTe M
OMARINIITE Cu8Fe2ZnGe2S12 O
WASSONITE TiS R
OGNITITE NiBiTe R
NUWAITE Ni6GeS2 Q
NIPALARSITE Ni8Pd3As4 C
MURCHISITE Cr5S6 R
MONCHETUNDRAITE Pd2NiTe2 O
SANGENAROITE Ag8(Sb8-xAsx)S16 (x between = and 2) M
PALLADOTHALLITE Pd3Tl Q
TETRAHEDRITE-(Fe) Cu6(Cu4Fe2)Sb4S13 C
MEERSCHAUTITE Pb42(Ag,Cu)6(Sb,As)45S112 M
ZACCARINIITE RhNiAs Q
YEOMANITE Pb2O(OH)Cl O
WUYANZHIITE Cu2S Q
RAMOSITE Pb25,7Sn8,3Mn3,4Sb6,4S56,2 M
VYMAZALOVAITE Pd3Bi2S2 C
TSYGANKOITE Mn8Tl8Hg2(Sb21Pb2Tl)S48 M
TORRYWEISERITE Rh5Ni10S16 R
TILKERODEITE Pd2HgSe3 R
VORONTSOVITE (Hg5Cu)TlAs4S12 C
THALHAMMERITE Pd9Ag2Bi2S4 Q
SELENOLAURITE RuSe2 C
TENNANTITE-(Zn) Cu6(Cu4Zn2)As4S13 C
TENNANTITE-(Fe) Cu6(Cu4Fe2)As4S13 C
TAZIEFFITE Pb20Cd2(As,Bi)22S50Cl10 M
SVETLANAITE SnSe O
STANGERSITE SnGeS3 M
SPIRIDONOVITE (Cu1-xAgx)2Te R
SPALTIITE Tl2Cu2As2S5 M
SHOSANBETSUITE Ag3Sn O
SHENZHUANGITE NiFeS2 Q
THUNDERBAYITE TlAg3Au3Sb7S6 A
DISULFODADSONITE Pb11Sb13S30(S2)0,5 A
GRATIANITE (Mn,Fe)Bi2S4 M
FLEETITE Cu2RhIrSb2 C
FERROVORONTSOVITE (Fe5Cu)TlAs4S12 C
FERROTOCHILINITE (FeS)6.5[Fe++(OH)2] M
FERHODSITE (Fe,Rh,Ni,Ir,Cu,Pt)9S8 T
FERDOWSIITE Ag8(Sb5As3)S16 M
ERAZOITE Cu4SnS6 R
ELIOPOULOSITE V7S8 R
ELDRAGONITE Cu6BiSe6 O
GROKHOVSKYITE CuCrS2 R
DRECHSLERITE Tl4(Sb4-xAsx)S8 A
ARSENOTUCEKITE Ni18Sb3AsS16 Q
DEBATTISTIITE Ag9Hg0,5As6S12Te2 A
DALIRANITE PbHgAs2S5 M
CHUKOTKAITE AgPb7Sb5S15 M
CASTAINGITE CuMo2S5 H
BUTIANITE Ni6SnS2 Q
BAYANKHANITE Cu3-8HgS3-5 H?
ARSENOGOLDFIELDITE Cu6Cu6(As2Te2)S13 C
RICHARDSITE Zn2CuGaS4 Q
MARCOBALDIITE Pb12Sb3As2BiS21 A
EKPLEXITE (Nb,Mo,W)S2.(Mg1-xAlx)(OH)2+x R
KRAVTSOVITE PdAg2S O
MARATHONITE Pd25Ge9 R
MANGANOKASKASITE (Mo,Nb)S2.(Mn1-xAlx)(OH)2+x R
ARSENMARCOBALDIITE Pb12As3,2Sb2,8)S21 A
MALETOYVAYAMITE Au3Se4Te6 A
LUXEMBOURGITE AgCuPbBi4Se8 M
LUKKULAISVAARAITE Pd14Ag2Te9 Q
GRUNDMANNITE CuBiSe2 O
KURILITE Ag8Te3Se R
KOJONENITE Pd7-xSnTe2 (x between 0,3 and 0,8) Q
KEUTSCHITE Cu2AgAsS4 Q
HRABAKITE Ni9PbSbS8 Q
GUNGERITE TlAs5Sb4S13 O
KUVAEVITE Ir5Ni10S16 R
HONEAITE Au3TlTe2 O
KENOARGENTOTETRAHEDRITE-(Fe) Ag6(Cu4Fe2)Sb4S12[] C
IRIDISITE (Ir,Cu,Rh,Ni,Pt)S2 ps C
JACUTINGAITE (Pt,Pd)2HgSe3 R
JASZCZAKITE [Bi3S3][AuS2] O
JOSEITE-A Bi4TeS2 R
KALGOORLIEITE As2Te3 M
KASKASITE (Mo,Nb)S2.(Mg1-xAlx)(OH)2+x R
HANSBLOCKITE (Cu,Hg)(Bi,Pb)Se2 M
* HALIDES
Simple halides, without H2O
FLINTEITE K2ZnCl4 O
OSKARSSONITE AlF3 R
WAIMIRITE-(Y) YF3 O
M:X = 1:1, 2:3, 3:5, etc.
NANTOKITE CuCl C
MARSHITE CuI C
MIERSITE (Ag,Cu)I C
IODARGYRITE AgI H
TOCORNALITE (Ag,Hg)I (?)
BROMARGYRITE AgBr C
CHLORARGYRITE AgCl C
CAROBBIITE KF C
GRICEITE LiF C
HALITE NaCl C
SYLVITE KCl C
VILLIAUMITE NaF C
LAFOSSAITE Tl(Cl,Br) C
SALAMMONIAC NH4Cl C
KUZMINITE Hg2(Br,Cl)2 Q
MOSCHELITE Hg+2I2 Q
CALOMEL Hg2Cl2 Q
NEIGHBORITE NaMgF3 O
CHLOROCALCITE KCaCl3 O ps C
KOLARITE PbTeCl2 O
RADHAKRISHNAITE PbTe3(Cl,S)2 Q
CHALLACOLLOITE KPb2Cl5 M
HEPHAISTOSITE (Tl,K)Pb2(Cl,Br)5 M
PARASCANDOLAITE KMgF3 C
BRONTESITE (NH4)3PbCl5 O
M:X = 1:2
TOLBACHITE CuCl2 M
COCCINITE HgI2 Q
SELLAITE MgF2 Q
SCACCHITE MnCl2 R
CHLOROMAGNESITE MgCl2 Q
LAWRENCITE (Fe++,Ni)Cl2 R
FRANKDICKSONITE BaF2 C
STRONTIOFLUORITE (Sr,Ca)F2 C
FLUORITE CaF2 C
TVEITITE-(Y) Ca1-xYxF2+x M ps C
GAGARINITE-(Ce) NaCaCeF6 R
GAGARINITE-(Y) NaCaY(F,Cl)6 H
POLEZHAEVAITE-(Ce) NaSrCeF6 H
FLUOROCRONITE PbF2 C
M:X = 1:3
ZHARCHIKHITE AlF(OH)2 M
MOLYSITE Fe+++Cl3 H
FLUOCERITE-(Ce) (Ce,La)F3 H
FLUOCERITE-(La) (La,Ce)F3 H
GANANITE BiF3 C
Simple halides, with H2O
M:X = 1:1 and 2:3
HYDROHALITE NaCl.2H2O M
CARNALLITE KMgCl3.6H2O O
M:X = 1:2
ERIOCHALCITE CuCl2.2H2O O
ROKUHNITE Fe++Cl2.H2O M
BISCHOFITE MgCl2.6H2O M
NICKELBISCHOFITE NiCl2.6H2O M
SINJARITE CaCl2.2H2O Q
ANTARCTICITE CaCl2.6H2O R
TACHYHYDRITE CaMg2Cl6.12H2O R
M:X = 1:3
CHLORALUMINITE AlCl3.6H2O R
Simple halides with H2O and additional OH
CADWALADERITE Al5(H2O)3(OH)12.n(Cl,H2O) am.
KORSHUNOVSKITE Mg2Cl(OH)3.3,5-4H2O A
NEPSKOEITE Mg4(OH)7Cl.6H2O O
KOENENITE Na4Mg9Al4Cl12(OH)22 R
Complex halides
AMMINEITE Cu(NH3)2Cl2 O
Borofluorides
FERRUCCITE NaBF4 O
AVOGADRITE (K,Cs)BF4 O
BARBERIITE (NH4)BF4 O
Neso-aluminofluorides
CRYOLITHIONITE {Na3}[Al2](Li3)F12 C
CRYOLITE Na3AlF6 M
ELPASOLITE K2NaAlF6 C
SIMMONSITE Na2LiAlF6 M (?)
COLQUIRIITE CaLiAlF6 R
WEBERITE Na2MgAlF7 O
KARASUGITE SrCaAl(F,OH)7 M
USOVITE Ba2CaMgAl2F14 M
PACHNOLITE NaCaAlF6.H2O M
THOMSENOLITE NaCaAlF6.H2O M
CARLHINTZEITE Ca2AlF7.H2O A ps M
YAROSLAVITE Ca3Al2F10(OH)2.H2O O
Soro-aluminofluorides
GEARKSUTITE CaAlF4(OH).H2O M
ACUMINITE SrAlF4(OH).H2O M
TIKHONENKOVITE SrAlF4(OH).H2O M
ARTROEITE PbAlF3(OH)2 A
JORGENSENITE Na2(Sr,Ba)14Na2Al12F64(OH,F)4 M
CALCJARLITE Na(Ca,Sr)3Al3(F,OH)16 M
JARLITE Na(Sr,Na)7MgAl6F32(OH,H2O)2 M
Ino-aluminofluorides
ROSENBERGITE AlF3.3H2O Q
PROSOPITE CaAl2(F,OH)8 M
Phyllo-aluminofluorides
CHIOLITE Na5Al3F14 Q
Tekto-aluminofluorides
HYDROKENORALSTONITE Na0,5(Al,Mg)2(F,OH)6.H2O C
BOGVADITE Na2SrBa2Al4F20 O
Aluminofluorides with CO3, SO4, PO4
CHUKHROVITE-(Ca) Ca4,5Al2(SO4)F13.12H2O C
STENONITE (Sr,Ba,Na)2Al(CO3)F5 M
CHUKHROVITE-(Ce) Ca3(Ce,Y)Al2(SO4)F13.10H2O C
CHUKHROVITE-(Nd) Ca3(Nd,Y)Al2(SO4)F13.12H2O C
CHUKHROVITE-(Y) Ca3(Y,Ce)Al2(SO4)F13.10H2O C
MENIAYLOVITE Ca4AlSi(SO4)F13.12H2O C
CREEDITE Ca3Al2(SO4)(F,OH)10.2H2O M
BOGGILDITE Sr2Na2Al2(PO4)F9 M
THERMESSAITE-(NH4) (NH4)2AlF3(SO4) O
THERMESSAITE K2Al(SO4)F3 O
Silicofluorides
MALLADRITE Na2SiF6 R
BARARITE (NH4)2SiF6 H
HIERATITE K2SiF6 C
CRYPTOHALITE (NH4)2SiF6 C
DEMARTINITE K2SiF6 H
KNASIBFITE K3Na4BF4(SiF6)3 O
KNASIBFITE K3Na4[SiF6]3[BF4] O
With MX6 complexes; M = Fe, Mn, Cu
CHLORMANGANOKALITE K4MnCl6 R
RINNEITE K3NaFe++Cl6 R
ERYTHROSIDERITE K2Fe+++Cl5.H2O O
KREMERSITE (NH4,K)2Fe+++Cl5.H2O O
MITSCHERLICHITE K2CuCl4.2H2O Q
DOUGLASITE K2Fe++Cl4.2H2O M
ZIRKLERITE (Fe++,Mg)9Al4Cl18(OH)12.14H2O (?) R
SALTONSEAITE K3NaMnCl6 R
Halides of Bi, etc.
STEROPESITE Tl3Bi(Cl,Br)6 M
Oxyhalides, hydroxyhalides and related double halides
CABVINITE Th2F7(OH).3H2O Q
With Cu, etc., without Pb
MELANOTHALLITE Cu2OCl2 O
KEMPITE Mn2Cl(OH)3 O
ATACAMITE Cu2Cl(OH)3 O
HIBBINGITE (Fe,Mg)2(OH)3Cl O
BELLOITE Cu(OH)Cl M
BOTALLACKITE Cu2Cl(OH)3 M
CLINOATACAMITE Cu++2Cl(OH)3 M
PARATACAMITE Cu3(Cu,Zn)(OH)6Cl2 R
KAPELLASITE Cu3Zn(OH)6Cl2 R
GILLARDITE Cu3NiCl2(OH)6 R
HAYDEEITE Cu3MgCl2(OH)6 R
HERBERTSMITHITE Cu3Zn(OH)6Cl2 R
BARLOWITE Cu4BrF(OH)6 H
CLARINGBULLITE Cu++4FCl(OH)6 H
SIMONKOLLEITE Zn5(OH)8Cl2.H2O H
BUTTGENBACHITE Cu19Cl4(NO3)2(OH)32.2H2O H
CONNELLITE Cu19Cl4(SO4)(OH)32.2H2O H
ABHURITE Sn++21Cl16(OH)14O6 R
PONOMAREVITE K4Cu++4OCl10 M
ANTHONYITE Cu(OH,Cl)2.3H2O M
CALUMETITE CaCu4(OH)8Cl2.3,5H2O O
KHAIDARKANITE Cu4Al3(OH)14F3.2H2O M
BOBKINGITE Cu++5Cl2(OH)8.2H2O M
AVDONINITE K2Cu5(OH)4Cl8.H2O M
DRONINOITE Ni6Fe+++2(OH)16Cl2.4H2O R
PARAHIBBINGITE Fe++2(OH)3Cl R
CENTENNIALITE CaCu3Cl2(OH)6.nH2O (n near 0.7) R
FEODOSIYITE Cu11Mg2Cl18(OH)8.16H2O M
LEVERETTITE Cu3(Co,Cu)(OH)6Cl2 R
MISAKIITE Cu3Mn(OH)6Cl2 R
PARATACAMITE-(Mg) Cu3(Mg,Cu)(OH)6Cl2 R
PARATACAMITE-(Ni) Cu3(Ni,Cu)(OH)6Cl2 R
With Pb, Cu, etc.
DIABOLEITE Pb2CuCl2(OH)4 Q
PSEUDOBOLEITE Pb5Cu4Cl10(OH)8.2H2O Q
BOLEITE KPb26Ag9Cu24Cl62(OH)48 C
CUMENGEITE Pb21Cu20Cl42(OH)40.6H2O Q
BIDEAUXITE Pb++2Ag+Cl3F(OH) C
CHLOROXIPHITE Pb3CuCl2(OH)2O2 M
HEMATOPHANITE Pb4Fe+++3O8(OH,Cl) Q
ASISITE Pb9(SiO4)O6Cl2 Q
PARKINSONITE (Pb,Mo)O8Cl2 Q
MURDOCHITE PbCu++6O8-x(Cl,Br)2x (x smaller or = 0,5) C
YEDLINITE Pb6CrCl6(O,OH)8 R
RICKTURNERITE Pb7O4[Mg(OH)4](OH)Cl3 O
EDDAVIDITE Pb2Cu12O15Br2 C
With Pb (As,Sb,Bi), without Cu
LAURIONITE PbCl(OH) O
PARALAURIONITE PbCl(OH) M
FIEDLERITE Pb3Cl4F(OH).H2O M
PENFIELDITE Pb2Cl3(OH) H
LAURELITE Pb7F12Cl2 H
BISMOCLITE BiOCl Q
DAUBREEITE BiO(OH,Cl) Q
MATLOCKITE PbFCl Q
RORISITE (Ca,Mg)FCl Q
ZAVARITSKITE BiOF Q
ZHANGPEISHANITE BaFCl Q
NADORITE PbSbO2Cl O
PERITE PbBiO2Cl O
ARAVAIPAITE Pb3AlF9.H2O M
CALCIOARAVAIPAITE PbCa2AlF6(F,OH)3 A
THORIKOSITE Pb3(Sb+++,As+++)O3(OH)Cl2 Q
MEREHEADITE Pb47(BO3)2(CO3)O24(OH)13Cl25 M
BLIXITE Pb2Cl(O,OH)2 M
PINALITE Pb3WO5Cl2 O
SYMESITE Pb10(SO4)O7Cl4.H2O A ps Q
ECDEMITE Pb6As+++2O7Cl4 Q
MENDIPITE Pb3Cl2O2 O
DAMARAITE Pb3O2(OH)Cl O
ONORATOITE Sb8O11Cl2 M
COTUNNITE PbCl2 O
PSEUDOCOTUNNITE K2PbCl4 O (?)
BARSTOWITE 3PbCl2.PbCO3.H2O or Pb4Cl6CO3.H2O M
With Hg
EGLESTONITE (Hg++2)3OCl3(OH) C
KADYRELITE Hg4(Br,Cl)2O C
POYARKOVITE Hg3ClO M
HANAWALTITE Hg+6Hg++(Cl,OH)2O3 O
TERLINGUAITE Hg+Hg++ClO M
PINCHITE Hg++5O4Cl2 O
GIANELLAITE Hg4(SO4)N2 C
MOSESITE Hg2N(Cl,SO4,MoO4,CO3).H2O C
KLEINITE Hg2N(Cl,SO4).nH2O H
TEDHADLEYITE Hg+10Hg++I2(Cl,Br)2O4 A
VASILYEVITE Hg++2I3Br2Cl(CO3)O6 A
AURIVILLIUSITE Hg+2Hg++2I2O2 O
TERLINGUACREEKITE Hg++3O2Cl2 O
KELYANITE [Hg2]6(SbO)6BrCl2 R
COMANCHEITE Hg++55N---24(NH2,OH)4(Cl,Br)34 O
GAILDUNNINGITE Hg++3[NHg++2]18(Cl,I,OH,Br,S)24 O
With Rare-Earth Elements
HALENIUSITE-(La) (La,Ce)OF C
HALENIUSITE-(Ce) CeOF C
Halogenides, etc. unclassified
URANOCLITE (UO2)2(OH)2Cl2(H2O)4 M
NATALIYAMALIKITE TlI O
SANGUITE KCuCl3 M
NOVOGRABLENOVITE (NH4)MgCl3.6H2O M
PANICHIITE (NH4)2Sn++++Cl6 C
REDIKORTSEVITE (NH4)MgCl3.6H2O O
ROMANORLOVITE K8Cu6Cl17(OH)3 Q
RUMSEYITE [Pb2OF]Cl Q ps C
SBACCHIITE Ca2AlF7 O
TOPSOEITE FeF3(H2O)3 Q
VERNEITE Na2Ca3Al2F14 C
VLADKRIVOVICHEVITE [Pb32O18][Pb4Mn2O]Cl14(BO3)8.2H2O O
MUONIONALUSTAITE Ni3(OH)4Cl2.4H2O M
THERMESSAITE-(NH4) (NH4)2AlF3(SO4) O
SIIDRAITE Pb2Cu(OH)2I3 O
TONDIITE Cu3MgCl2(OH)6 R
TELLUROPERITE Pb3(Te++++O4)Cl2 O
JAKOBSSONITE CaAlF5 M
DIOSKOURIITE CaCu4Cl6(OH)4.4H2O M
FLUORNATROCOULSELLITE (Na,Ca)2(Mg,Al)2F6F R ps C
HEKLAITE KNaSiF6 O
CRYOBOSTRYXITE KZnCl3.2H2O M
HEREROITE [Pb32(O,[])21](AsO4)2[(Si,As,V,Mo]O4)2Cl10 M
MELLIZINKALITE K3Zn2Cl7 A
IYOITE MnCuCl(OH)3 M
JANCHEVITE Pb7V+++++(O8,5[]0,5)Cl2 Q
JAVORIEITE KFeCl3 O
KALITHALLITE K3Tl+++Cl6.2H2O Q
KULIGINITE Fe3Mg(OH)6Cl2 R
LEONARDSENITE MgAlF5(H2O)2 M
MELLINZINKALITE K3Zn2Cl7 A
CHRYSOTHALLITE K6Cu6Tl+++Cl17(OH)4.H2O Q
* OXIDES, hydroxides, V[5,6] vanadates, arsenites, antimonites, bismuthites, sulfites, selenites, tellurites, iodates
GARPENBERGITE Mn6AsSbO10(OH)2 O
Metal: Oxygen = 2:1 and 1:1
Cation:Anion (M:O) = 2:1 (and 1.8:1)
ICE H2O H
CUPRITE Cu2O C
PARAMELACONITE Cu+2Cu++2O3 Q
M:O = 1:1 (and up to 1:1.25); with small to medium-sized cations only
CREDNERITE CuMnO2 M
TENORITE CuO M
DELAFOSSITE Cu+Fe+++O2 R
MCCONNELLITE CuCrO2 R
BROMELLITE BeO H
ZINCITE (Zn,Mn)O H
LIME CaO C
WUSTITE Fe++O C
PERICLASE MgO C
BUNSENITE NiO C
MONTEPONITE CdO C
MANGANOSITE Mn++O C
PALLADINITE (Pd,Cu)O Q
M:O = 1:1 (and up to 1:1.25); with large cations (+- smaller ones)
SWEDENBORGITE NaBe4SbO7 H
BROWNMILLERITE Ca2(Al,Fe+++)2O5 O
SREBRODOLSKITE Ca2Fe+++2O5 O
MONTROYDITE HgO O
LITHARGE PbO Q
ROMARCHITE SnO Q
MASSICOT PbO O
SHULAMITITE Ca3Fe+++AlTi++++O8 O
Metal: Oxygen = 3:4 and similar
With small and medium-sized cations
CHRYSOBERYL BeAl2O4 O
MANGANOSTIBITE (Mn++,Fe++)7(SbO4)(AsO4,SiO4)O4 O
With only medium-sized cations
CHENMINGITE FeCr2O4 O
SPINEL MgAl2O4 C
MAGNESIOCHROMITE MgCr2O4 C
MAGNESIOCOULSONITE MgV2O4 C
MAGNESIOFERRITE MgFe+++2O4 C
JACOBSITE (Mn++,Fe++,Mg)(Fe+++,Mn+++)2O4 C
MANGANOCHROMITE (Mn++,Fe++)(Cr+++,V+++)2O4 C
QANDILITE (Mg,Fe++)2(Ti,Fe+++,Al)O4 C
VUORELAINENITE (Mn++,Fe++)(V+++,Cr+++)2O4 C
TREVORITE NiFe+++2O4 C
ULVOSPINEL Fe++2Ti++++O4 C
MAGNETITE Fe++Fe+++2O4 C
ZINCOCHROMITE ZnCr2O4 C
COCHROMITE (Co,Ni,Fe++)(Cr,Al)2O4 C
GALAXITE (Mn++,Fe++,Mg)(Al,Fe+++)2O4 C
GAHNITE ZnAl2O4 C
FRANKLINITE (Zn,Mn++,Fe++)(Fe+++,Mn+++)2O4 C
FILIPSTADITE (Mn,Mg)2Sb+++++Fe+++O8 O
CUPROSPINEL (Cu++,Mg)Fe+++2O4 C
COULSONITE Fe++V+++2O4 C
CHROMITE Fe++Cr2O4 C
NICHROMITE (Ni,Co,Fe++)(Cr+++,Fe+++,Al)2O4 C
HERCYNITE Fe++Al2O4 C
JACOBSITE-Q Mn++(Fe+++,Mn+++)2O4 Q
HETAEROLITE ZnMn+++2O4 Q
HAUSMANNITE Mn++Mn+++2O4 Q
MAGHEMITE (Fe+++0,67[]0,33)Fe+++2O4 C
TITANOMAGHEMITE (Ti0,5[]0,5)Fe+++2O4 C
TEGENGRENITE (Mg,Mn++)2Sb+++++0,5(Mn+++,Si,Ti)0,5O4 R ps C
XIEITE FeCr2O4 O
MAOHOKITE MgFe2O4 O
DELTALUMITE (Al0,67[]0,33)Al2O4 Q
DELLAGIUSTAITE V++Al2O4 C
GUITE Co++Co+++2O4 Co++Co+++2O4 C
THERMAEROGENITE CuAl2O4 C
With medium-sized and large cations
MAROKITE CaMn+++2O4 O
DMITRYIVANOVITE CaAl2O4 M
ADDIBISCHOFFITE Ca2Al6Al6O20 A
ELLINAITE CaCr2O4 O
With only large cations
MINIUM Pb++2Pb++++O4 Q
Metal: Oxygen = 2: 3,3: 5, and similar
With small cations
BYRUDITE (Be,[])(V3+++,Ti++++,Cr)3O6 O
VERBIERITE BeCr+++2TiO6 O
With medium-sized cations
HEMATITE alpha-Fe2O3 R
WANGDAODEITE FeTiO3 R
TISTARITE Ti2O3 R
PYROPHANITE MnTiO3 R
MELANOSTIBITE Mn(Sb+++++,Fe+++)O3 R
KARELIANITE V2O3 R
ILMENITE Fe++TiO3 R
ESKOLAITE Cr2O3 R
ECANDREWSITE (Zn,Fe++,Mn++)TiO3 R
CORUNDUM Al2O3 R
BRIZZIITE NaSb+++++O3 R
AKIMOTOITE (Mg,Fe++)(SiO3) R
AUROANTIMONATE AuSbO3  
GEIKIELITE MgTiO3 R
AVICENNITE Tl2O3 C
BIXBYITE (Mn+++,Fe+++)2O3 C
ARMALCOLITE (Mg,Fe++)Ti2O5 O
PSEUDOBROOKITE (Fe+++,Fe++)2(Fe++,Ti)O5 O
MAGNESIOHOGBOMITE-6N12S Mg5Al11TiO23(OH) R
MAGNESIOHOGBOMITE-2N2S Ti(Mg,Fe)2Al8O15(OH) H
ZINCOHOGBOMITE-2N6S Ti(Zn,Mg,Fe)6Al16O31(OH) H
ZINCOHOGBOMITE-2N2S (Zn,Fe,Ti,Al)22(O,OH)32 H
MAGNESIOHOGBOMITE-2N3S Ti(Mg,Fe)3Al10O19(OH) R
FERROHOGBOMITE-6N12S [(Fe++,Mg,Zn)5(Al,Ti,Fe+++)12O23(OH)]6 R
FERROHOGBOMITE-2N2S (Fe++,Zn,Mg)3(Al,Fe+++,Ti++++)8O15(OH) H
MAGNESIOHOGBOMITE-6N6S Ti(Mg,Fe)2Al8O15(OH) R
KLEBERITE Fe+++Ti++++6O11(OH)5 M ps H
PSEUDORUTILE Fe+++2Ti3O9 H
BERDESINSKIITE V+++2TiO5 M
OXYVANITE (V+++,Cr+++)2(V++++,Ti++++)O5 M
OLKHONSKITE (Cr+++,V+++)2Ti3O9 M (?)
SCHREYERITE V+++2Ti3O9 M
ISEITE Mn2Mo3O8 H
KAMIOKITE Fe2Mo3O8 H
MAJINDEITE Mg2Mo3O8 H
NOLANITE (V+++,Fe++,Fe+++,Ti)10O14(OH)2 H
RINMANITE (Zn,Mn++)2Sb+++++2Mg2Fe+++4O14(OH)2 H
CLAUDETITE As2O3 M
STIBIOCLAUDETITE AsSbO3 M
ARSENOLITE As2O3 C
SENARMONTITE Sb2O3 C
VALENTINITE Sb2O3 O
BISMITE Bi2O3 M
SPHAEROBISMOITE Bi2O3 Q
SILLENITE Bi+++12(SiO4)O16 C
KYZYLKUMITE V+++2Ti2O5(OH) M
HEMLEYITE FeSiO3 A
With large and medium-sized cations
CHROMBISMITE Bi+++16(CrO4)O23 Q
FREUDENBERGITE Na2(Ti,Fe)8O16 M ps H
GROSSITE CaAl4O7 M
CHLORMAYENITE Ca12Al14O32Cl2 C
YAFSOANITE {Ca3}[Te++++++2](Zn3)O12 C
PEROVSKITE CaTiO3 O ps C
BARIOPEROVSKITE BaTiO3 O
LAKARGIITE Ca(Zr,Ti,Sn)O3 O ps C
LATRAPPITE Ca2NbFe+++O6 O
LUESHITE NaNbO3 M ps C
MEGAWITE Ca(Sn,Zr)O3 O ps C
NATRONIOBITE NaNbO3 M
TAUSONITE SrTiO3 C
MACEDONITE PbTiO3 Q
ISOLUESHITE (Na,La,Ca)(Nb,Ti)O3 C
LOPARITE-(Ce) (Na,Ce,Ca)(Ti,Nb)O3 Q/O ps Q
DAVIDITE-(La) (La,Ce)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
SENAITE Pb(Ti,Fe,Mn)21O38 R
MATHIASITE (K,Ca,Sr)(Ti,Cr,Fe,Mg)21O38 R
LOVERINGITE (Ca,Ce)(Ti,Fe+++,Cr,Mg)21O38 R
LINDSLEYITE (Ba,Sr)(Ti,Cr,Fe,Mg,Zr)21O38 R
LANDAUITE NaMn++Zn2(Ti,Fe+++)6Ti12O38 M ps R
DAVIDITE-(Y) (Y,Ce,La)2Fe+++2(Ti,Fe+++)18O38 (?) R
DESSAUITE-(Y) (Sr,Pb)(Y,U)(Ti,Fe+++)20O38 R ps H
DAVIDITE-(Ce) (Ce,La)(Y,U,Fe++)(Ti,Fe+++)20(O,OH)38 R
CRICHTONITE (Sr,La,Ce,Y)(Ti,Fe+++,Mn)21O38 R
CLEUSONITE (Pb,Sr)(U++++,U++++++)(Fe+++,Zn)2(Ti,Fe++,Fe+++)18(O,OH)38 R
GRAMACCIOLIITE-(Y) (Pb,Sr)(Y,Mn)(Ti,Fe+++)18Fe+++2O38 R ps H
DIAOYUDAOITE NaAl11O17 H
YIMENGITE K[Ti3Cr5Fe+++2Mg++2]O19 H
PLUMBOFERRITE Pb[Fe10,67Mn++0,33Pb]O18,33 H
NEZILOVITE Pb[Mn++++2e7AlZn2]O19 H
MAGNETOPLUMBITE Pb[Fe12]O19 H
LINDQVISTITE Pb2(Mn++,Mg)Fe+++16O27 H
HIBONITE Ca[Al12]O19 H
HAGGERTYITE Ba[Ti5Fe+++2Fe++4Mg]O19 H
BATIFERRITE Ba[Ti2Fe+++8Fe++2]O19 H
BARIOFERRITE Ba[Fe12]O19 H
HAWTHORNEITE Ba[Ti3Cr4Fe+++2Fe++2Mg]O19 H
JEPPEITE (K,Ba)2(Ti,Fe+++)6O13 M
NIXONITE Na2Ti6O13 M
ZENZENITE Pb3(Fe+++,Mn+++)4Mn++++3O15 H
GOLDSCHMIDTITE KNbO3 C
YTTRIAITE-(Y) Y2O3 C
VAPNIKITE Ca3UO6 M
SARANOVSKITE-(Y) SrCaFe++2(Cr4Ti2)Ti12O38 R
KAHLENBERGITE KAl11O17 H
DAVEMAOITE CaSiO3 C
CHLORKYUYGENITE Ca12Al14O32[(H2O)4Cl2] C
BOTUOBINSKITE SrFe++(Ti++++12Cr+++6)Mg2[O36(OH)2] A
BITIKLEITE {Ca3}[Sb+++++Sn++++](Al3)O12 C
ANZAITE-(Ce) Ce4Fe++Ti6O18(OH)2 M
ALLENDEITE Sc4Zr3O12 R
NATALIAKULIKITE Ca4Ti2(Fe+++,Fe++)(Si,Fe+++,Al)O11 O
Metal: Oxygen = 1:2 and similar
TANTALOWODGINITE (Mn++,Li)(Ta,Sn)(Ta,Nb)2O8 M
ACHALAITE (Fe++,Mn)(Ti,Fe+++,Ta)(Nb,Ta)2O8 M
ANDYMCDONALDITE Fe2TeO6 Q
With small cations: Silica family
BOSOITE SiO2.nCxH2x+2 H
CHIBAITE SiO2.0,15(CH4,C2H6,C3H8) C
QUARTZ ROUGE = QUARTZ HEMATOIDE = QUARTZ SiO2 R
QUARTZ BLEU = QUARTZ SiO2 R
QUARTZ ENFUME = SMOKY QUARTZ = Brown QUARTZ SiO2 R
QUARTZ HEMATOIDE = FERRUGINOUS QUARTZ SiO2 R
QUARTZ ROSE = QUARTZ SiO2 R
QUARTZ SiO2 R
OPAL SiO2.nH2O am.
TRIDYMITE SiO2 M ps H
CRISTOBALITE SiO2 Q
MOGANITE SiO2.nH2O M
MELANOPHLOGITE SiO2 C/Q
LECHATELIERITE SiO2 Am.
COESITE SiO2 M
STISHOVITE SiO2 Q
SEIFERTITE SiO2 O
With medium-sized cations; chains of edge-sharing octahedra
TRIPUHYITE Fe+++(Sb+++++,Sn,W++++++,Ti++++)O4 Q
PLATTNERITE PbO2 Q
VARLAMOFFITE Sn2Fe+++O5(OH) C
TUGARINOVITE MoO2 M
PYROLUSITE Mn++++O2 Q
ARGUTITE GeO2 Q
CASSITERITE SnO2 Q
RUTILE TiO2 Q
TAPIOLITE-(Mn) (Mn++,Fe++)(Ta,Nb)2O6 Q
BYSTROMITE MgSb+++++2O6 Q
ORDONEZITE ZnSb+++++2O6 Q
TAPIOLITE-(Fe) (Fe++,Mn++)(Ta,Nb)2O6 Q
PARAMONTROSEITE VO2 O
RAMSDELLITE MnO2 O
AKHTENSKITE epsilon-Mn++++O2 H
NSUTITE (gamma-MnO2)Mn++xMn++++1-xO2-2x(OH)2x (x is small) H
SCRUTINYITE alpha-PbO2 O
SAMARSKITE-(Yb) (Yb,Y,U,Th,Ca,Fe)(Nb,Ta)O4 M ps O
YTTROCOLUMBITE-(Y) (Y,U,Fe++)(Nb,Ta)O4 O
SRILANKITE (Ti,Zr)O2 O
IXIOLITE (Ta,Nb,Sn,Fe,Mn)4O8 M
ISHIKAWAITE (U,Y,Fe+++,Fe++)(Nb,Ti)O4 O
CALCIOSAMARSKITE (Ca,Fe+++,U,Y)NbO4 M
SAMARSKITE-(Y) (Y,Ce,U,Fe+++)3(Nb,Ta,Ti)5O16 M
ROSSOVSKYITE (Fe+++,Ta)(Nb,Ti)O4 M
FERBERITE Fe++WO4 M
SANMARTINITE (Zn,Fe++)WO4 M
NIOBOHEFTETJERNITE ScNbO4 M
HUBNERITE MnWO4 M
HUANZALAITE (Mg,Fe++)WO4 M
HEFTETJERNITE (Sc,Sn++++,Mn++)(Ta,Nb)O4 M
COLUMBITE-(Mg) (Mg,Fe++,Mn)(Nb,Ta)2O6 O
COLUMBITE-(Mn) (Mn,Fe++)(Nb,Ta)2O6 O
QITIANLINGITE (Fe++,Mn)2(Nb,Ta)2W++++++O10 O
TANTALITE-(Fe) Fe++Ta2O6 O
TANTALITE-(Mg) (Mg,Fe++)(Ta,Nb)2O6 O
TANTALITE-(Mn) Mn++Ta2O6 O
COLUMBITE-(Fe) Fe++Nb2O6 O
FERROWODGINITE (Fe++,Mn++)(Sn,Ti,Fe+++,Ta)(Ta,Nb)2O8 M
TITANOWODGINITE (Mn++,Fe++)(Ti,Sn,Ta,Sc)(Ta,Nb)2O8 M
WODGINITE (Ta,Nb,Sn,Mn,Fe)16O32 M
FERROTITANOWODGINITE (Fe++,Mn++)(Ti,Sn++++,Ta,Fe+++)(Ta,Nb)2O8 M
LITHIOWODGINITE (Li,Mn,Fe)(Ta,Nb,Sn)3O8 M
LITHIOTANTITE Li(Ta,Nb)3O8 M
TIVANITE V+++TiO3(OH) M
CARMICHAELITE (Ti,Cr,Fe)(O,OH)2 M
ALUMOTANTITE AlTaO4 O
BIEHLITE (Sb+++,As+++)2(MoO6) M
SHAKHDARAITE-(Y) ScYNb2O8 M
With medium-sized cations; sheets of edge-sharing octahedra
BAHIANITE Al5Sb+++++3O14(OH)2 M
SIMPSONITE Al4(Ta,Nb)3(O,OH,F)14 R
With medium-sized cations; frameworks of edge-sharing octahedra
ANATASE TiO2 Q
BROOKITE TiO2 O
With medium-sized cations; * With various polyhedra
DOWNEYITE SeO2 Q
KORAGOITE (Mn++,Mn+++,Fe++)3(Nb,Ta,Ti)3(Nb,Mn)2(W,Ta)2O20 M
TUNGSTIBITE Sb2O3.WO3 O
KOECHLINITE Bi2MoO6 O
RUSSELLITE Bi2WO6 Q
TELLURITE TeO2 O
PARATELLURITE TeO2 Q
BISMUTOCOLUMBITE Bi(Nb,Ta)O4 Q
BISMUTOTANTALITE Bi(Ta,Nb)O4 O
CERVANTITE Sb+++Sb+++++O4 O
CLINOCERVANTITE beta-Sb+++Sb+++++O4 M
STIBIOCOLUMBITE SbNbO4 O
STIBIOTANTALITE SbTaO4 O
BADDELEYITE ZrO2 M
With large (+- medium-sized) cations; dimers and trimers of edgesharing octahedra
RYNERSONITE Ca(Ta,Nb)2O6 O
TANTALAESCHYNITE-(Y) (Y,Ce,Ca)(Ta,Ti,Nb)2O6 O
NIOBOAESCHYNITE-(Y) (Y,Ce,Nd)0,5(Ca,Th)0,5(Nb,Ti)2(O,OH)6 O
NIOBOAESCHYNITE-(Nd) (Nd,Ce)(Nb,Ti)2(O,OH)6 O
AESCHYNITE-(Y) (Y,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Nd) (Nd,Ce,Ca)(Ti,Nb)2(O,OH)6 O
AESCHYNITE-(Ce) (Ce,Ca,Fe,Th)(Ti,Nb)2(O,OH)6 O
NIOBOAESCHYNITE-(Ce) (Ce,Ca,Th)(Nb,Ti)2(O,OH)6 O
VIGEZZITE (Ca,Ce)(Nb,Ta,Ti)2O6 O
CHANGBAIITE PbNb2O6 R
MURATAITE-(Y) (Y,Na)6(Zn,Fe+++)5Ti12O29(O,F)10F4 C
With large (+- medium-sized) cations; chains of edge-sharing octahedra
FERSMITE (Ca,Ce,Na)(Nb,Ta,Ti)2(O,OH,F)6 O
YTTROCRASITE-(Y) (Y,Th,Ca,U)(Ti,Fe+++)2(O,OH)6 O
URANOPOLYCRASE (U,Y)(Ti,Nb,Ta)2O6 O
TANTEUXENITE-(Y) (Y,Ce,Ca)(Ta,Nb,Ti)2(O,OH)6 O
POLYCRASE-(Y) (Y,Ca,Ce,U,Th)(Ti,Nb,Ta)2O6 O
KOBEITE-(Y) (Y,U)(Ti,Nb)2(O,OH)6 (?) am.
EUXENITE-(Y) (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 O
LORANSKITE-(Y) (Y,Ce,Ca)ZrTaO6 (?) O (?)
YTTROTANTALITE-(Y) (Y,U,Fe++)(Ta,Nb)O4 O
FERGUSONITE-(Ce)-Beta (Ce,La,Nd)NbO4 M
FERGUSONITE-(Nd)-Beta (Nd,Ce)NbO4 M
FERGUSONITE-(Y)-Beta YNbO4 M
THOREAULITE Sn++Ta2O6 M
FOORDITE Sn++(Nb,Ta)2O6 M
RASPITE PbWO4 M
With large (+- medium-sized) cations; sheets of edge-sharing octahedra
BRANNERITE (U,Ca,Y,Ce)(Ti,Fe)2O6 M
ORTHOBRANNERITE U++++U++++++Ti4O12(OH)2 O
THORUTITE (Th,U,Ca)Ti2(O,OH)6 M
KASSITE CaTi2O4(OH)2 O
LUCASITE-(Ce) (Ce,La)Ti2(O,OH)6 M
HYDROPLUMBOELSMOREITE (Pb,[])2(W,Fe+++)2O6(H2O) C
HYDROPYROCHLORE (H2O,[])2Nb2(O,OH)6(H2O) C
HYDROKENOELSMOREITE []2W2O6(H2O) C
FLUORNATROMICROLITE (Na,Ca,Bi)2Ta2O6F C
CUPROROMEITE Cu++2Sb2(O,OH)7 C (?)
STETEFELDTITE Ag2Sb2(O,OH)7 C
STIBICONITE Sb+++Sb+++++2O6(OH) C
ROSIAITE PbSb+++++2O6 R
ZIRCONOLITE-3T CaZrTi2O7 A
ZIRCONOLITE-3O CaZrTi2O7 O
ZIRCONOLITE-2M CaZrTi2O7 M
LAACHITE (Ca,Mn)2Zr2Nb2TiFeO14 M
LIANDRATITE U++++++(Nb,Ta)2O8 H
PETSCHECKITE U++++Fe++(Nb,Ta)2O8 H
INGERSONITE Ca3Mn++Sb+++++4O14 H
PITTONGITE Na2(W,Fe+++)9(O,OH)27.4H2O H
ROMEITE = FLUORNATROROMEITE or FLUORCALCIOROMEITE or OXYCALCIOROMEITE (Ca,Fe++,Mn++,Na)2(Sb+++++,Ti++++)2O6(O,OH,F) C
OXYBISMUTOMICROLITE (Bi1,33[]0,67)S2Ta2O6O C
OXYNATROMICROLITE (Na,Ca,U)2(Ta,Nb)2O6(O,F) C
HYDROXYNATROPYROCHLORE (Na,?a,Ce)2Nb2O6(OH) C
KENOPLUMBOPYROCHLORE (Pb,[])2Nb2O6([],O) C
HYDROXYPLUMBOPYROCHLORE (Pb1,5[]0,5)Nb2O6(OH) C
KENOPLUMBOMICROLITE (Pb,[])2Ta2O6([],O,OH) C
OXYCALCIOBETAFITE Ca2(Ti,Nb)2O6O C
HYDROXYNATROMICROLITE (Na,Bi+++,[])2Ta2O6(OH) C
OXYCALCIOMICROLITE Ca2Ta2O6O C
OXYCALCIOPYROCHLORE Ca2Nb2O6O C
OXYCALCIOROMEITE (Ca,Fe++,Sb+++,Na)2Sb+++++2O7 C
OXYKENOMICROLITE   C
OXYNATROPYROCHLORE (Na,Ca,U)2Nb2O6(O,OH) C
OXYPLUMBOBETAFITE Pb2(Ti,Nb)2O6O C
OXYPLUMBOPYROCHLORE Pb2Nb2O6O C
OXYSTANNOMICROLITE Sn2Ta2O6O C
OXYSTIBIOMICROLITE (Sb+++,Ca)2Ta2O6O C
OXYURANOBETAFITE (U,Ca,[])2(Ti,Nb)2O6O C
OXYYTTROPYROCHLORE-(Y) (Y,[])2Nb2O6O C
HYDROXYMANGANOPYROCHLORE (Mn,Th,Na,Ca,REE)2(Nb,Ti)2O6(OH) C
PLUMBOROMEITE ? ?
HYDROKENOPYROCHLORE ([],x)2Nb2O6(H2O,Cs) C
SCHETELIGITE (Ca,Y,Sb,Mn)2(Ti,Ta,Nb,W)2O6(O,OH) O (?)
STIBIOROMEITE Sb+++Sb+++++2O6(OH) C
YTTROMICROLITE (Ca,Y+++,U,Na)2-x(Ta,Nb,Ti,Fe+++)2O7 C
PLUMBOELSMOREITE ? ?
FLUORCALCIOMICROLITE (Ca,Na,[])2Ta2O6F C
HYDROXYCALCIOBETAFITE (Ca,Na,U)2(Ti,Nb,Ta)2O6(OH) C
CESIOKENOPYROCHLORE []Nb2(O,OH)6Cs1-x (x about 0,20) C
FLUORNATROPYROCHLORE (Na,Pb,Ca,REE,U)2Nb2O6F C
HYDROXYKENOMICROLITE ([],Na,Sb+++)2Ta2O6(OH) C
OXYPLUMBOROMEITE (Pb,Ca)2Sb+++++2O7 C
ARGENTOROMEITE Ag2Sb2(O,OH)7 C
HYDROXYKENOPYROCHLORE ([],Ce,Ba)2(Nb,Ti)2O6(OH,F) C
BISMUTOSTIBICONITE Bi(Sb+++++,Fe+++)2O7 C
FLUORCALCIOPYROCHLORE (Ca,Na)2(Nb,Ti)2O6F C
FLUORCALCIOROMEITE (Ca,Na)2Sb+++++2(O,OH)6F C
FLUORHYDROPYROCHLORE ? C
HYDROXYCALCIOROMEITE (Ca,Sb+++)2(Sb+++++,Ti)2O6(OH) C
HYDROXYKENOELSMOREITE ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) ([],Pb)2(W,Fe+++,Al)2(O,OH)6(OH) R
BISMUTOROMEITE ? C
HYDROXYFERROROMEITE Fe++1,5[]0,5)Sb+++++2O6(OH) C
FLUORKENOPYROCHLORE ([],Na,Ce,Ca)2(Nb,Ti)2O6F C
HYDROXYCALCIOPYROCHLORE (Ca,Na,U,[])2(Nb,Ti)2O6(OH) C
HYDROXYCALCIOMICROLITE Ca1,5Ta2O6(OH) C
HYDROMICROLITE (H2O,[])2Ta2(O,OH)6(H2O) C
HYDROKENOMICROLITE ([],H2O)2Ta2(O,OH6)(H2O) C
FLUORSTRONTIOPYROCHLORE (Sr,[])2Nb2(O,OH)6F C
FLUORPLUMBOPYROCHLORE (Pb,Y,Th,U,Na,Ca)2-x(Nb,Ti)2O6F C
FLUORNATROROMEITE (Na,Ca)2Sb2(O,OH)6F C
With large (+- medium-sized) cations; polyhedral frameworks
CALCIOTANTITE CaTa4O11 H
IRTYSHITE Na2(Ta,Nb)4O11 H
NATROTANTITE Na2Ta4O11 M
With large (+- medium-sized) cations; tunnel structures
AKAGANEITE beta-Fe+++(O,OH,Cl) M ps Q
CRYPTOMELANE K(Mn++++,Mn++)8O16 M ps Q
HOLLANDITE BaMn++++6Mn++2O16 M
STRONTIOMELANE (Sr,K,Ba)Mn++++6Mn++2O16 M
CORONADITE Pb(Mn++++,Mn++)8O16 M ps Q
MANJIROITE (Na,K)(Mn++++,Mn++)8O16.nH2O Q
REDLEDGEITE BaTi6Cr+++2O16.H2O Q
HENRYMEYERITE BaFe++Ti7O16 Q
MANNARDITE BaTi6V+++2O16.H2O Q
PRIDERITE (K,Ba)(Ti,Fe+++)8O16 Q
ROMANECHITE (Ba,H2O)2(Mn++++,Mn+++)5O10 M
TODOROKITE (Mn++,Ca,Mg)Mn++++3O7.H2O M
FERRICORONADITE Pb(Mn++++6Fe+++2)O16 Q
FERRIHOLLANDITE BaMn++++6(Fe+++,Mn+++)2O16 M
THALLIOMELANE TlMn++++7,5Cu++0,5O16 Q
With large (+- medium-sized) cations; fluorite-type structures
CERIANITE-(Ce) (Ce++++,Th)O2 C
THORIANITE ThO2 C
URANINITE UO2 C
ZIRKELITE (Ca,Th,Ce)Zr(Ti,Nb)2O7 C
CALZIRTITE CaZr3TiO9 Q
TAZHERANITE (Zr,Ti,Ca)O2 C
HIARNEITE (Ca,Mn++,Na)2(Zr,Mn+++)5(Sb+++++,Ti,Fe+++)2O16 Q
With large (+- medium-sized) cations; unclassified
RANKAMAITE (Na,K,Pb,Li)3(Ta,Nb,Al)11(O,OH)30 O
SOSEDKOITE (K,Na)5Al2(Ta,Nb)22O60 O
CESPLUMTANTITE (Cs,Na)2(Pb,Sb+++)3Ta8O24 Q
EYSELITE Fe+++Ge++++3O7(OH) O
KURANAKHITE PbMn++++Te++++++O6 O
Metal: Oxygen = < 1 :2
Oxides with metal : oxygen < 1:2 (M2O5, MO3)
TANTITE Ta2O5 A (?)
MOLYBDITE MoO3 O
Hydroxides (without V or U)
Hydroxides with OH, without H2O; corner-sharing tetrahedra
BEHOITE Be(OH)2 O
CLINOBEHOITE Be(OH)2 M
WULFINGITE Zn(OH)2 O
SWEETITE Zn(OH)2 Q
ASHOVERITE Zn(OH)2 Q
Hydroxides with OH, without H2O; insular octahedra
SHAKHOVITE Hg+4Sb+++++O3(OH)3 M
CUALSTIBITE Cu2AlSb+++++(OH)12 R
ZINCALSTIBITE Zn2AlSb+++++(OH)12 R
OMSITE (Ni,Cu)2Fe+++(OH)6[Sb(OH)6] R
Hydroxides with OH, without H2O; corner-sharing octahedra
DZHALINDITE In(OH)3 C
SOHNGEITE Ga(OH)3 C
BERNALITE Fe(OH)3 O ps C
MUSHISTONITE (Cu++,Zn,Fe++)Sn++++(OH)6 C
NATANITE Fe++Sn++++(OH)6 C
SCHOENFLIESITE MgSn++++(OH)6 C
VISMIRNOVITE ZnSn++++(OH)6 C
WICKMANITE Mn++Sn++++(OH)6 C
BURTITE CaSn(OH)6 C
MOPUNGITE NaSb+++++(OH)6 Q
STOTTITE Fe++Ge(OH)6 Q
JEANBANDYITE (Fe+++,[])(Sn++++,[])(OH)6 Q ps C
TETRAWICKMANITE omsitedritsite Q
FERRONIGERITE-2N1S (Fe,Mg)4(Al10Sn2)O22(OH)2 R
FERRONIGERITE-6N6S (Fe,Mg)18(Al42Sn6)O90(OH)6 R
MAGNESIONIGERITE-2N1S (Mg,Fe++)4(Al10Sn2)[]12O22(OH)2 R
MAGNESIONIGERITE-6N6S (Mg,Fe++)18(Al42Sn6)[]48O90(OH)6 R
ZINCONIGERITE-2N1S ZnSn2Al12O22(OH)2 R
ZINCONIGERITE-6N6S Zn3Sn2Al16O30(OH)2 R
FERROTAAFFEITE-6N'3S (Fe++,Zn,Mg)2Al6BeO12 R
MAGNESIOTAAFFEITE-2N'2S Mg3Al8BeO16 H
MAGNESIOTAAFFEITE-6N'3S Mg2Al6BeO12 R
Hydroxides with OH, without H2O; chains of edge-sharing octahedra
SPERTINIITE Cu++(OH)2 O
TSUMGALLITE GaO(OH) O
BRACEWELLITE Cr+++O(OH) O
DIASPORE AlO(OH) O
GROUTITE Mn+++O(OH) O
GUYANAITE CrO(OH) O
MONTROSEITE (V+++,Fe+++)O(OH) O
MANGANITE Mn+++O(OH) M
YTTROTUNGSTITE-(Y) YW2O6(OH)3 M
YTTROTUNGSTITE-(Ce) CeW2O6(OH)3 M
FRANKHAWTHORNEITE Cu2Te++++++O4(OH)2 M
KHINITE-3T Pb++Cu++3Te++++++O6(OH)2 R
KHINITE-4O Pb++Cu++3Te++++++O6(OH)6 O
GOETHITE alpha-Fe+++O(OH) O
Hydroxides with OH, without H2O; sheets of edge-sharing octahedra
BRUCITE Mg(OH)2 R
THEOPHRASTITE Ni(OH)2 R
PORTLANDITE Ca(OH)2 H
AMAKINITE (Fe++,Mg)(OH)2 R
PYROCHROITE Mn++(OH)2 R
BAYERITE Al(OH)3 M
DOYLEITE Al(OH)3 A
GIBBSITE Al(OH)3 M
NORDSTRANDITE Al(OH)3 A
LEPIDOCROCITE gamma-Fe+++O(OH) O
BOHMITE AlO(OH) O
HETEROGENITE-3R Co+++O(OH) R
HETEROGENITE-2H Co+++O(OH) H
GRIMALDIITE Cr+++O(OH) R
FEITKNECHTITE beta-Mn+++O(OH) H
LITHIOPHORITE Li6Al14Mn++3Mn++++18O42(OH)42 H or M
QUENSELITE PbMn+++O2(OH) M
FERRIHYDRITE 5Fe+++2O3.9H2O H
FEROXYHYTE delta-Fe+++O(OH) H
VERNADITE (MnO2)(Mn++++,Fe+++,Ca,Na)(O,OH)2.nH2O H
QUETZALCOATLITE Zn6Cu3(Cl,Pb,Ag)2(TeO3)2O6(OH)6 H
Hydroxides with OH, without H2O; various polyhedra
HYDROROMARCHITE Sn3O2(OH)2 Q
Hydroxides with OH, without H2O; unclassified
JANGGUNITE Mn++++5-x(Mn++,Fe+++)1+xO8(OH)6 (x=0,2) O
CESAROLITE PbH2Mn++++3O8 (?)
KIMROBINSONITE (Ta,Nb)(OH)5-2x(O,CO3)x C
Hydroxides with H2O +- (OH); insular octahedra
BRANDHOLZITE MgSb+++++2(OH)12.6H2O R
BOTTINOITE NiSb+++++2(OH)12.6H2O H
Hydroxides with H2O +- (OH); corner-sharing octahedra
MEYMACITE WO3.2H2O am.
SIDWILLITE MoO3.2H2O M
TUNGSTITE WO3.H2O O
HYDROTUNGSTITE H2WO4.H2O M
ILSEMANNITE Mo3O8.nH2O am.
Hydroxides with H2O +- (OH); chains of edge-sharing octahedra
BAMFORDITE Fe+++Mo2O6(OH)3.H2O A
Hydroxides with H2O +- (OH); sheets of edge-sharing octahedra
WOODALLITE Mg6(Cr,Fe+++)2(OH)16Cl2.4H2O R
MUSKOXITE Mg7Fe+++4(OH)13.10H2O H
MEIXNERITE Mg6Al2(OH)18.4H2O R
JAMBORITE Ni++(OH)2.H2O H
IOWAITE Mg6Fe+++2(OH)16Cl2.4H2O H
FOUGERITE Fe++4Fe+++2(OH)12[CO3].3H2O R
HYDROCALUMITE Ca4Al2(OH)12(Cl,CO3,OH)2.4H2O M
KUZELITE Ca4Al2(OH)12(SO4).6H2O R
AURORITE (Mn,Ag,Ca)Mn++++3O7.3H2O A (?)
JIANSHUIITE (Mg,Mn++)Mn++++3O7.3H2O A
ERNIENICKELITE NiMn++++3O7.3H2O R
CHALCOPHANITE (Zn,Fe++,Mn++)Mn++++3O7.3H2O R
WOODRUFFITE Zn++(Mn++++,Mn+++)5O10.3,5H2O M ps Q
ASBOLANE (Co,Ni)1-y(Mn++++O2)2-x(OH)2-2y+2x.nH2O H
BUSERITE Na4Mn14O27.21H2O ?
RANCIEITE (Ca,Mn++)Mn++++4O9.3H2O H (?)
TAKANELITE (Mn++,Ca)Mn++++4O8.H2O H
BIRNESSITE Na4Mn14O27.9H2O O
CIANCIULLIITE Mn++++(Mg,Mn++)2Zn+2(OH)10.2-4H2O M
JENSENITE Cu++3Te++++++O6.2H2O M
LEISINGITE (Cu,Mg,Zn)2(Mg,Fe)Te++++++O6.6H2O R
AKDALAITE 4Al2O3.H2O H
CAFETITE CaTi2O5.H2O O
MOURITE U++++Mo++++++5O12(OH)10 M
DELORYITE Cu++4(UO2)(MoO4)2(OH)6 M
TREBEURDENITE Fe++2Fe+++4O2(OH)10[CO3].3H2O R
Hydroxides with H2O +- (OH); unclassified
FRANCONITE Na2Nb4O11.9H2O M
HOCHELAGAITE (Ca,Na,Sr)Nb4O11.8H2O M
TERNOVITE (Mg,Ca)Nb4O11.nH2O M
BELYANKINITE Ca1-2(Ti,Zr,Nb)5O12.9H2O (?) am.
GERASIMOVSKITE (Mn,Ca)(Nb,Ti)5O12.9H2O am.
MANGANBELYANKINITE (Mn,Ca)(Ti,Nb)5O12.9H2O am.
SILHYDRITE 3SiO2.H2O O
CUZTICITE Fe+++2Te++++++O6.3H2O H
CHARLESHATCHETTITE CaNb4O10(OH)2.8H2O M
Hydroxides with H2O(OH); frameworks of corner and/or face-sharing octahedra
MENEZESITE Ba3MgZr4Nb12O42.12H2O C
ASPEDAMITE []12(Fe+++,Fe++)3Nb4[Th(Nb,Fe+++)12O42]{(H2O),(OH)}12 C
Uranyl Hydroxides
Without additional cations
METASCHOEPITE UO3.nH2O (n smaller than 2) O
PARASCHOEPITE UO3.2H2O O
SCHOEPITE [(UO2)8O2(OH)12](H2O)12 O
IANTHINITE (UO2).5(UO3).10H2O O
METASTUDTITE UO4.2H2O O
STUDTITE UO4.4H2O M
PAULSCHERRERITE (UO2)(OH)2 M ps O
BOBFINCHITE Na[(UO2)8O3(OH)11].10H2O O
With additional cations (K, Ca, Ba, Pb, etc.); * With mainly UO2(O,OH)5 pentagonal polyhedra
AGRINIERITE K2(Ca,Sr)(UO2)6O6(OH)4.5H2O O
COMPREIGNACITE K2(UO2)6O4(OH)6.7H2O O
RAMEAUITE K2Ca(UO2)6O6(OH)4,6H2O M
BECQUERELITE Ca(UO2)6O4(OH)6.8H2O O
BILLIETITE Ba(UO2)6O4(OH)6.8H2O O
PROTASITE Ba(UO2)3O3(OH)2.3H2O M ps H
RICHETITE PbU++++++4O13.4H2O A
BAURANOITE BaU2O7.4-5H2O (?)
CALCIOURANOITE (Ca,Ba,Pb)U2O7.5H2O am.
METACALCIOURANOITE (Ca,Na,Ba)U2O7.2H2O (?)
FOURMARIERITE Pb(UO2)4O3(OH)4.4H2O O
WOLSENDORFITE (Pb,Ca)U2O7.2H2O O
MASUYITE Pb(UO2)3O3(OH)2.2H2O O
METAVANDENDRIESSCHEITE PbU7O22.nH2O (n smaller than12) O
VANDENDRIESSCHEITE Pb1,5(UO2)10O6(OH)11.11H2O O
VANDENBRANDEITE Cu(UO2)(OH)4 A
SAYRITE Pb2(UO2)5O6(OH)2.4H2O M
CURITE Pb3(UO2)8O8(OH)6.2H2O O
IRIGINITE UO2Mo2O7.3H2O O
URANOSPHAERITE Bi(UO2)O2(OH) M
HOLFERTITE U++++++1,75Ti++++Ca0,25O7,5(H2O)3 or U++++++1,75Ti++++Ca0,25O7,17(OH)0,67(H2O)3 H
With additional cations; * With mainly UO2(O,OH)6 hexagonal polyhedra
CLARKEITE Na[(UO2)O(OH)](H2O)0-1 H
UMOHOITE (UO2)MoO4.2H2O A
SPRIGGITE Pb2(UO2)6O8(OH)2.3H2O M
V[5,6] Vanadates
BASSOITE SrV++++3O7 M
V[>4] Nesovanadates
Uranyl Sorovanodates
CARNOTITE K2(UO2)2V2O8.3H2O M
MARGARITASITE (Cs,K,H3O)2(UO2)2V2O8.H2O M
SENGIERITE Cu2(UO2)2V2O8.6H2O M
CURIENITE Pb(UO2)2V2O8.5H2O O
FRANCEVILLITE (Ba,Pb)(UO2)2V2O8.5H2O O
FRITZSCHEITE Mn++(UO2)2[(P,V)O4]2.10H2O (?) Q
VANURALITE Al(UO2)2(V+++++O4)2(OH).11H2O M
METAVANURALITE Al(UO2)2V2O8(OH).8H2O A
TYUYAMUNITE Ca(UO2)2V2O8.5-8H2O O
METATYUYAMUNITE Ca(UO2)2V2O8.3H2O O
STRELKINITE Na2(UO2)2V2O8.6H2O O
UVANITE U++++++2V+++++6O21.15H2O (?) O (?)
RAUVITE Ca(UO2)2V+++++10O28.16H2O  
[6]-Sorovanadates
LASALITE Na2Mg2(V10O28).20H2O M
MAGNESIOPASCOITE MgCa2(V10O28).16H2O M ps H
PASCOITE Ca3V10O28.17H2O M
HUMMERITE KMgV+++++5O14.8H2O A
SHERWOODITE Ca9Al2V++++4V+++++24O80.56H2O Q
BECKETTITE Ca2V6Al6O20 A
AMMONIOLASALITE (NH4)2Mg2(H2O)20][V10O28] M
Inovanadates
ROSSITE CaV2O6.4H2O A
METAROSSITE CaV2O6.2H2O A
MUNIRITE NaVO3.(2-x)H2O M
METAMUNIRITE Na2[V+++++2O6] or NaVO3 O
DICKTHOMSSENITE Mg(V2O6).7H2O M
ANSERMETITE Mn++(V+++++2O6).4H2O M
PSEUDODICKTHOMSSENITE Mg(VO3)2.8H2O A
Phyllovanadates
MELANOVANADITE Ca(V+++++2V++++2)O10.5H2O A
SHCHERBINAITE V2O5 O
HEWETTITE CaV+++++6O16.9H2O M
METAHEWETTITE CaV+++++6O16.3H2O M
CORVUSITE (Na,Ca,K)(V+++++,V++++,Fe++)8O20.4H2O M
FERNANDINITE Ca(V+++++,V++++,Fe++)80O20.4H2O M
BOKITE (Al,Fe+++)1,3(V+++++,V++++,Fe+++)8O20.7,4H2O M
BARIANDITE Al3(V+++++,V++++)40O100.45H2O M
STRACZEKITE (Ca,K,Ba)(V+++++,V++++)8O20.3H2O M
HAGGITE V2O2(OH)3 M
DOLORESITE H8V++++6O16 M
DUTTONITE V++++O(OH)2 M
CAVOITE CaV++++3O7 O
Tektovanadates
BANNERMANITE (Na,K)xV++++xV+++++6-xO15 (x=0,7) M
Unclassified V oxides
CALCIODELRIOITE Ca(VO3)2(H2O)4 M
FERVANITE Fe+++4(VO4)4.5H2O M
HUEMULITE Na4MgV+++++10O28.24H2O A
VANALITE NaAl8V10O38.30H2O M
SIMPLOTITE CaV++++4O9.5H2O M
VANOXITE V++++4V+++++2O13.8H2O R (?)
NAVAJOITE (V+++++,Fe+++)10O24.12H2O M
DELRIOITE (Sr,Ca)(VO3)2(H2O)4 M
METADELRIOITE Ca(VO3)2(H2O)4 A
BARNESITE (Na,Ca)2V+++++6O16.3H2O M
HENDERSONITE (Ca,Sr)x(V+++++,V++++)12O32.12H2O (x = about 2,6) O
GRANTSITE (NaCa)x(V+++++,V++++)6O16.4H2O (x = about 2,3) M
LENOBLITE V++++2O4.2H2O O (?)
SATPAEVITE Al12V++++2V+++++6O37.30H2O O (?)
Arsenites, antimonites, bismuthites, sulfites, selenites, tellurites; iodates
Arsenites, antimonites, bismuthites; without additional anions, without H2O
LEITEITE ZnAs+++2O4 M
REINERITE Zn3(As+++O3)2 O
KARIBIBITE Fe+++2As+++4(O,OH)9 O
TRIPPKEITE CuAs+++2O4 Q
SCHAFARZIKITE Fe++Sb+++2O4 Q
KUSACHIITE CuBi2O4 Q
APUANITE Fe++Fe+++4Sb+++4O12S Q
VERSILIAITE Fe2Fe4Sb6O16S O
SCHNEIDERHOHNITE Fe++Fe+++3As+++5O13 A
ZIMBABWEITE (Na,K)2PbAs+++4(Ta,Nb,Ti)4O18 O
LUDLOCKITE Pb++Fe+++4As+++10O22 A
PAULMOOREITE Pb2As+++2O5 M
STIBIVANITE (-2M,-2O) Sb+++2V++++O5 O/M
CHADWICKITE H(UO2)(As+++O3) Q (?)
Arsenites, antimonites, bismuthites; with additional anions, without H2O
FETIASITE (Fe++,Fe+++,Ti++++)3O2(As+++2O5) M
MANGANARSITE Mn++3As+++204(OH)4 R
MAGNUSSONITE Mn++5As+++3O9(OH,Cl) C/Q
ARMANGITE Mn++26As+++18O50(OH)4(CO3) R
NANLINGITE NaLiCa5Mg12Fe++(AsO3)8F14 R
ASBECASITE Ca3(Ti,Fe,Sn)(Be,B,Al)2(As+++,Sb+++)3O6(SiO4)2 R
STENHUGGARITE CaFe+++(As+++O2)(As+++Sb+++O5) Q
TRIGONITE Pb3Mn(As+++O3)2(As+++O2OH) M
FINNEMANITE Pb5(As+++O3)3Cl H
GEBHARDITE Pb8(As+++2O5)2OCl6 M
DERBYLITE Fe+++4Ti++++3Sb+++O13(OH) M
GRAESERITE Fe+++4Ti3As+++O13(OH) M
TOMICHITE (V,Fe)4Ti3AsO13(OH) M
HEMLOITE (As,Sb)2(Ti,V,Fe,Al)12O23OH A
FREEDITE Pb8Cu+(As+++O3)2O3Cl5 M
GEORGIADESITE Pb4(AsO3)4Cl4(OH) M
EKATITE (Fe+++,Fe++,Zn)12(OH)6(AsO3)6[AsO3,HOSiO3]2 H
Arsenites, antimonites, bismuthites; without additional anions, with H2O
CAFARSITE (Ca,Na,[])19Ti8Fe+++4Fe++4(AsO3)28F C
LAZARENKOITE (Ca,Fe++)Fe+++As+++3O7.3H2O O
ROUSEITE Pb2Mn++(As+++O3)2.2H2O A
VAJDAKITE [(Mo++++++O2)2(H2O)2As+++2O5)].H2O M
Arsenites, antimonites, bismuthites; with additional anions, with H2O
NEALITE Pb4Fe++(As+++++O3)2Cl4.2H2O A
SEELITE Mg(UO2)(AsO4)0,6(AsO3)1,4.7H2O M
TOOELEITE Fe+++6(As+++O3)4SO4(OH)4.4H2O O
Sulfites
GRAVEGLIAITE Mn++(SO3).3H2O O
HANNEBACHITE Ca2(SO3)2.H2O O
ORSCHALLITE Ca3(SO3)2(SO4).12H2O R
SCOTLANDITE PbSO3 M
ALBERTINIITE (Fe++,Mn++)(SO3).3H2O M
FLEISSTALITE Fe++(SO3).3H2O O
Selenites without additional anions, without H2O
MOLYBDOMENITE PbSeO3 M
Selenites with additional anions, without H2O
GEORGBOKIITE Cu5(SeO3)2O2Cl2 M
PARAGEORGBOKIITE beta-Cu5(SeO3)2O2Cl2 M
CHLOROMENITE Cu9O2(SeO3)4Cl6 M
SOFIITE Zn2(Se++++O3)Cl2 O ps H
ILINSKITE (Na,K)Cu5(SeO3)2O2Cl3 O
FRANCISITE Cu3Bi(SeO3)2O2Cl O
DERRIKSITE Cu4(UO2)(SeO3)2(OH)6 O
BURNSITE KCdCu++7O2(SeO3)2Cl9 H
ALLOCHALCOSELITE Cu+Cu++5PbO2(SeO3)2Cl5 M
PREWITTITE KPb1,5Cu6Zn(SeO3)2O2Cl10 O
Selenites without additional anions, with H2O
CHALCOMENITE CuSeO3.2H2O O
AHLFELDITE (Ni,Co)SeO3.2H2O M
CLINOCHALCOMENITE CuSeO3.2H2O M
COBALTOMENITE CoSeO3.2H2O M
MANDARINOITE Fe+++2Se++++3O9.6H2O M
TELLUROMANDARINOITE Fe+++2Te3O9.6H2O M
ORLANDIITE Pb3SeO3Cl4.H2O A
LARISAITE (H3O)(Na,K)(UO2)3O2(SeO3)2.4H2O M
Selenites with additional anions, with H2O
MARTHOZITE Cu++(UO2)3(SeO3)2O2.8H2O O
GUILLEMINITE Ba(UO2)3(SeO3)2O2.3H2O O
PIRETITE Ca(UO2)3(SeO3)2(OH)4.4H2O O
DEMESMAEKERITE Pb2Cu5(UO2)2(SeO3)6(OH)6.2H2O A
HAYNESITE (UO2)3(SeO3)2(OH)2.5H2O O
Tellurites without additional anions, without H2O
WINSTANLEYITE TiTe++++3O8 C
WALFORDITE (Fe+++,Te++++++)(Te++++3O8) C
ZINCOSPIROFFITE Zn2(Te3O8) M
SPIROFFITE Mn++2Te3O8 M
BALYAKINITE CuTeO3 O
RAJITE CuTe++++2O5 M
CARLFRIESITE CaTe++++2Te++++++O8 M
DENNINGITE (Ca,Mn)(Mn,Zn)(Te2O5)2 Q
CHEKHOVICHITE (Bi,Pb,Fe)2Te4O11 M
SMIRNITE Bi2Te++++O5 O
CHOLOALITE PbCu++(Te++++O3)2.H2O C
FAIRBANKITE Pb12++(Te++++O3)11(SO4) A
PLUMBOTELLURITE PbTe++++O3 O
MAGNOLITE Hg+2Te++++O3 O
MOCTEZUMITE Pb(UO2)(TeO3)2 M
SCHMITTERITE (UO2)TeO3 O
CLIFFORDITE UTe3O9 C
Tellurites with additional anions, without H2O
RODALQUILARITE H3Fe+++2(Te++++O3)4Cl A
MACKAYITE Fe+++Te2O5(OH) Q
MROSEITE CaTe++++(CO3)O2 O
PINGGUITE Bi6Te++++++2O15 O
TLAPALLITE H6(Ca,Pb)2(Cu,Zn)3(SO4)(Te++++O3)4(Te++++++O6) M
Tellurites without additional anions, with H2O
ILIRNEYITE Mg0,5[ZnMn+++(TeO3)3].4,5H2O H
KEYSTONEITE Mg0,5[Ni++Fe+++(TeO3)3].4,5H2O H
KINICHILITE Mg0,5[Mn++Fe+++(TeO3)3].4,5H2O H
ZEMANNITE Mg0,5[Zn++Fe+++(Te++++O3)3].4,5H2O H
BLAKEITE Fe+++2(TeO3)3 (?)
EMMONSITE Fe+++2Te++++3O9.2H2O A
GRAEMITE CuTeO3.H2O O
TEINEITE CuTeO3.2H2O O
Tellurites with additional anions, with H2O
SONORAITE Fe+++Te++++O3(OH).H2O M
POUGHITE Fe+++2(TeO3)2(SO4).3H2O O
CESBRONITE Cu++3Te++++++O4(OH)4 O
EZTLITE Pb++2Fe+++3(Te++++O3)3(SO4)O2Cl M
JUABITE CaCu10(Te++++O3)4(As+++++O4)4(OH)2.4H2O A
Iodates: Trigonal [IO3] pyramids (mostly).
Iodates without additional anions, without H2O
LAUTARITE Ca(IO3)2 M
Iodates with additional anions, without H2O
SALESITE Cu(IO3)(OH) O
SCHWARTZEMBERGITE Pb++5I+++O6H2Cl3 Q
SEELIGERITE Pb3I+++++O4Cl3 O
BLUEBELLITE Cu6[I+++++O3(OH)3](OH)7Cl R
Iodates without additional anions, with H2O
BELLINGERITE Cu++3(IO3)6.2H2O A
BRUGGENITE Ca(IO3)2.H2O M
Iodates with additional anions, with H2O
DIETZEITE Ca2H2O(IO3)2(CrO4) M
GEORGEERICKSENITE Na6CaMg(IO3)6(CrO4,SO4)2.12H2O R
Oxides, etc. unclassified
XUITE Ca3Fe2[(AlO3(OH)]3 C
PSEUDOPOMITE Ca3,5[V++++6V+++++9O37(CO3)].29H2O A
ELGORESYITE (Mg5Si2)O9 M
SHAGAMITE KFe11O17 H
POMITE Ca3[V++++5V+++++10O37(CO3)].37H2O A
LIGUOWUITE WO3 M
IGELSTROMITE Fe+++(SbPb)O4 Q
WAD = Massive MANGNESE OXIDES    
PANDORAITE-Ba BaV++++5V+++++2O16.3H2O M
PAULOABIBITE NaNbO3 R
NOGGERATHITE-(Ce) (Ce,Ca)2Zr2(Nb,Ti)(Ti,Nb)2Fe++O14 O
NOLLMOTZITE Mg[U+++++(U++++++O2)2O4F3].4H2O M
OTTOITE Pb2Te++++++O5 M
PACKRATITE Ca11(As+++V+++++10V++++2As+++++6O51)2.83H2O A
NICKSOBOLEVITE Cu7(SeO3)2O2Cl6 M
PANDORAITE-Ca CaV++++5V+++++2O16.3H2O M
PANGUITE (Ti++++,Sc,Al,Mg,Zr,Ca)1,8O3 O
PARARAISAITE CuMg[Te++++++O4(OH)2].6H2O M
NESTOLAITE CaSeO3.H2O M
PASEROITE PbMn++(Fe+++,[])2(V+++++,Ti,[])18O38 R
MILLSITE Cu++(Te++++O3).2H2O M
PETERANDRESENITE Mn4Nb6O19.14H2O M
PLUMBOSELITE Pb3O2(SeO3) O
PARATIMROSEITE Pb2Cu++4(Te++++++O6)2(H2O)2 O
MAURIZIODINIITE (NH4)(As2O3)2I H
QATRANAITE CaZn2(OH)6(H2O)2 M
MAGNESIOHOGBOMITE-2N4S [(Mg8,43Fe++1,57)Al22Ti++++2O46(OH)2] R
MAGNESIOHOGBOMITE-6N12S Mg5Al11TiO23(OH) R
MAGNESIOTAAFFEITE-2N'2S2 Mg3Al8BeO16 R
MAMBERTIITE BiMo+++++2,80O8(OH) A
MAPIQUIROITE (Sr,Pb)(U,Y)Fe2(Ti,Fe+++,Cr+++)18O38 R
MOJAVEITE Cu6[Te++++++O4(OH)2](OH)7Cl R
MARKCOOPERITE Pb(UO2)Te++++++O6 M ps Q
NASHITE Na3Ca2[(V++++V+++++9)O28].24H2O M
MELCHERITE Ba2Na2Mg[Nb6O19].6H2O R
MENGXIANMINITE (Ca,Na)2Sn2(Mg,Fe)3Al8[(BO3)(BeO4)O6]2 O
MIANNINGITE ([],Pb,Ce,Na)(U++++,Mn,U++++++)Fe+++2(Ti,Fe+++)18O38 R
VESTAITE (Ti++++Fe++)Ti++++3O9 M
MIRNYITE SrZr++++(Ti++++12Cr+++6)Mg2O38 A
MORRISONITE Ca11(As3+V4+2V5+10As5+6O51)2.78H2O M
MARIINSKITE Be(Cr+++,Al)2O4 O
VORLANITE (CaU++++++)O4 C ps H
TORRECILLASITE Na(As,Sb)+++4O6Cl O
TREDOUXITE NiSb2O6 Q
TSCHAUNERITE (Fe++)(Fe++Ti++++)O4 O
TULULITE Ca14(Fe+++,Al)(Al,Zn,Fe+++,Si,P,Mn,Mg)15O36 C
USTURITE {Ca3}[Sb+++++Zr](Fe+++3)O12 C
MAGNESIOBELTRANDOITE-2N3S Mg8Al18Fe+++2O38(OH)2 R
VALLEYITE Ca4Fe6O13 C
PISEKITE-(Y) (Y,As,Ca,Fe,U)(Nb,Ti,Ta)O4  
TEWITE (K1,5[]0,5)(Te1,25W0,25[]0,5)W5O19 O
WERNERBAURITE (NH4)4Ca[V+++++10O28].16H2O A
WERNERKRAUSEITE Ca(Fe+++,Mn+++)2Mn++++O6 O
WOLFRAMOWODGINITE Mn(Mn,Sn,Fe,Ta)(W,Ta,Nb)2O8 M
WUMUITE KAl0,33W2,67O9 H
ZINCOMENITE ZnSeO3 O
ZINCOVELESITE-6N6S Zn3(Fe+++,Mn+++,Al,Ti)8O15(OH) R
VANARSITE NaCa12(As+++V+++++8,5V4++++3,5As+++++6O51)2.78H2O M
SEGERSTROMITE Ca3(As+++++O4)2[As+++(OH)3]2 C
RAKOVANITE (NH4)3Na3[V10O28].12H2O. M
RIESITE TiO2 M
ROWLEYITE [Na(NH4,K)9Cl4][V2(P,As)O8]6.n[H2O,Na,NH4,K,Cl] C
RUSSOITE (NH4)ClAs2O3(H2O)0,5 H
SACCOITE Ca2Mn+++2F(OH)8.0,5(SO4) Q
SARDIGNAITE Bi+++Mo2O7(OH).2H2O M
TIMROSEITE Pb2Cu++5(Te++++++O6)2(OH)2 O
SCHINDLERITE (NH4)4Na2[V+++++10O28].10H2O A
THORNEITE Pb6(Te++++++2O10)(CO3)Cl2(H2O) M
SHARYGINITE Ca3TiFe2O8 O
SHINKOLOBWEITE Pb1,25[U+++++(H2O)2(U++++++O2)5O8(OH)2](H2O)5 O
STEFANWEISSITE (Ca,REE)2Zr2(Nb,Ti)(Ti,Nb)2Fe++O14 O
TAKANAWAITE-(Y) Y(Ta,Nb)O4 M
TASHELGITE CaMgFe+++Al9O16(OH) M ps O
TAZZOLIITE Ba2CaSr0.5Na0.5Ti2Nb3SiO17[PO2(OH)2]0.5 O
RAISAITE Cu++Mg[Te++++++O4(OH)2].6H2O M
SARRABUSITE Pb5Cu(SeO3)4Cl4 M
FERROTAAFFEITE-2N'2S Be(Fe,Mg,Zn)3Al8O16 H
GAUTHIERITE KPb[(UO2)7O5(OH)7].8H2O M
DZHULUITE {Ca3}[Sb+++++Sn++++](Fe+++3)O12 C
ECKHARDITE (Ca,Pb)Cu++Te++++++O5(H2O) M
EKEBERGITE ThFeNb2O8 M
ELBRUSITE {Ca3}[U+++++0,5Zr1,5](Fe+++3)O12 C
MACHIITE Al2Ti3O9 M
CHUKOCHENITE LiAl5O8 O
FEIITE Fe++2(Fe++Ti++++)O5 O
CHIHUAHUAITE Fe++[Al12]O19 H
FINCHITE Sr(UO2)2(V2O8).5H2O O
FLUORKYUYGENITE Ca12Al14O32[(H2O)4F2] C
FLUORMAYENITE Ca12Al14O32F2 C
FUETTERERITE Pb3Cu++6Te++++++O6(OH)7Cl5 R ps H
GAJARDOITE KCa0,5As+++4O6Cl2.5H2O H / A
GATEWAYITE Ca6(As+++V++++3V+++++9As+++++6O51).31H2O M
EUREKADUMPITE (Cu,Zn)16(Te++++O3)2(AsO4)3Cl(OH)18.7H2O O ps H
BODIEITE Bi2(TeO3)2(SO4) M
ADANITE Pb2(Te++++O3)(SO4) M
AKAOGIITE TiO2 M
ALMEIDAITE PbZn2(Mn,Y)(Ti,Fe+++)18O37(OH,O) R
BAHARIYAITE KMnO4 O
BIANCHINIITE Ba2(TiV)(As2O5)2OF Q
BICAPITE [KNa2Mg2(H2O)25][H2PV+++++12O40(V+++++O)2] Q
CUYAITE Ca2Mn+++As+++14O24Cl M
BLUESTREAKITE K4Mg2(V++++2V+++++8O28).14H2O M
FAVREAUITE PbBiCu6O4(SeO3)4(OH).H2O Q
BRATTFORSITE Mn19As12O36Cl2 M
BURROITE Ca2(NH4)2(V10O28).15H2O A
CARBOIRITE Fe++Al2GeO5(OH)2 A
CARLOSBARBOSAITE (UO2)2Nb2O6(OH)2.2H2O O
CARMELTAZITE ZrAl2Ti4O11 O
CASEYITE [(V+++++O2)Al7,5(OH)15(H2O)13]2[H2V++++V+++++9O28][V+++++10O28]2.90H2O M
BILLWISEITE Sb+++5(Nb,Ta)3WO18 M
GELOSAITE Bi(Mo++++++,Mo+++++)2-2,5O7(OH).H2O M
KEGGINITE Pb3Ca3[AsV12O40(VO)].20H2O R
KOKINOSITE Na2Ca2(V+++++10O28).24H2O A
KOLLERITE (NH4)2Fe+++(SO3)2(OH).H2O O
KROTITE CaAl2O4 M
KROUPAITE KPb0,5[(UO2)8O4(OH)10].10H2O O
KRUIJENITE Ca4Al4(SO4)F2(OH)16.2H2O Q
KANGITE (Sc,Ti,Al,Zr,Mg,Ca,[])2O3 C
KYAWTHUITE Bi+++Sb+++++O4 M
LAGALYITE Ca2xMn1-xO2.1,5-2H2O (x = 0,05-0,08) M
LEESITE K(H2O)2[(UO2)4O2(OH)5].3H2O O
ERMAKOVITE (NH4)(As2O3)2Br H
LIUDONGSHENGITE Zn4Cr2(OH)12(CO3).3H2O R
LIUITE FeTiO3 O
LUCABINDIITE (K,NH4)As4O6(Cl,Br) H
LUMSDENITE NaCa3Mg2(As+++V++++2V+++++10As+++++6O51).45H2O A
LUOGUFENGITE epsilon-Fe2O3 O
KUDRYAVTSEVAITE Na3MgFe+++Ti4O12 O
HEISENBERGITE (UO2)(OH)2.H2O O
GORERITE Ca[AlFe+++11]O19 H
GREENWOODITE Ba2-x(V+++OH)xV9(Fe+++,Fe++)2Si2O22 R
POSTITE Mg(H2O)6Al2(OH)2(H2O)8(V10O28).13H2O O
GUNTERITE Na4Ca[V10O28].20H2O M ps H
HAGSTROMITE Pb8Cu++(Te++++++O6)2(CO3)Cl4 O
HAITAITE-(La) LaU++++Fe+++2(Ti13Fe++4Fe+++)O38 R
KAITIANITE Ti+++2Ti++++O5 M
HEAMANITE-(Ce) (K0,5Ce0,5)TiO3 C
LEPAGEITE Mn++3(Fe+++7Fe++4)O3[Sb+++5As+++8O34] A
HOUSLEYITE Pb6CuTe4O18(OH)2 M
HUENITE Cu4(MoO4)3(OH)2 R
HUGHESITE Na3Al(V10O28).22H2O A
HYDROPASCOITE Ca3(V10O28).24H2O A
ICE VII H2O C
JOELBRUGGERITE Pb3Zn3(Sb+++++,Te++++++)As2O13(OH,O) H
HARMUNITE CaFe+++2O4 O
* CARBONATES, NITRATES
Carbonates without additional anions, without H2O
Alkali carbonates
ZABUYELITE Li2CO3 M
GREGORYITE (Na2,K2,Ca)CO3 H (?)
NATRITE Na2CO3 M
NAHCOLITE NaHCO3 M
KALICINITE KHCO3 M
TESCHEMACHERITE (NH4)HCO3 O
WEGSCHEIDERITE Na5(CO3)(HCO3)3 A
Alkali-earth (and other M2+) carbonates
SPHAEROCOBALTITE CoCO3 R
SPHEROCOBALTITE CoCO3 R
SMITHSONITE ZnCO3 R
SIDERITE Fe++CO3 R
RHODOCHROSITE Mn++CO3 R
OTAVITE CdCO3 R
MAGNESITE MgCO3 R
CALCITE CaCO3 R
GASPEITE (Ni,Mg,Fe++)CO3 R
KUTNOHORITE Ca(Mn++,Mg,Fe++)(CO3)2 R
MINRECORDITE CaZn(CO3)2 R
ANKERITE Ca(Fe++,Mg,Mn)(CO3)2 R
DOLOMITE CaMg(CO3)2 R
ARAGONITE CaCO3 O
CERUSSITE PbCO3 O
STRONTIANITE SrCO3 O
WITHERITE BaCO3 O
VATERITE CaCO3 H
HUNTITE CaMg3(CO3)4 R
NORSETHITE BaMg(CO3)2 R
ALSTONITE BaCa(CO3)2 A ps O
PARALSTONITE BaCa(CO3)2 R
OLEKMINSKITE Sr(Sr,Ca,Ba)(CO3)2 R
BARYTOCALCITE BaCa(CO3)2 M
CARBOCERNAITE (Ca,Na)(Sr,Ce,Ba)(CO3)2 O
BENSTONITE (Ba,Sr)6(Ca,Mn)6Mg(CO3)13 R
JUANGODOYITE Na2Cu++(CO3)2 M
Alkali and alkali-earth carbonates
EITELITE Na2Mg(CO3)2 R
NYEREREITE Na2Ca(CO3)2 O
ZEMKORITE (Na,K)2Ca(CO3)2 H
BUTSCHLIITE K2Ca(CO3)2 R
FAIRCHILDITE K2Ca(CO3)2 H
SHORTITE Na2Ca2(CO3)3 O
SANROMANITE Na2CaPb3(CO3)5 H
KHANNESHITE (NaCa)3(Ba,Sr,Ce,Ca)3(CO3)5 H
CALCIOBURBANKITE Na3(Ca,Ce,La,Sr)3(CO3)5 H
BURBANKITE (Na,Ca)3(Sr,Ba,Ce)3(CO3)5 H
With rare-earth elements (REE)
SAHAMALITE-(Ce) (Mg,Fe++)Ce2(CO3)4 M
PETERSENITE-(Ce) (Na,Ca)4(Ce,La,Nd,Sr,Pr,Sm,Ba)2(CO3)5 M
REMONDITE-(Ce) Na3(Ce,La,Ca,Na,Sr)3(CO3)5 M ps H
REMONDITE-(La) Na3(La,Ce,Ca)3(CO3)5 M ps H
PARATOOITE-(La) (REE,Ca,Na,Sr)6Cu(CO3)8 or REE3(Ca,Sr)2NaCu(CO3)8 O
Carbonates with additional anions, without H2O
With Cu, Co, Ni, Zn, Mg, Mn
AZURITE Cu3(CO3)2(OH)2 M
ZINCROSASITE (Zn,Cu++)2(CO3)(OH)2 M
GEORGEITE Cu++5(CO3)3(OH)4.6H2O am.
GLAUKOSPHAERITE (Cu,Ni)2(CO3)(OH)2 M
KOLWEZITE (Cu++,Co)2(CO3)(OH)2 A
MALACHITE Cu2(CO3)(OH)2 M
MCGUINNESSITE (Mg,Cu++)2(CO3)(OH)2 M
NULLAGINITE Ni2(CO3)(OH)2 M
POKROVSKITE Mg2(CO3)(OH)2.0,5H2O M
ROSASITE (Cu++,Zn)2(CO3)(OH)2 M
CHUKANOVITE Fe++2(CO3)3(OH)2 M
HYDROZINCITE Zn5(CO3)2(OH)6 M
AURICHALCITE (Zn,Cu)5(CO3)2(OH)6 M
HOLDAWAYITE Mn++6(CO3)2(OH)7(Cl,OH) M
DEFERNITE Ca6(CO3)2-x(SiO4)x(OH)7(Cl,OH)1-2x (x=0,5) O
LOSEYITE (Mn,Zn)7(CO3)2(OH)10 M
SCLARITE (Zn,Mg,Mn++)4Zn3(CO3)2(OH)10 M
With alkalies, etc.
BARENTSITE Na7AlH2(CO3)4F4 A
DAWSONITE NaAl(CO3)(OH)2 O
TUNISITE NaCa2Al4(CO3)4(OH)8Cl Q
SABINAITE Na4Zr2TiO4(CO3)4 M
With alkali-earth cations
BRENKITE Ca2(CO3)F2 O
ROUVILLEITE Na3(Ca,Mn++)2(CO3)3(F,OH) M
PODLESNOITE BaCa2(CO3)2F2 O
With rare earth elements (REE)
CORDYLITE-(Ce) NaBaCe2(CO3)4F H
CORDYLITE-(La) (Na,Ca)Ba(La,Ce,Sr)2(CO3)4F H
LUKECHANGITE-(Ce) Na3(Ce,La,Nd)2(CO3)4F H
KUKHARENKOITE-(Ce) Ba2Ce(CO3)3F M
KUKHARENKOITE-(La) Ba2(La,Ce,Th)(CO3)3F M
ZHONGHUACERITE-(Ce) Ba2Ce(CO3)3F R
CEBAITE-(Ce) Ba3Ce2(CO3)5F2 M
CEBAITE-(Nd) Ba3(Nd,Ce)2(CO3)5F2 M
ARISITE-(Ce) NaCe2(CO3)2[(CO3)1-xF2x]F H
ARISITE-(La) NaLa2(CO3)2[F2x(CO3)1-x]F H
PARISITE-(La) Ca(La,Nd,Ce)2F2(CO3)3 M ps R ?
THORBASTNASITE Th(Ca,Ce)(CO3)2F2.3H2O H
BASTNASITE-(Ce) (Ce,La)(CO3)F H
BASTNASITE-(La) (La,Ce)(CO3)F H
BASTNASITE-(Nd) (Nd,La,Ce)(CO3)F H
BASTNASITE-(Y) (Y,Ce)(CO3)F H
HYDROXYLBASTNASITE-(Ce) (Ce,La)(CO3)(OH,F) H
HYDROXYLBASTNASITE-(La) La(CO3)(OH) H
HYDROXYLBASTNASITE-(Nd) (Nd,La)(CO3)(OH,F) H
PARISITE-(Ce) CaCe2F2(CO3)3 M
PARISITE-(Nd) Ca(Nd,Ce,La)2(CO3)3F2 R
SYNCHYSITE-(Ce) Ca(Ce,La)(CO3)2F M
SYNCHYSITE-(Nd) Ca(Nd,La)(CO3)2F M ps H
SYNCHYSITE-(Y) (Y,Ce)Ca(CO3)2F M ps H
RONTGENITE-(Ce) Ca2(Ce,La)3(CO3)5F3 R
HORVATHITE-(Y) NaY(CO3)F2 O
QAQARSSUKITE (Ba,Ca,Sr)(Ce,La,Nd)(CO3)2F R
HUANGHOITE-(Ce) BaCe(CO3)2F R
With Pb, Bi
SHANNONITE Pb2OCO3 O
HYDROCERUSSITE Pb3(CO3)2(OH)2 R
PLUMBONACRITE Pb5O(OH)2(CO3)3 H
PHOSGENITE Pb2(CO3)Cl2 Q
BISMUTITE Bi2(CO3)O2 Q
KETTNERITE CaBi(CO3)OF Q
BEYERITE (Ca,Pb)Bi2(CO3)2O2 Q
ABELLAITE NaPb2(CO3)2(OH) H
With (Cl), SO4, PO4, TeO3
MANGANOTYCHITE Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 C
NORTHUPITE Na3Mg(CO3)2Cl C
FERROTYCHITE Na6Fe++2(SO4)(CO3)4 C
TYCHITE Na6Mg2(CO3)4(SO4) C
BONSHTEDTITE Na3Fe++(PO4)(CO3) M ps O
BRADLEYITE Na3Mg(PO4)(CO3) M
CRAWFORDITE Na3Sr(PO4)(CO3) M ps O
SIDORENKITE Na3Mn(PO4)(CO3) M ps O
DAQINGSHANITE-(Ce) (Sr,Ca,Ba)3(Ce,La)(PO4)(CO3)3-x(OH,F)x H
REEDERITE-(Y) (Na,Al,Mn,Ca)15(Y,Ce,Nd,La)2(CO3)9(SO3F)(Cl,F) H
MINEEVITE-(Y) Na25Ba(Y,Gd,Dy)2(HCO3)4(CO3)11(SO4)2ClF2 H
BRIANYOUNGITE Zn3(CO3,SO4)(OH)4 M ps O
PHILOLITHITE Pb12O6Mn(Mg,Mn++)2(Mn,Mg)4(SO4)(CO3)4Cl4(OH)12 Q
LEADHILLITE Pb4(SO4)(CO3)2(OH)2 M ps A
MACPHERSONITE Pb4(SO4)(CO3)2(OH)2 O
SUSANNITE Pb4(SO4)(CO3)2(OH)2 R
Carbonates without additional anions, with H2O
With medium-sized cations
NESQUEHONITE Mg(CO3).3H2O M
LANSFORDITE MgCO3.5H2O M
BARRINGTONITE MgCO3.2H2O A
HELLYERITE NiCO3.6H2O A
With large cations (alkali and alkali-earth carbonates)
THERMONATRITE Na2CO3.H2O O
NATRON Na2CO3.10H2O M
TRONA Na3(CO3)(HCO3).2H2O M
MONOHYDROCALCITE CaCO3.H2O H
IKAITE CaCO3.6H2O M
PIRSSONITE Na2Ca(CO3)2.2H2O O
GAYLUSSITE Na2Ca(CO3)2.5H2O M
CHALCONATRONITE Na2Cu(CO3)2.3H2O M
BAYLISSITE K2Mg(CO3)2.4H2O M
TULIOKITE BaNa6Th(CO3)6.6H2O H
BAINBRIDGEITE-(YCe) Na2Ba2YCe(CO3)6.3H2O A
MCKELVEYITE-(Nd) (Ba,Sr)(Nd,Ce,La)(CO3)2. 4-10H2O A
MCKELVEYITE-(Y) Ba3Na(Ca,U)Y(CO3)6.3H2O A ps R
EWALDITE (Ba,Sr)(Ca,Na,Y,Ce)(CO3)2.10-12H2O H
DONNAYITE-(Y) Sr3NaCaY(CO3)6.3H2O A ps R
WELOGANITE Sr3Na2Zr(CO3)6.3H2O A ps R
TENGERITE-(Y) Y2(CO3)3.nH2O O
KIMURAITE-(Y) CaY2(CO3)4.6H2O O
LOKKAITE-(Y) CaY4(CO3)7.9H2O O
SHOMIOKITE-(Y) Na3Y(CO3)3.3H2O O
LANTHANITE-(Nd) (Nd,La)2(CO3)3.8H2O O
LANTHANITE-(La) (La,Ce)2(CO3)3.8H2O O
CALKINSITE-(Ce) (Ce,La)2(CO3)3.4H2O O
LANTHANITE-(Ce) (Ce,La)2(CO3)3.8H2O O
ADAMSITE-(Y) NaY(CO3)2.6H2O A
DECRESPIGNYITE-(Y) (Y,Gd,Dy)4Cu(CO3)4Cl(OH)5.2H2O M ps H
GALGENBERGITE-(Ce) Ca(Ce,La,Nd)2(CO3)4.H2O A
ALICEWILSONITE-(Yla) Na2Sr2YLa(CO3)6.3H2O A
With rare earth elements (REE)
HIZENITE-(Y) Ca2Y6(CO3)11.14H2O O
ALICEWILSONITE-(YCe) Na2Sr2YCe(CO3)6.3H2O A
Carbonates with additional anions, with H2O
With medium-sized cations
GIORGIOSITE Mg5(CO3)4(OH)2.5-6H2O (?)
HYDROMAGNESITE Mg5(CO3)4(OH)2.4H2O M
DYPINGITE Mg5(CO3)4(OH)2.5H2O M (?)
WIDGIEMOOLTHALITE (Ni,Mg)5(CO3)4(OH)2.4-5H2O M
ARTINITE Mg2(CO3)(OH)2.3H2O M
CHLORARTINITE Mg2(CO3)Cl(OH).3H2O R
INDIGIRITE Mg2Al2(CO3)4(OH)2.15H2O M (?)
OTWAYITE Ni2(CO3)(OH)2.H2O O
ZARATITE Ni3(CO3)(OH)4.4H2O C
KAMBALDAITE NaNi4(CO3)3(OH)3.3H2O H
CALLAGHANITE Cu2Mg2(CO3)(OH)6.2H2O M
CLARAITE (Cu,Zn)15(AsO4)2(CO3)4(SO4)(OH)14.7H2O A
HYDROSCARBROITE Al14(CO3)3(OH)36.nH2O A
SCARBROITE Al5(OH)13(CO3).5H2O H
CARESITE (Fe++,Mg)4Al2(OH)12(CO3).3H2O R
CHARMARITE Mn++4Al2(OH)12(CO3).3H2O H/R
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
QUINTINITE [Mg4Al2(OH)12][(CO3)(H2O)3] M
QUINTINITE (Mg,Fe++)4Al2(OH)12(CO3).3H2O H/R
CHLORMAGALUMINITE (Mg,Fe++)4Al2(OH)12(Cl2,CO3).2H2O H
ZACCAGNAITE Zn4Al2(OH)12(CO3).3H2O H
BRUGNATELLITE Mg6Fe+++(CO3)(OH)13.4H2O H
MANASSEITE = HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O H
KAZNAKHTITE Ni6Co+++2(CO3)(OH)16.4H2O R
BARBERTONITE = STICHTITE Mg6Cr2(CO3)(OH)16.4H2O H
DESAUTELSITE Mg6Mn+++2(CO3)(OH)16.4H2O R
HYDROTALCITE Mg6Al2(CO3)(OH)16.4H2O R
HYDROTALCITE-3R Mg6Al2(CO3)(OH)16.4H2O R
PYROAURITE Mg6Fe+++2(CO3)(OH)16.4H2O R
REEVESITE Ni6Fe+++2(CO3)(OH)16.4H2O R
STICHTITE Mg6Cr+++2(CO3)(OH)16.4H2O R
TAKOVITE Ni6Al2(OH)16(CO3,OH).4H2O R
COMBLAINITE Ni++6Co+++2(CO3)(OH)16.4H2O R
COALINGITE Mg10Fe+++2(CO3)(OH)24.2H2O R
AKOPOVAITE Al4Li2(OH)12(CO3)(H2O)3 M
ALEXKHOMYAKOVITE K6(Ca2Na)(CO3)5Cl.6H2O H
With large and medium-sized cations
ALUMOHYDROCALCITE CaAl2(CO3)2(OH)4.3H2O A
NASLEDOVITE PbMn3Al4(CO3)4(SO4)O5.5H2O (?)
PARAALUMOHYDROCALCITE CaAl2(CO3)2(OH)4.6H2O (?)
MONTROYALITE Sr4Al8(CO3)3(OH,F)26.10-11H2O A (?)
STRONTIODRESSERITE (Sr,Ca)Al2(CO3)2(OH)4.H2O O
KOCHSANDORITE CaAl2(CO3)2(OH)4.1,5H2O O
DUNDASITE PbAl2(CO3)2(OH)4.H2O O
DRESSERITE BaAl2(CO3)2(OH)4.H2O O
HYDRODRESSERITE BaAl2(CO3)2(OH)4.3H2O A
SCHUILINGITE-(Nd) PbCu(Nd,Gd,Sm,Y)(CO3)3(OH).1,5H2O O
SERGEEVITE Ca2Mg11(CO3)13-x(HCO3)x(OH)x.10-xH2O (x=4) R
SZYMANSKIITE Hg+16(Ni,Mg)6(CO3)12(OH)12(H3O8).3H2O H
GRGURICITE CaCr2(CO3)2(OH)4.4H2O A
With large cations
CALCIOANCYLITE-(Ce) (Ca,Sr)(Ce,REE)(CO3)2(OH).H2O O
KOZOITE-(Nd) (Nd,La)(CO3)(OH) O
KOZOITE-(La) (La,Ce,Nd)(CO3)(OH) O
GYSINITE-(Nd) Pb(Nd,La)(CO3)2(OH).H2O O
ANCYLITE-(La) Sr(La,Ce)(CO3)2(OH).H2O O
ANCYLITE-(Ce) SrCe(CO3)2(OH).H2O O
CALCIOANCYLITE-(Nd) Ca(Nd,Ce,Gd,Y)3(CO3)4(OH)3.H2O O
KAMPHAUGITE-(Y) Ca(Y,REE)(CO3)2(OH).H2O Q
SHELDRICKITE NaCa3(CO3)2F3.H2O R
THOMASCLARKITE-(Y) Na(Y,REE)(HCO3)(OH)3.4H2O M ps Q
PETERBAYLISSITE Hg+3(CO3)(OH).2H2O O
CLEARCREEKITE Hg+3(CO3)(OH).2H2O M
NIVEOLANITE NaBeCO3(OH).1-2H2O Q
Uranyl Carbonates
UO2:CO3 > 1:1
URANCALCARITE Ca(UO2)3(CO3)(OH)6.3H2O O
WYARTITE CaU+++++(UO2)2(CO3)O4(OH).7H2O O
OSWALDPEETERSITE (UO2)2CO3(OH)2.4H2O M
ROUBAULTITE Cu2(UO2)3(CO3)2O2(OH)2.4H2O A
KAMOTOITE-(Y) (Y,Nd,Gd)2U++++++4(CO3)3O12.14,5H2O M
SHARPITE Ca(UO2)3(CO3)4.3H2O O
UO2:CO3 = 1:1
RUTHERFORDINE UO2(CO3) O
BLATONITE (UO2)(CO3).H2O H/R (?)
JOLIOTITE (UO2)(CO3).2H2O O
BIJVOETITE-(Y) [(Y,REE)8(H2O)25(UO2)16O8(OH)8(CO3)16](H2O)14 M ps O
UO2:CO3 < 1:1 - 1:2
FONTANITE Ca(UO2)3(CO3)4.3H2O O
ZELLERITE Ca(UO2)(CO3)2.5H2O O
METAZELLERITE Ca(UO2)(CO3)2.3H2O O
MEYROWITZITE Ca(UO2)(CO3)2.5H2O M
UO2:CO3 = 1:3
BAYLEYITE Mg2(UO2)(CO3)3.18H2O M
SWARTZITE CaMg(UO2)(CO3)3.12H2O M
ALBRECHTSCHRAUFITE Ca4Mg(UO2)2(CO3)6F2.17H2O A
LIEBIGITE Ca2(UO2)(CO3)3.11H2O O
RABBITTITE Ca3Mg3(UO2)2(CO3)6(OH)4.18H2O M
ANDERSONITE Na2Ca(UO2)(CO3)3.6H2O R
GRIMSELITE K3Na(UO2)(CO3)3.H2O H
WIDENMANNITE Pb2(UO2)(CO3)3 O
ZNUCALITE CaZn11(UO2)(CO3)3(OH)20.4H2O A
AGRICOLAITE K4(UO2)(CO3)3 M
CEJKAITE Na4(UO2)(CO3)3 A
UO2:CO3= 1:4
VOGLITE Ca2Cu++(UO2)(CO3)4.6H2O M
SHABAITE-(Nd) Ca(Nd,Ce,Sm,Gd,Y)2[(UO2)(CO3)3](CO3)2(H2O)10,5 M
UO2:CO3 = 1:5
ASTROCYANITE-(Ce) Cu+2(Ce,Nd,La,Pr,Sm,Ca,Y)2(UO2)(CO3)5(OH)2.3H2O H
With SO4 or SiO4
SCHROCKINGERITE NaCa3(UO2)(CO3)3(SO4)F.10H2O A
LEPERSONNITE-(Gd) CaO.(Gd,Dy)2O3.24UO3.8CO2.4SiO2.60H2O O
NITRATES
Without OH or H2O
NITRATINE NaNO3 R
NITER KNO3 O
GWIHABAITE (NH4,K)(NO3) O
NITROBARITE Ba(NO3)2 C
With OH
ROUAITE Cu2(NO3)(OH)3 M
GERHARDTITE Cu2(NO3)(OH)3 O
With H2O
NITROMAGNESITE Mg(NO3)2.6H2O M
NITROCALCITE Ca(NO3)2.4H2O M
With OH (etc.) and H2O
LIKASITE Cu3(NO3)(OH)5.2H2O O
MBOBOMKULITE (Ni,Cu)Al4[(NO3)2,(SO4)](OH)12.3H2O M
HYDROMBOBOMKULITE (Ni,Cu)Al4(NO3,SO4)2(OH)12.14H2O M
SVEITE KAl7(NO3)4Cl2(OH)16.8H2O M
Carbonates, etc. unclassified
PARAMARKEYITE Ca2(UO2)(CO3)3.5H2O M
NITROPLUMBITE [Pb4(OH)4](NO3)4 M
SOMERSETITE Pb8O2(OH)2(CO3)5 H
MARKLITE Cu5(CO3)2(OH)6.6H2O M
MOSSBAUERITE Fe+++6O4(OH)8[CO3].3H2O R
NATROMARKEYITE Na2Ca8(UO2)4(CO3)13(H2O)24.3H2O O
PADDLEWHEELITE MgCa5Cu2(UO2)4(CO3)12(H2O)33 M
PARADSASVARITE Zn2(CO3)(OH)2 M
PSEUDOMARKEYITE Ca8(UO2)4(CO3)12(H2O)18.3H2O M
PUTNISITE SrCa4Cr+++8(CO3)8SO4(OH)16.25H2O O
SLIKITE Zn2Mg(CO3)2(OH)2.4H2O A
LISLKIRCHNERITE Pb6Al(OH)8Cl2(NO3)5.2H2O M
SHILOVITE Cu(NH3)4(NO3)2 O
ELASMOCHLOITE Na3Cu6BiO4(SO4)5 M
LUSERNAITE-(Y) Y4Al(CO3)2(OH,F)11.6H2O O
DRITSITE Li2Al4(OH)12Cl2.3H2O H
ELEOMELANITE (K2Pb)Cu4O2(SO4)4 M
GROOTFONTEINITE Pb3O(CO3)2 H
JEZEKITE Na8[UO2(CO3)3(SO4)2].2H2O H
LECOQITE-(Y) Na3Y(CO3)3.6H2O H
LEOSZILARDITE Na6Mg(UO2)2(CO3)6.6H2O M
LINEKITE K2Ca3[(UO2)(CO3)3]2.8H2O O
MARKEYITE Ca9(UO2)4(CO3)13.28H2O O
ALDZHANITE CaMgB2O4Cl.7H2O O
* BORATES
Monoborates
BO3, without additional anions; 1(D).
SASSOLITE H3BO3 A
NORDENSKIOLDINE CaSnB2O6 R
TUSIONITE Mn++Sn++++(BO3)2 R
KOTOITE Mg3B2O6 O
JIMBOITE Mn3B2O6 O
TAKEDAITE Ca3B2O6 R
BO3, with additional anions; 1(D) + OH, etc.
CHUBAROVITE KZn2(BO3)Cl2 R
HAMBERGITE Be2BO3(OH) O
BERBORITE Be2(BO3)(OH,F).H2O H
BERBORITE Be2(BO3)(OH,F).H2O R
JEREMEJEVITE Al6B5O15(F,OH)3 H
YUANFULIITE Mg(Fe+++,Fe++,Al,Ti,Mg)(BO3)O O
WARWICKITE (Mg,Ti,Fe,Cr,Al)2O(BO3) O
KARLITE (Mg,Al)6(BO3)3(OH,Cl)4 O
BONACCORDITE Ni2Fe+++BO5 O
FREDRIKSSONITE Mg2(Mn+++,Fe+++)BO5 O
LUDWIGITE Mg2Fe+++BO5 O
VONSENITE Fe++2Fe+++BO5 O
AZOPROITE (Mg,Fe++)2(Fe+++,Ti,Mg)BO5 O
PINAKIOLITE (Mg,Mn++)2(Mn+++,Sb+++)BO5 M
FOLVIKITE Sb+++++9Mn+++(Mg,Mn++)10O8(BO3)4 M
TAKEUCHIITE Mn+++11[(Mn++,Mg)xFe+++y[]z](BO3)12O24 (sum x,y,z=25) O
ORTHOPINAKIOLITE Mn+++7[(Mn++,Mg)xFe+++y[]z](BO3)8O16 (sum x,y,z=17) O
CHESTERMANITE Sb+++++(Mn+++,Fe+++)5[(Mn++,Mg)xFe+++y](BO3)8O16 (sum x,y=18) O
BLATTERITE Sb+++++3(Mn+++,Fe+++)9(Mn++,Mg)35(BO3)16O32 O
ALUMINOMAGNESIOHULSITE (Mg,Fe++)2(Al,Mg,Sn)2(BO3)O2 M
HULSITE Fe++2Fe+++O2(BO3) M
MAGNESIOHULSITE (Mg,Fe++)2(Fe+++,Sn++++,Mg)BO5 M
FLUOBORITE Mg3(BO3)(F,OH)3 H
HYDROXYLBORITE Mg3(BO3)(OH,F)3 H
WIGHTMANITE Mg5(BO3)O(OH)5.2H2O M
SHABYNITE Mg5(BO3)(Cl,OH)2(OH)5.4H2O M
GAUDEFROYITE Ca4Mn+++3-x(BO3)3(CO3)(O,OH)3 H
SAKHAITE Ca48Mg16(BO3)32(CO3)16.2(H2O,HCl) C
HARKERITE Ca48Mg16[AlSi4O15(OH)]4(BO3)16(CO3)16.2(H2O,HCl) C
PERTSEVITE-(F) Mg2(BO3,SiO4)(F,OH)0,5-1 O
PERTSEVITE-(OH) Mg2(BO3,SiO4)(OH,F)0,5-1 O
JACQUESDIETRICHITE Cu2(OH)3BO(OH2) O
PAINITE CaZrBAl9O18 H
SAVELIEVAITE Mg2Cr+++O2(BO3) O
MARINAITE Cu2Fe+++O2(BO3) M
B(O,OH)4, without and with additional anions; 1(T), 1(T)+OH, etc
SINHALITE MgAlBO4 O
PSEUDOSINHALITE (Mg,Fe++)2Al3B2O9(OH) M
BEHIERITE (Ta,Nb)BO4 Q
SCHIAVINATOITE (Nb,Ta)BO4 Q
FROLOVITE CaB2(OH)8 A
HEXAHYDROBORITE Ca[B(OH)4]2.2H2O M
HENMILITE Ca2Cu[B(OH)4]2(OH)4 A
BANDYLITE CuB(OH)4Cl Q
TEEPLEITE Na2B(OH)4Cl Q
MOYDITE-(Y) YB(OH)4(CO3) O
CARBOBORITE Ca2Mg(CO3)2B2(OH)8.4H2O M
SULFOBORITE Mg3B2(SO4)(OH)8(OH,F)2 O
LUNEBURGITE Mg3B2(PO4)2(OH)6.5H2O M
SEAMANITE Mn3(PO4)B(OH)6 O
CAHNITE Ca2B(AsO4)(OH)4 Q
Diborates
Neso-diborates with double triangles B2(O,OH)5; 2(2D); 2(2D) + OH, etc.
SUANITE Mg2B2O5 M
CLINOKURCHATOVITE Ca(Mg,Fe++,Mn)B2O5 M
KURCHATOVITE Ca(Mg,Mn,Fe++)B2O5 O
SUSSEXITE MnBO2(OH) M
SZAIBELYITE MgBO2(OH) M
WISERITE (Mn++,Mg)14B8(Si,Mg)O22(OH)10Cl Q
Neso-diborates with double tetrahedra B2O(OH)6; 2(2T)
PINNOITE MgB2O4.3H2O Q
PENTAHYDROBORITE CaB2O(OH)6.2H2O A
Ino-diborates with triangles and/or tetrahedra
CALCIBORITE CaB2O4 O
VIMSITE CaB2O2(OH)4 M
SIBIRSKITE Ca2B2O4(OH)2 M
PARASIBIRSKITE Ca2B2O5.H2O M
Tektodiborates with tetrahedra
SANTAROSAITE Cu(B2O4) Q
Triborates
Neso-triborates
AMEGHINITE NaB3O3(OH)4 M
INDERITE MgB3O3(OH)5.5H2O M
KURNAKOVITE MgB3O3(OH)5.5H2O A
INDERBORITE CaMg[B3O3(OH)5]2.6H2O M
MEYERHOFFERITE Ca2B6O6(OH)10.2H2O A
INYOITE Ca2B6O6(OH)10.8H2O M
SOLONGOITE Ca2B3O4(OH)4Cl M
PEPROSSIITE-(Ce) (Ce,La)Al2(B4O10)O0,5 H
NIFONTOVITE Ca3B6O6(OH)12(H2O)2 M
OLSHANSKYITE Ca2[B3O3(OH)6](OH)(H2O)3 A
COLEMANITE CaB3O4(OH)3.H2O M
HYDROBORACITE CaMgB6O8(OH)6.3H2O M
HOWLITE Ca2B5SiO9(OH)5 M
JARANDOLITE CaB3O4(OH)3 M
Phyllo-triborates
JOHACHIDOLITE CaAlB3O7 O
Tetraborates
ALFREDSTELZNERITE Ca4(H2O)4[B4O4(OH)6]4(H2O)15 O
Neso-tetraborates
BORAX Na2B4O5(OH)4.8H2O M
TINCALCONITE Na6[B4O5(OH)4]3.8H2O R
HUNGCHAOITE MgB4O5(OH)4.7H2O A ps H
FEDOROVSKITE Ca2(Mg,Mn)2B4O7(OH)6 O
ROWEITE Ca2Mn++2B4O7(OH)6 O
HYDROCHLORBORITE Ca2B4O4(OH)7Cl.7H2O M
URALBORITE CaB2O2(OH)4 M
BORCARITE Ca4MgB4O6(OH)6(CO3)2 M
NUMANOITE Ca4CuB4O6(CO3)2(OH)6 M
FONTARNAUITE (Na,K)2(Sr,Ca)(SO4)[B5O8(OH)](H2O)2 M
Ino-tetraborates
KERNITE Na2B4O6(OH)2.3H2O M
Phyllo-tetraborates
Tekto-tetraborates
Pentaborates
Neso-pentaborates
LEUCOSTAURITE Pb2[B5O9]Cl.0,5H2O O
SBORGITE NaB5O6(OH)4.3H2O M
RAMANITE-(Cs) CsB5O6(OH)4.4H2O M
RAMANITE-(Rb) RbB5O6(OH)4.4H2O O
SANTITE KB5O6(OH)4.2H2O O
AMMONIOBORITE (NH4)2B10O16.5H2O M
ULEXITE NaCaB5O6(OH)6.5H2O A
Ino-pentaborates
LARDERELLITE (NH4)B5O6(OH)4 M
EZCURRITE Na4B10O17.7H2O A
PROBERTITE NaCaB5O7(OH)4.3H2O M
TERTSCHITE Ca4B10O19.20H2O M (?)
PRICEITE Ca2B5O7(OH)5.H2O A
Phyllo-pentaborates
NASINITE Na2B5O8(OH).2H2O O
BIRINGUCCITE Na2B5O8(OH).H2O M
GOWERITE CaB6O10.5H2O M
VEATCHITE-A = Discredited Sr2B11O16(OH)5.H2O A
VEATCHITE Sr2B11O16(OH)5.H2O M
VEATCHITE Sr2B11O16(OH)5.H2O M
CALCIOVEATCHITE SrCaB11O16(OH)5.H2O M
VOLKOVSKITE KCa4[B5O8(OH)4][B(OH)3]Cl.4H2O A
TUZLAITE NaCaB5O8(OH)2.3H2O M
HEIDORNITE Na2Ca3B5O8(SO4)2Cl(OH)2 M
BRIANROULSTONITE Ca3B5O6(OH)Cl2.8H2O M
Tekto-pentaborates
HILGARDITE Ca2B5O9Cl.H2O A
TYRETSKITE Ca2B5O9(OH).H2O A
KURGANTAITE CaSrB5O9Cl.H2O A
Hexaborates
Neso-hexaborates
AKSAITE MgB6O7(OH)6.2H2O O
MCALLISTERITE Mg2B12O14(OH)12.9H2O R
ADMONTITE MgB6O10.7H2O M
RIVADAVITE Na6Mg[B6O7(OH)6]4.10H2O M
TERUGGITE Ca4MgAs2B12O22(OH)12.12H2O M
Ino-hexaborates
ARISTARAINITE Na2MgB12O20.10H2O M
KALIBORITE KHMg2B12O16(OH)10.4H2O M
Phyllo-hexaborates
NOBLEITE CaB6O9(OH)2.3H2O M
TUNELLITE SrB6O9(OH)2.3H2O M
STRONTIOBORITE SrB8O11(OH)4 M
GINORITE Ca2B14O23.8H2O M
STRONTIOGINORITE SrCaB14O20(OH)6.5H2O M
FABIANITE CaB3O5(OH) M
Heptaborates and other megaborates
Tekto-heptaborates
BORACITE Mg3B7O13Cl O ps C
CHAMBERSITE Mn3B7O13Cl O
ERICAITE (Fe++,Mg,Mn)3B7O13Cl O
CONGOLITE (Fe++,Mg,Mn)3B7O13Cl R
TREMBATHITE (Mg,Fe++,Mn)3B7O13Cl R
KORZHINSKITE CaB2O4.H2O M
Phyllo-nonborates, etc.
STUDENITSITE NaCa2B9O14(OH)4.2H2O M
PENOBSQUISITE Ca2(Fe++,Mg)[B9O13(OH)6]Cl.4H2O M
PREOBRAZHENSKITE Mg3B11O15(OH)9 O
WALKERITE Ca16(Mg,Li)2Cl6B52O68(OH)56.28H2O O
Tekto-dodecaborates
LONDONITE (Cs,K,Rb)Al4Be4(B,Be)12O28 C
RHODIZITE (K,Cs)Al4Be4(B,Be)12O28 C
Mega-tektoborates
PRINGLEITE Ca9B26O34(OH)24Cl4.13H2O A
RUITENBERGITE Ca9B26O34(OH)24Cl4.13H2O M
METABORITE HBO2 C
Unclassified borates
CHELKARITE CaMgB2O4(Cl,OH)2.5H2O (?) O
BRAITSCHITE-(CE) (Ca,Na)7(Ce,La,Nd)2[B6O7(OH)3(O,OH)3]4.(H2O) H
SATIMOLITE KNa2(Al5Mg2)[B12O18(OH)12](OH)6Cl4.4H2O R
IQUIQUEITE K3Na4Mg(Cr++++++O4)B24O39(OH).12H2O H
WARDSMITHITE Ca5MgB24O42.30H2O H
HALURGITE Mg4[B8O13(OH)2]2.7H2O M
EKATERINITE Ca2B4O7(Cl,OH)2.2H2O H
VITIMITE Ca6SO4B14O19(OH)14.5H2O M
CANAVESITE Mg2(CO3)(HBO3).5H2O M
QILIANSHANITE NaH4(CO3)(BO3).2H2O M
Bromates, etc. unclassified
REDCANYONITE (NH4)2Mn[(UO2)4O4(SO4)2](H2O)4 M
YARZHEMSKIITE K[B5O7(OH)2].H2O M
VRANAITE Al16B4Si4O38 M
SHIMAZAKIITE-4M Ca2B2-xO5-3x(OH)3x (x=0-0,06) M
RHABDOBORITE-(Mo) Mg12Mo++++++1,33O6(BO3)6F2 H
RHABDOBORITE-(V) Mg12(V+++++,Mo++++++,W++++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
RHABDOBORITE-(W) Mg12(W++++++,V+++++)1,5O6{[BO3]6-x[(P,As)O4]xF2-x} (x smaller than 1) H
KRASNOSHTEINITE Al8[B2O4(OH)2](OH)16Cl4.7H2O M
IMAYOSHIITE Ca3Al(CO3)[B(OH)4](OH)6.12H2O H
EWINGITE Mg8Ca8(UO2)24(CO3)30O4(OH)12(H2O)138 Q
CLINOMETABORITE HBO2 M
CHIYOKOITE Ca3Si(CO3)[B(OH)4]O(OH)5.12H2O H
POPUGAEVAITE Ca3[B5O6(OH)6]FCl2.8H2O M
* SULFATES, selenates, tellurates, chromates, molybdates, wolframates
Sulfates (selenates, etc.) without additional anions, without H2O
With small cations
With medium-sized cations
DRAVERTITE CuMg(SO4)2 M
MIKASAITE (Fe+++,Al)2(SO4)3 R
MILLOSEVICHITE (Al,Fe+++)2(SO4)3 R
CHALCOCYANITE CuSO4 O
ZINKOSITE ZnSO4 O
MCALPINEITE Cu++3Te++++++O6.H2O C
HERMANNJAHNITE CuZn(SO4)2 M
With medium-sized and large cations
VANTHOFFITE Na6Mg(SO4)4 M
PYRACMONITE (NH4)3Fe+++(SO4)3 R ps H
EFREMOVITE (NH4)2Mg2(SO4)3 C
FERROEFREMOVITE (NH4)2Fe++2(SO4)3 C
LANGBEINITE K2Mg2(SO4)3 C
MANGANOLANGBEINITE K2Mn2(SO4)3 C
YAVAPAIITE KFe+++(SO4)2 M
ELDFELLITE NaFe+++(SO4)2 M
STEKLITE KAl(SO4)2 R
GODOVIKOVITE (NH4)(Al,Fe+++)(SO4)2 H
SABIEITE (NH4)Fe+++(SO4)2 R
THENARDITE Na2SO4 O
METATHENARDITE Na2SO4 H
APHTHITALITE (K,Na)3Na(SO4)2 R
MOHNITE (NH4)K2Na(SO4)2 R
ACMONIDESITE (NH4,K,Pb)8NaFe++4(SO4)5Cl8 O
ALUMINOPYRACMONITE (NH4)3Al(SO4)3 R
With only large cations
ARCANITE 'TAYLORITE' K2SO4 O
MASCAGNITE (NH4)2SO4 O
ARCANITE K2SO4 0
MERCALLITE KHSO4 O
MISENITE K8H6(SO4)7 M
LETOVICITE (NH4)3H(SO4)2 A
GLAUBERITE Na2Ca(SO4)2 M
ANHYDRITE CaSO4 O
CELESTINE SrSO4 O
OLSACHERITE Pb2(SeO4)(SO4) O
BARYTE BaSO4 O
ANGLESITE PbSO4 O
PALMIERITE (K,Na)2Pb(SO4)2 R
KALISTRONTITE K2Sr(SO4)2 R
CALCIOLANGBEINITE K2Ca2(SO4)3 C
BUBNOVAITE K2Na8Ca(SO4)6 R
LEGUERNITE Bi38O42(SO4)15 M
Sulfates (selenates, etc.) with additional anions, without H2O
With small cations
With medium-sized cations
BRUMADOITE Cu3Te++++++O4(OH)4.5H2O M
HAUCKITE Fe+++3(Mg,Mn++)24Zn18(SO4)4(CO3)2(OH)81 H
ANTLERITE Cu3(SO4)(OH)4 O
DOLEROPHANITE Cu2(SO4)O M
BROCHANTITE Cu4(SO4)(OH)6 M
VERGASOVAITE Cu3O[(Mo,S)O4](SO4) O
TAVAGNASCOITE Bi4O4(SO4)(OH)2 O
KLEBELSBERGITE Sb+++4O4(OH)2(SO4) O
SCHUETTEITE Hg3(SO4)O2 H
PARAOTWAYITE Ni(OH)2-x(SO4,CO3)0,5x M
XOCOMECATLITE Cu3Te++++++O4(OH)4 O
PAUFLERITE V++++O(SO4) O
GRANDVIEWITE Cu3Al9(SO4)2(OH)29 M
RAMACCIONIITE Cu4[SeO4](OH)6 M
With medium-sized and large cations
BACKITE Pb2AlTe++++++O6Cl R
ADRANOSITE-(Fe) (NH4)4NaFe2(SO4)4Cl(OH)2 Q
AGAITE Pb3Cu++Te++++++O5(OH)2(CO3) O
DANSITE-Mn Na21Mn++(SO4)10Cl3 C
DANSITE Na21Mg(SO4)10Cl3 C
DANSITE-Fe Na21Fe++(SO4)10Cl3 C
JAROSITE K2Fe+++6(SO4)4(OH)12 R
WALTHIERITE BaAl6(SO4)4(OH)12 R
SCHLOSSMACHERITE (H3O,Ca)Al3(AsO4,SO4)2(OH)6 R
PLUMBOJAROSITE PbFe+++6(SO4)4(OH)12 R
OSARIZAWAITE Pb2Cu++Al4(SO4)4(OH)12 R
NATROJAROSITE Na2Fe+++6(SO4)4(OH)12 R
ARGENTOJAROSITE Ag+2Fe+++6(SO4)4(OH)12 R
NATROALUNITE-2c (Na,Ca,K)2Al6(SO4)4(OH)12 R
NATROALUNITE Na2Al6(SO4)4(OH)12 R
HYDRONIUMJAROSITE (H3O+)2Fe+++6(SO4)4(OH)12 R
HUANGITE CaAl6(SO4)4(OH)12 R
DORALLCHARITE (Tl,K)2Fe+++6(SO4)4(OH)12 O
BEAVERITE-Cu Pb(Cu++,Fe+++,Al)6(SO4)4(OH)12 R
AMMONIOJAROSITE (NH4)2Fe+++6(SO4)4(OH)12 R
AMMONIOALUNITE (NH4)2Al6(SO4)4(OH)12 R
ALUNITE K2Al6(SO4)4(OH)12 R
BEAVERITE-Zn Pb(Fe2Zn)(SO4)2(OH) R
YEELIMITE Ca4Al6O12(SO4) C
ATLASOVITE Cu6Fe+++Bi+++O4(SO4)5.KCl Q
NABOKOITE Cu++7Te++++O4(SO4)5.KCl Q
CHLOROTHIONITE K2Cu(SO4)Cl2 O
EUCHLORINE KNaCu++3(SO4)3O M
FEDOTOVITE K2Cu++3O(SO4)3 M
KAMCHATKITE KCu++3OCl(SO4)2 O
PIYPITE K2Cu2(SO4)2O Q
KLYUCHEVSKITE K3Cu3(Fe+++,Al)O2(SO4)4 M
ALUMOKLYUCHEVSKITE K3Cu3(Al,Fe+++)O2(SO4)4 M
CALEDONITE Pb5Cu2(CO3)(SO4)3(OH)6 O
WHERRYITE Pb7Cu2(SO4)4(SiO4)2(OH)2 M
MAMMOTHITE Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 M
LINARITE PbCu(SO4)(OH)2 M
MUNAKATAITE Pb2Cu(Se++++O3)(SO4)(OH)4 M
SCHMIEDERITE Pb2Cu++2(Se++++O3)(Se++++++O4)(OH)4 M
CHENITE Pb4Cu(SO4)2(OH)6 A
KRIVOVICHEVITE Pb3Al(SO4)(OH)7 R
ANHYDROKAINITE KMg(SO4)Cl  
ADRANOSITE (NH4)4NaAl2(SO4)4(OH)2Cl Q
ADRANOSITE-(Fe) (NH4)4NaFe+++2(SO4)4Cl(OH)2 Q
PUNINITE Na2Cu3O(SO4)3 M
With only large cations
SULPHOHALITE Na6(SO4)2FCl C
GALEITE Na15(SO4)5F4Cl R
SCHAIRERITE Na21(SO4)7F6Cl R
KOGARKOITE Na3(SO4)F M
CESANITE Na3Ca2(SO4)3(OH) H
CARACOLITE Na2(Pb2Na)(SO4)3Cl M ps H
AIOLOSITE Na4Bi+++(SO4)3Cl H
BURKEITE Na6(CO3)(SO4)2 O
HANKSITE KNa22(SO4)9(CO3)2Cl H
CANNONITE Bi2O(OH)2SO4 M
LANARKITE Pb2(SO4)O M
GRANDREEFITE Pb2SO4F2 M
ITOITE Pb3Ge(SO4)2O2(OH)2 O
CHILUITE Bi6Te++++++2Mo++++++2O21 H
HECTORFLORESITE Na9(IO3)(SO4)4 M
PSEUDOGRANDREEFITE Pb6SO4F1O O ps Q
SUNDIUSITE Pb10(SO4)O8Cl2 M
Sulfates (selenates, etc.) without additional anions, with H2O
With small cations
ALFREDOPETROVITE Al2(Se++++O3)3.6H2O H
With only medium-sized cations
KIESERITE MgSO4.H2O M
SZOMOLNOKITE Fe++SO4.H2O M
POITEVINITE (Cu++,Fe++,Zn)SO4.H2O A
DWORNIKITE (Ni,Fe++)SO4.H2O M
COBALTKIESERITE Co(SO4).H2O M
SZMIKITE Mn++SO4.H2O M
GUNNINGITE (Zn,Mn++)SO4.H2O M
SANDERITE MgSO4.2H2O (?)
BONATTITE CuSO4.3H2O M
CRANSWICKITE MgSO4.4H2O M
STARKEYITE MgSO4.4H2O M
ILESITE (Mn++,Zn,Fe++)SO4.4H2O M
BOYLEITE (Zn,Mg)SO4.4H2O M
APLOWITE (Co,Mn++,Ni)SO4.4H2O M
ROZENITE Fe++SO4.4H2O M
CHALCANTHITE Cu++SO4.5H2O A
JOKOKUITE Mn++SO4.5H2O A
PENTAHYDRITE MgSO4.5H2O A
SIDEROTIL (Fe++,Cu)SO4.5H2O A
HEXAHYDRITE MgSO4.6H2O M
MOORHOUSEITE (Co,Ni,Mn++)SO4.6H2O M
CHVALETICEITE (Mn++,Mg)SO4.6H2O M
BIANCHITE (Zn,Fe++)(SO4).6H2O M
FERROHEXAHYDRITE Fe++SO4.6H2O M
NICKELHEXAHYDRITE (Ni,Mg,Fe++)(SO4).6H2O M
RETGERSITE NiSO4.6H2O Q
ZINCMELANTERITE (Zn,Cu++,Fe++)SO4.7H2O M
ALPERSITE (Mg,Cu)SO4.7H2O M
BIEBERITE CoSO4.7H2O M
BOOTHITE CuSO4.7H2O M
MALLARDITE Mn++SO4.7H2O M
MELANTERITE Fe++SO4.7H2O M
MORENOSITE NiSO4.7H2O O
EPSOMITE MgSO4.7H2O O
GOSLARITE ZnSO4.7H2O O
ALUNOGEN Al2(SO4)3.17H2O A
METAALUNOGEN Al4(SO4)6.27H2O M
ALUMINOCOQUIMBITE Al2Fe+++2(SO4)6(H2O)12.6H2O R
COQUIMBITE AlFe+++3(SO4)6(H2O)12.6H2O R
PARACOQUIMBITE Fe+++2(SO4)3.9H2O R
RHOMBOCLASE (H5O2)+Fe+++(SO4)2.2H2O O
KORNELITE Fe+++2(SO4)3.7H2O M
QUENSTEDTITE Fe+++2(SO4)3.10H2O A
LAUSENITE Fe+++2(SO4)3.6H2O M
LISHIZHENITE ZnFe+++2(SO4)4.14H2O A
ROMERITE Fe++Fe+++2(SO4)4.14H2O A
RANSOMITE CuFe+++2(SO4)4.6H2O M
APJOHNITE Mn++Al2(SO4)4.22H2O M
BILINITE Fe++Fe+++2(SO4)4.22H2O M
DIETRICHITE (Zn,Fe++,Mn++)Al2(SO4)4.22H2O M
HALOTRICHITE Fe++Al2(SO4)4.22H2O M
PICKERINGITE MgAl2(SO4)4.22H2O M
REDINGTONITE (Fe++,Mg,Ni)(Cr,Al)2(SO4)4.22H2O M
WUPATKIITE (Co,Mg,Ni)Al2(SO4)4.22H2O M
MERIDIANIITE MgSO4.11H2O A
DROBECITE Cd(SO4).4H2O  
With medium-sized and large cations
AMMONIOVOLTAITE (NH4)2Fe++5Fe+++3Al(SO4)12(H2O)18 C
ANDYCHRISTYITE PbCu++Te++++++O5(H2O) A
KRAUSITE KFe+++(SO4)2.H2O M
TAMARUGITE NaAl(SO4)2.6H2O M
MENDOZITE NaAl(SO4)2.11H2O M
KALINITE KAl(SO4)2.11H2O M (?)
LONECREEKITE (NH4)(Fe+++,Al)(SO4)2.12H2O C
TSCHERMIGITE (NH4)Al(SO4)2.12H2O C
LANMUCHANGITE TlAl(SO4)2.12H2O C
ALUM-(Na) NaAl(SO4)2.12H2O C
ALUM-(K) KAl(SO4)2.12H2O C
AMMONIOMAGNESIOVOLTAITE (NH4)2Mg5Fe+++3Al(SO4)12.18H2O C
PERTLIKITE K2(Fe++,Mg,Mn++)2(Mg,Fe+++)4Fe+++2Al(SO4)12.18H2O Q ps C
VOLTAITE K2Fe++5Fe+++4(SO4)12.18H2O C
ZINCOVOLTAITE K2Zn5Fe+++3Al(SO4)12.18H2O C
KROHNKITE Na2Cu(SO4)2.2H2O M
FERRINATRITE Na3Fe+++(SO4)3.3H2O R
GOLDICHITE KFe+++(SO4)2.4H2O M
LOWEITE Na12Mg7(SO4)13.15H2O R
COBALTOBLODITE Na2(Co,Mg)(SO4)2.4H2O M
BLODITE Na2Mg(SO4)2.4H2O M
CHANGOITE Na2Zn(SO4)2.4H2O M
NICKELBLODITE Na2(Ni,Mg)(SO4)2.4H2O M
LEONITE K2Mg(SO4)2.4H2O M
MEREITERITE K2Fe++(SO4)2.4H2O M
NICKELBOUSSINGAULTITE (NH4)2(Ni,Mg)(SO4)2.6H2O M
BOUSSINGAULTITE (NH4)2Mg(SO4)2.6H2O M
PICROMERITE K2Mg(SO4)2.6H2O M
CYANOCHROITE K2Cu++(SO4).6H2O M
MOHRITE (NH4)2Fe++(SO4)2.6H2O M
POLYHALITE K2Ca2Mg(SO4)4.2H2O A
LEIGHTONITE K2Ca2Cu(SO4)4.2H2O A ps O
AMARILLITE NaFe++(SO4)2.6H2O M
KONYAITE Na2Mg(SO4)2.5H2O M
WATTEVILLEITE Na2Ca(SO4)2.4H2O (?) O (?)
XOCOLATLITE Ca2Mn++++2Te++++++2O12.H2O M
MAGNESIOVOLTAITE K2Mg5Fe+++3Al(SO4)12.18H2O C
With only large cations
ARGESITE (NH)4Bi3Cl16 R ps H
CAMPOSTRINIITE (Bi,Na)3(Na,K)4(SO4)6.H2O M
MATTEUCCITE NaHSO4.H2O M
MIRABILITE Na2SO4.10H2O M
LECONTITE (NH4,K)Na(SO4).2H2O O
HYDROGLAUBERITE Na4Ca(SO4)3.2H2O M
EUGSTERITE Na4Ca(SO4)3.2H2O M (?)
GORGEYITE K2Ca5(SO4)6.H2O M
SYNGENITE K2Ca(SO4)2.H2O M
KOKTAITE (NH4)2Ca(SO4)2.H2O M
GYPSUM CaSO4.2H2O M
BASSANITE 2CaSO4.H2O M ps H
ZIRCOSULFATE Zr(SO4)2.4H2O O
SCHIEFFELINITE Pb10Te6O20(OH)14(SO4).5H2O O
MONTANITE Bi2Te++++++O6.2H2O M (?)
OMONGWAITE (Na,K)2Ca5(SO4)6.3H2O M ps H
Sulfates (selenates, etc.) with additional anions, with H2O
CAMINITE Mg7(SO4)5(OH)4.H2O Q
With small cations
With only medium-sized cations; insular octahedra and finite units
SVYAZHINITE (Mg,Mn)(Al,Fe+++)(SO4)2F.14H2O A
AUBERTITE CuAl(SO4)2Cl.14H2O A
MAGNESIOAUBERTITE (Mg,Cu)Al(SO4)2Cl.14H2O A
KHADEMITE Al(SO4)F(H2O5) O
ROSTITE Al(SO4)(OH).5H2O O
JURBANITE Al(SO4)(OH).5H2O M
ANORTHOMINASRAGRITE V++++O(SO4).5H2O A
MINASRAGRITE V++++O(SO4).5H2O M
ORTHOMINASRAGRITE V++++O(SO4).5H2O O
BOBJONESITE V++++O(SO4).3H2O M
AMARANTITE Fe+++2(SO4)2O.7H2O A
METAHOHMANNITE Fe+++2(SO4)2O.4H2O (?)
HOHMANNITE Fe+++2(SO4)2O.8H2O A
ALUMINOCOPIAPITE (Al,Mg)Fe+++4(SO4)6(OH)2.20H2O A
CALCIOCOPIAPITE CaFe+++4(SO4)6(OH)2.19H2O A
COPIAPITE Fe++Fe+++4(SO4)6(OH)2.20H2O A
CUPROCOPIAPITE Cu++Fe+++4(SO4)6(OH)2.20H2O A
FERRICOPIAPITE (Fe+++,Al,Mg)Fe+++5(SO4)6(OH)2.20H2O A
MAGNESIOCOPIAPITE MgFe+++4(SO4)6(OH)2.20H2O A
ZINCOCOPIAPITE ZnFe+++4(SO4)6(OH)2.18H2O A
With only medium-sized cations; chains of edge-sharing octahedra
ALUMINITE Al2(SO4)(OH)4.7H2O M ps O
METAALUMINITE Al2(SO4)(OH)4.5H2O M
BUTLERITE Fe+++(SO4)(OH).2H2O M
PARABUTLERITE Fe+++(SO4)(OH).2H2O O
FIBROFERRITE Fe+++(SO4)(OH).5H2O M
XITIESHANITE Fe+++(SO4)(OH).7H2O M
BOTRYOGEN MgFe+++(SO4)2(OH).7H2O M
ZINCOBOTRYOGEN (Zn,Mg,Mn)Fe+++(SO4)2(OH).7H2O M
CHAIDAMUITE CuFe(SO4)2(OH).4H2O A ps M
GUILDITE CuFe+++(SO4)2(OH).4H2O M
With only medium-sized cations; sheets of edge-sharing octahedra
FELSOBANYAITE Al4(SO4)(OH)10.4H2O H
POSNJAKITE Cu4(SO4)(OH)6.H2O M
WROEWOLFEITE Cu4(SO4)(OH)6.2H2O M
LANGITE Cu4(SO4)(OH)6.2H2O M
SPANGOLITE Cu6Al(SO4)(OH)12Cl.3H2O R
KTENASITE (Cu,Zn)5(SO4)2(OH)6.6H2O M
CHRISTELITE Zn3Cu2(SO4)2(OH)6.4H2O A
EDWARDSITE Cd2(Cu,Zn)3(SO4)2(OH)3.4H2O M
SERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O M
NIEDERMAYRITE Cu4Cd(SO4)2(OH)6.4H2O M
DEVILLINE CaCu4(SO4)2(OH)6.3H2O M
CAMPIGLIAITE Cu++4Mn++(SO4)2(OH)6.4H2O M
ORTHOSERPIERITE Ca(Cu,Zn)4(SO4)2(OH)6.3H2O O
NATROGLOCOCERINITE Zn6Al3(OH)18[Na(H2O)6](SO4)2.6H2O H
KARCHEVSKYITE [Mg18Al9(OH)54][Sr2(CO3,PO4)9(H2O,H3O)11] R
ZINCOWOODWARDITE (Zn,Cu)5,5-4Al2,5-4(SO4)1,5-2(OH)16.5-8H2O R ps H
ZINCALUMINITE Zn6Al6(SO4)2(OH)26.5H2O H (?)
WOODWARDITE Cu6Al2[(OH)16(SO)4].2,5-3H2O R
WERMLANDITE Mg7Al2(OH)18[Ca(H2O)6][SO4]2.6H2O R
SHIGAITE NaMn++6Al3(SO4)2(OH)18.12H2O R
NIKISCHERITE NaFe++6Al3(SO4)2(OH)18.12H2O R
CARRBOYDITE (Ni,Cu)14Al9(SO4,CO3)6(OH)43.7H2O (?) H
MOTUKOREAITE NaMg6Al3(SO4)2(OH)18.12H2O H
MOUNTKEITHITE (Mg,Ni)11(Fe+++,Cr,Al)3(OH)24(SO4,CO3)3,5.11H2O H
HYDROWOODWARDITE [Cu1-xAlx(OH)2][(SO4)0,5x(H2O)n] (x lower than 0,67; n = about 1,5x) R
HYDROHONESSITE Ni6Fe+++2(SO4)(OH)16.7H2O H
HONESSITE Ni6Fe+++2(SO4)(OH)16.4H2O R
GLAUCOCERINITE (Zn,Cu)10Al6(SO4)3(OH)32.18H2O H
NATROGLAUCOCERINITE Zn6Al3(OH)18[Na(H2O)6](SO4)2.6H2O  
TORREYITE (Mg,Mn)9Zn4(SO4)2(OH)22.8H2O M
LAWSONBAUERITE (Mn,Mg)9Zn4(SO4)2(OH)22.8H2O M
MOOREITE (Mg,Zn,Mn)15(SO4)2(OH)26.8H2O M
NAMUWITE (Zn,Cu)4(SO4)(OH)6.4H2O H
BECHERERITE Zn7Cu(OH)13[SiO(OH)3](SO4) R
RAMSBECKITE (Cu,Zn)15(SO4)4(OH)22.6H2O M
VONBEZINGITE Ca6Cu++3(SO4)3(OH)12.2H2O M
REDGILLITE Cu6(SO4)(OH)10.H2O M
CHALCOALUMITE CuAl4(SO4)(OH)12(H2O)3 M
KYRGYZSTANITE (Zn,Ni)Al4(SO4)(OH)12.3H2O M
NICKELALUMITE NiAl4(SO4)(OH)12(H2O)3 M
GUARINOITE (Zn,Co,Ni)6(SO4)(OH,Cl)10.5H2O H
THERESEMAGNANITE NaCo4(SO4)(OH)6Cl.6H2O R
SCHULENBERGITE (Cu,Zn)7(SO4,CO3)2(OH)10.3H2O R
MONTETRISAITE Cu6(SO4)(OH)10.H2O O
FEHRITE MgCu4(SO4)2(OH)6.6H2O M
GOBELINITE CoCu4(SO4)2(OH)6.6H2O M
ISSELITE Cu6(SO4)(OH)10(H2O4).H2O O
With only medium-sized cations; unclassified
MANGAZEITE Al2(SO4)(OH)4.3H2O A
CYANOTRICHITE Cu4Al2(SO4)(OH)12.2H2O O
CARBONATECYANOTRICHITE Cu++4Al2(CO3,SO4)(OH)12.2H2O O
SCHWERTMANNITE Fe+++16O16(OH)12(SO4)2 Q
TLALOCITE (Cu,Zn)16(Te++++O3)(Te++++++O4)2Cl(OH)25.27H2O M (?)
UTAHITE MgCu++4Zn2Te++++++3O14(OH)4.6H2O A
COQUANDITE Sb6+xO8+x(SO4)(OH)x.(H2O)1-x (x = 0,3) A
OSAKAITE Zn4(SO4)(OH)6.5H2O A
WILCOXITE MgAl(SO4)2F.18H2O A
STANLEYITE V++++O(SO4).6H2O O
HYDROBASALUMINITE Al4(SO4)(OH)10.12-36H2O M
VOLASCHIOITE Fe+++4(SO4)O2(OH)6.2H2O M
ZAHERITE Al12(SO4)5(OH)26.20H2O A
CAMEROLAITE Cu6Al3(OH)18(H2O)2[Sb(OH)6](SO4) M
With large and medium-sized cations
UKLONSKOVITE NaMg(SO4)F2H2O M
KAINITE MgSO4.KCl.3H2O M
NATROCHALCITE NaCu2(SO4)2(OH,H2O)2 M
METASIDERONATRITE Na2Fe+++(SO4)2(OH).H2O O
SIDERONATRITE Na2Fe+++(SO4)2(OH).3H2O O
SCHAURTEITE Ca3Ge++++(SO4)2(OH)6.3H2O H
DESPUJOLSITE Ca3Mn++++(SO4)2(OH)6.3H2O H
FLEISCHERITE Pb3Ge(SO4)2(OH)6.3H2O H
MALLESTIGITE Pb3Sb+++++(SO4)(AsO4)(OH)6.3H2O H
SLAVIKITE (H3O+)3Mg6Fe15(SO4)21(OH)18.98H2O R
METAVOLTINE K2Na6Fe++Fe+++6(SO4)12O2.18H2O H
LANNONITE HCa4Mg2Al4(SO4)8F9.32H2O Q
VLODAVETSITE AlCa2(SO4)2F2Cl.4H2O Q
PERETAITE CaSb+++4O4(OH)2(SO4)2.2H2O M
GORDAITE NaZn4Cl(OH)6(SO4).6H2O R
CLAIRITE (NH4)2(Fe+++,Mn+++)3(SO4)4(OH)3.3H2O A
ARZRUNITE Cu4Pb2(SO4)(OH)4Cl6.2H2O (?) O
ELYITE Pb4Cu(SO4)O2(OH)4.H2O M
YECORAITE Bi5Fe+++3(Te++++O3)(Te++++++O4)2O9.9H2O Q or H
LAUTENTHALITE PbCu++4(OH)6(SO4)2.3H2O M
RIOMARINAITE Bi(OH)SO4.H2O M
DUKEITE Bi+++24Cr++++++8O57(OH)6.3H2O R
FLAGGITE Pb4Cu++4Te++++++2(SO4)2O11(OH)2(H2O) A
ALDRIDGEITE (Cd,Ca)(Cu,Zn)4(SO4)2(OH)6.3H2O M
AMMONIOMATHESIUSITE (NH4)5(UO2)4(SO4)4(VO5).4H2O Q
CHROMSCHIEFFELINITE Pb10Te++++++6O20(OH)14(CrO4).5H2O O
BAIRDITE Pb2Cu++4Te++++++2O10(OH)2(SO4)(H2O) M
CARLSONITE (NH4)5Fe+++3O(SO4)6.7H2O A
With large and medium-sized cations; * With NO3, CO3, B(OH)4, SiO4 or IO3
DARAPSKITE Na3(SO4)(NO3).H2O M
CLINOUNGEMACHITE K2Na3Fe(SO4)6(OH)3.9H2O M ps R
UNGEMACHITE K3Na8Fe+++(SO4)6(NO3)2.6H2O R
HUMBERSTONITE K3Na7Mg2(SO4)6(NO3)2.6H2O R
THAUMASITE Ca6Si2(CO3)2(SO4)2(OH)12.24H2O H
TATARINOVITE ??3Al(SO4)[B(OH)4](OH)6.12H2O H
STURMANITE Ca6(Fe+++,Al,Mn++)2(SO4)2[B(OH)4](OH)12.25H2O H
JOURAVSKITE Ca6Mn++++2(SO4,CO3)4(OH)12.26H2O H
SIWAQAITE Ca6Al2(CrO4)3(OH)12.26H2O R
KOTTENHEIMITE Ca3Si(OH)6(SO4)2.12H2O H
ETTRINGITE Ca6Al2(SO4)3(OH)12.26H2O H
CHARLESITE Ca6(Al,Si)2(SO4)2B(OH)4(OH,O)12.26H2O H
CARRARAITE Ca3Ge++++(OH)6(SO4)(CO3).12H2O H
BENTORITE Ca6(Cr,Al)2(SO4)3(OH)12.26H2O H
BURYATITE Ca3(Si,Fe+++,Al)(SO4)[B(OH)4](O,OH)5O.12H2O R ps H
HIELSCHERITE Ca3Si(OH)6(SO4)(SO3).11H2O H
RAPIDCREEKITE Ca2(SO4)(CO3).4H2O O
TATARSKITE Ca6Mg2(SO4)2(CO3)2Cl4(OH)4.7H2O O
NAKAURIITE Cu8(SO4)4(CO3)(OH)6.48H2O O
CHESSEXITE Na4Ca2(Mg,Zn)3Al8(SiO4)2(SO4)10(OH)10.40H2O O
CARLOSRUIZITE K6(Na,K)4Na6Mg10(Se++++++O4)12(IO3)12.12H2O R
FUENZALIDAITE K6(Na,K)4Na6Mg10(SO4)12(IO3)12.12H2O R
CHELYABINSKITE (Ca,Mg)3Si(OH)6(SO4,CO3)2.9H2O O
MATHESIUSITE K5(UO2)4(SO4)4(VO5)(H2O)4 Q
BIRUNITE Ca18(SiO3)8,5(CO3)8,5(SO4).15H2O ?
Uranyl sulfates
BESHTAUITE (NH4)2(UO2)(SO4)2.2H2O M
BEHOUNEKITE U++++(SO4)2.4H2O O
BELAKOVSKIITE Na7(UO2)(SO4)4(SO3OH)(H2O)3 A
Without cations
METAURANOPILITE (UO2)6(SO4)(OH)10.5H2O M
URANOPILITE (UO2)6(SO4)(OH)6O2.14H2O A
JACHYMOVITE (UO2)8(SO4)(OH)14.13H2O M (?)
With medium-sized cations
JOHANNITE Cu(UO2)2(SO4)2(OH)2.8H2O A
DELIENSITE Fe++(UO2)2(SO4)2(OH)2.3H2O O
ALWILKINSITE-(Y) Y(UO2)3(SO4)2O(OH)3(H2O)7.7H2O O
BOBCOOKITE NaAl(UO2)2(SO4)4.18H2O A
With medium-sized and large cations
ADOLFPATERAITE K(UO2)(SO4)(OH).H2O M
COBALTZIPPEITE Co(UO2)2(SO4)O2.3,5H2O M
MAGNESIOZIPPEITE Mg(UO2)2(SO4)O2.3,5H2O M
NATROZIPPEITE Na5(UO2)8(SO4)4O5(OH)3.12H2O M
NICKELZIPPEITE Ni(UO2)2(SO4)O2.3,5H2O M
ZINCZIPPEITE Zn(UO2)2(SO4)O2.3,5H2O M
ZIPPEITE K1,85H+0,15[(UO2)4O2(SO4)2(OH)2](H2O)4 M
RABEJACITE Ca2[(UO2)4O4(SO4)2](H2O)8 A
MARECOTTITE Mg3(H2O)18[(UO2)4O3(OH)(SO4)2]2.10H2O A
SEJKORAITE-(Y) (Y1,98Dy0,24)H+0,34[(UO2)8O88O7OH(SO4)4](OH)(H2O)26 A
PSEUDOJOHANNITE Cu3(OH)2[(UO2)4O4(SO4)2](H2O)12 A
Chromates
Without additional anions
TARAPACAITE K2CrO4 O
CHROMATITE CaCrO4 Q
HASHEMITE Ba(Cr,S)O4 O
CROCOITE PbCrO4 M
With additional O,V, S, Cl
PHOENICOCHROITE Pb2(CrO4)O M
SANTANAITE Pb11CrO16 H
WATTERSITE Hg+4Hg++Cr++++++O6 M
DEANESMITHITE Hg+2Hg++3Cr++++++O5S2 A
EDOYLERITE Hg++3Cr++++++O4S2 M
With PO4, AsO4, SiO4
VAUQUELINITE Pb2Cu++(CrO4)(PO4)(OH) M
FORNACITE (Pb,Cu++)3[(Cr,As)O4]2(OH) M
MOLYBDOFORNACITE Pb2Cu[(As,P)O4][(Mo,Cr)O4](OH) M
HEMIHEDRITE Pb10Zn(CrO4)6(SiO4)2(OH)2 A
IRANITE Pb10Cu(CrO4)6(SiO4)2(F,OH)2 A
EMBREYITE Pb5(CrO4)2(PO4)2.H2O M
CASSEDANNEITE Pb5(VO4)2(CrO4)2.H2O M
RAYGRANTITE Pb10Zn(SO4)6(SiO4)2(OH)2 A
LOPEZITE K2Cr2O7 A
Molybdates, Wolframates and Niobates
BAUMOITE Ba0,5[(UO2)3O8Mo2(OH)3](H2O)3 M
Without additional anions or H2O
FERGUSONITE-(Nd) (Nd,Ce)(Nb,Ti)O4 M
WULFENITE PbMoO4 Q
SUSEINARGIUITE Na0,5Bi0,5(MoO4) Q
STOLZITE PbWO4 Q
SCHEELITE CaWO4 Q
FERGUSONITE-(Y) YNbO4 Q
FERGUSONITE-(Ce) (Ce,Nd,La)NbO4.0,3H2O M
POWELLITE CaMoO4 Q
FORMANITE-(Y) YTaO4 Q
IWASHIROITE-(Y) Y(Ta,Nb)O4 M
PARANIITE-(Y) Ca2Y(AsO4)(WO4)2 Q
With additional anions and/or H2O
LINDGRENITE Cu3(MoO4)2(OH)2 M
SZENICSITE Cu3MoO4(OH)4 O
CUPROTUNGSTITE Cu++3(WO4)2(OH)2 Q
PHYLLOTUNGSTITE CaFe+++3H(WO4)6.10H2O O
RANKACHITE CaFe++V+++++4W++++++8O36.12H2O O
FERRIMOLYBDITE Fe2(MoO4)3.nH2O O (?)
ANTHOINITE AlWO3(OH)3 A
MPOROROITE W++++++AlO3(OH)3.2H2O A (?)
OBRADOVICITE-Kcu H4(K,Na)Cu++Fe+++2(AsO4)(MoO4)5.12H2O O
MENDOZAVILITE-NaFe (Na,K)(Ca,Mg)2Fe+++3(PO4)2(Mo++++++8O28)(OH).9H2O M
PARAMENDOZAVILITE NaAl4Fe+++7(PO4)5(P+++++Mo++++++12O40)(OH)16.56H2O M/A
TANCAITE-(Ce) Fe+++(Ce,La,Nd)(MoO4)3.3H2O R ps C
MENDOZAVILITE-NaCu [Na2(H2O)15Cu(H2O)6][Mo8P2Fe+++3O34(OH)3] M
OBRADOVICITE-NaCu Na2(H2O)17Cu(H2O)6][Mo8As2Fe+++3O34(OH)3] O
OBRADOVICITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] O
Uranium and uranyl molybdates and wolframates
With U4+
SEDOVITE U(MoO4)2 O
COUSINITE MgU2Mo2O11.6H2O (?)
MOLURANITE H4U++++(UO2)3(MoO4)7.18H2O am.
With U6+
CALCURMOLITE ((Ca1-xNax)2(UO2)3(MoO4)2(OH)6-x.nH2O M
TENGCHONGITE CaU++++++6Mo++++++2O25.12H2O O
URANOTUNGSTITE (Fe++,Ba,Pb)(UO2)2WO4(OH)4.12H2O O
Thiosulfates
Thiosulfates of Pb
SIDPIETERSITE Pb4(S2O3)O2(OH)2 A
STEVERUSTITE Pb++5Cu+(S++++++O3S--)3(OH)5.2H2O M
Sulfates, etc. unclassified
TOMBSTONEITE (Ca0,5Pb0,5)Pb3Cu++6Te++++++2O6(Te++++O3)6(Se++++O3)2(SO4)2.3H2O R
SCENICITE [(UO2)(H2O)2(SO4)]2.3H2O O
OZERNOVSKIITE Fe++4(Te++++O4)(Te++++O3)4.7H2O M
ERSSONITE CaMg7Fe+++2(OH)18(SO4)2.12H2O R
KLAPROTHITE Na6(UO2)(SO4)4.4H2O M
TOMIOLLOITE Al12(Te++++O3)5[(SO3)0,5(SO4)0,5](OH)24 H
NITSCHEITE (NH4)2[(UO2)2(SO4)3(H2O)2].3H2O M
METATAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3(Te++++O(OH)2)(H2O) M
PAULADAMSITE Cu4(SeO3)(SO4)(OH)4.2H2O A
PARAWULFFITE K5Na3Cu8O4(SO4)8 M
OTTOHAHNITE Na6(UO2)2(SO4)5(H2O)7.1,H2O A
OPPENHEIMERITE Na2(UO2)(SO4)2.3H2O A
OPHIRITE Ca2Mg4[Zn2Mn+++2(H2O)2(Fe+++W9O34)2].46H2O A
NURAGHEITE Th(MoO4)2.H2O M
NORTHSTARITE Pb6(Te++++O3)5(S++++++O3S--) H
NICKELPICROMERITE K2Ni(SO4)2.6H2O M
NAVROTSKYITE K2Na10(UO2)3(SO4)9.2H2O O
NATROAPHTHITALITE KNa3(SO4)2 R
MULLERITE Pb2Fe+++(Te++++++O6)Cl R
LUSSIERITE Na10[(UO2)(SO4)4](SO4)2(H2O)3 M
STRASSMANNITE Al(UO2)(SO4)2F.16H2O M
MEITNERITE (NH4)(UO2)(SO4)(OH).2H2O A
MEISSERITE Na5(UO2)(SO4)3(SO3OH)(H2O) A
MARKHININITE TlBi(SO4)2 A
MARKASCHERITE Cu3(MoO4)(OH)4 M
MANGANOBLODITE Na2(Mn++,Mg)(SO4)2.4H2O M
MAJZLANITE K2Na(ZnNa)Ca(SO4)4 M
MAGNESIOLEYDETITE Mg(UO2)(SO4)2.11H2O M
MAGNANELLIITE K3Fe+++2(SO4)4(OH)(H2O)2 M
PELIGOTITE Na6(UO2)(SO4)4(H2O)4 A
MINOHLITE (Cu,Zn)7(SO4)2(OH)10.8H2O R ps H
SCORDARIITE K8(Fe+++0,67[]0,33)[Fe+++3O(SO4)6]2.14H2O R
LLANTENESITE Cu6Al[SeO4](OH)12Cl.3H2O R
WITZKEITE K4Na4Ca(SO4)4(NO3)2.2H2O M
WILDCATITE CaFe+++Te++++++O5(OH) R
WETHERILLITE Na2Mg(UO2)2(SO4)4.18H2O Na2Mg(UO2)2(SO4)4.18H2O M
VOUDOURISITE CdSO4.H2O M
VENDIDAITE Al2(SO4)Cl(OH)3.6H2O M
THERASIAITE (NH4)3KNa2Fe++Fe+++(SO4)3Cl5 M
TAMBOITE Fe+++3(OH)(H2O)2(SO4)(Te++++O3)3[Te++++O(OH)2](H2O)3 M
SVORNOSTITE K2Mg[(UO2)(SO4)2]2.8H2O O
SHUMWAYITE (UO2)2(SO4)2.5H2O M
SEABORGITE LiK2Na6(UO2)(SO4)5(SO3OH)(H2O) A
PETROVITE Na12Cu2(SO4)8 M
COSSAITE (Mg0,5,[])Al6(SO4)6(HSO4)F6.36H2O R ps H
SARANCHINAITE Na2Cu(SO4)2 M
WULFFITE K3NaCu4O2(SO4)4 O
RIOTINTOITE Al(SO4)(OH).3H2O A
RIETVELDITE Fe(UO2)(SO4)2(H2O)5 O
REYNOLDSITE Pb2Mn++++2O5(CrO4) A
PSEUDOMEISSERITE-(NH4) (NH4)2Na4[(UO2)2(SO4)5].4H2O M
PLAVNOITE K0,8Mn0,6[(UO2)2O2(SO4)].3,5H2O M
PLASILITE Na(UO2)(SO4)(OH).2H2O M
PHILOXENITE (K,Na,Pb)4(Na,Ca)2(Mg,Cu)3(Fe+++0,5Al0,5)(SO4)8 A
SHUVALOVITE K2(Ca2Na)(SO4)3F O
BOUSKAITE MoO2)2O(SO3OH)2(H2O)2.2H2O A
FEYNMANITE Na(UO2)(SO4)(OH).3,5H2O M
FERMIITE Na4(UO2)(SO4)3.3H2O O
FASSINAITE Pb++2(S2O3)(CO3) O
FALGARITE K4(VO)3(SO4)5 M
EVDOKIMOVITE Tl4(VO)3(SO4)5(H2O)5 M
DOBROVOLSKYITE Na4Ca(SO4)3 R
DAGENAISITE Zn3Te++++++O6 M
CRYPTOCHALCITE K2Cu5O(SO4)5 A
CHINLEITE-(Y) NaY(SO4)2.H2O R
GENPLESITE Ca3Sn(SO4)2(OH)6.3H2O H
CALAMAITE Na2TiO(SO4)2.2H2O O
BRIDGESITE-(Ce) CaCe2Cu6(SO4)4(OH)12.H2O M
LEYDETITE Fe(UO2)(SO4)2(H2O)11 M
BELOUSOVITE KZn(SO4)Cl M
BELOMARINAITE KNa(SO4) R
BELOGUBITE CuZn(SO4)2.10H2O A
BALICZUNICITE Bi2O(SO4)2 A
ANTOFAGASTAITE Na2Ca(SO4)2.1,5H2O M
AMMONIOZIPPEITE (NH4)2[(UO2)2(SO4)O2].H2O O
ALCAPARROSSAITE K3Ti++++Fe+++(SO4)4O(H2O)2 M
CUPROMOLYBDITE Cu3(MoO4)O O
CESIODYMITE CsKCu5O(SO4)5 A
IVSITE Na3H(SO4)2 M
LAZARIDISITE 3CdSO4.8H2O M
LAURANIITE Cu6Cd2(SO4)2(OH)12.5H2O M
LANGHOFITE Pb2(OH)[WO4(OH)] A
LAHNSTEINITE Zn4(SO4)(OH)6.3H2O A ps H
KRASHENINNIKOVITE KNa2CaMg(SO4)3F H
KORYAKITE NaKMg2Al2(SO4)6 R
KONONOVITE NaMg(SO4)F M
KOBYASHEVITE Cu5(SO4)2(OH)6.4H2O A
KINGSGATEITE ZrMo++++++2O7(OH)2.2H2O Q
KATERINOPOULOSITE (NH4)2Zn(SO4)2.6H2O M
GEORGEROBINSONITE Pb4(CrO4)2(OH)2FCl O
KARPOVITE Tl2VO(SO4)2(H2O) M
ITELMENITE Na4Mg3Cu3(SO4)8 O
ICHNUSAITE Th(MoO4)2.3H2O M
HUIZINGITE-(Al) (NH4)9Al3(SO4)8(OH)2.4H2O A
HODGESMITHITE (Cu,Zn)6Zn(SO4)2(OH)10.3H2O R
HASANOVITE KNa(MoO2)(SO4)2 M
HANSESMARKITE Ca2Mn2Nb6O19.20H2O A
GREENLIZARDITE (NH4)Na(UO2)2(SO4)2(OH)2.4H2O A
GLIKINITE Zn3O(SO4)2 M
GIACOVAZZOITE K5Fe+++3O(SO4)6.10H2O M
GESCHIEBERITE K2(UO2)(SO4)2.2H2O O
BLUELIZARDITE Na7(UO2)(SO4)4Cl(H2O)2 M
* PHOSPHATES, ARSENATES, VANADATES
Phosphates, etc. without additional anions, without H2O
With small cations (some also With larger ones)
ALARSITE AlAsO4 R
BERLINITE AlPO4 R
RODOLICOITE Fe+++3(PO4) R
BERYLLONITE NaBePO4 M
HURLBUTITE CaBe2(PO4)2 M
LITHIOPHOSPHATE Li3PO4 O
NALIPOITE NaLi2PO4 O
OLYMPITE LiNa5(PO4)2 O
With medium-sized cations
BORISENKOITE Cu3[(V,As)O4]2 M
FARRINGTONITE Mg3(PO4)2 M
PURPURITE Mn+++PO4 O
SIMFERITE Li0,5(Mg,Mn+++)5(PO4)3 O
TRIPHYLITE LiFe++PO4 O
SICKLERITE Li(Mn++,Fe+++)PO4 O
NATROPHILITE NaMnPO4 O
LITHIOPHILITE LiMnPO4 O
KARENWEBBERITE Na(Fe++,Mn++)PO4 O
FERRISICKLERITE Li(Fe+++,Mn++)PO4 O
HETEROSITE Fe+++PO4 O
CHOPINITE (Mg,Fe++)3(PO4)2 M
SARCOPSIDE (Fe++,Mn,Mg)3(PO4)2 M
GRAFTONITE Fe++Fe++2(PO4)2 M
BEUSITE Mn++Mn++2(PO4)2 M
XANTHIOSITE Ni3(AsO4)2 M
LAMMERITE Cu3[(As,P)O4]2 M
LAMMERITE-Beta Cu3(AsO4)2 M
MCBIRNEYITE Cu3(VO4)2 A
PSEUDOLYONSITE (Cu,Zn)3(VO4)2 M
STRANSKIITE Zn2Cu++(AsO4)2 A
LYONSITE Cu++3Fe+++4(VO4)6 O
GRAFTONITE-Ca CaFe++2(PO4)2 M
GRAFTONITE-Mn MnFe++2(PO4)2 M
BEUSITE-(Ca) CaMn++2(PO4)2 M
ZAVALIAITE (Mn++,Fe++,Mg)3(PO4)2 M
With medium-sized and large cations
HOWARDEVANSITE NaCu++Fe+++2(VO4)3 A
ARSENIOPLEITE NaCaMn++(Mn++,Mg)2(AsO4)3 M
GROATITE []NaCaMn2(PO4)(HPO4)2 M
FERROHAGENDORFITE NaCaFe++Fe++2(PO4)3 M
FERROALLUAUDITE NaCaFe++(Fe++,Mn++,Fe+++)2(PO4)3 M
CARYINITE NaCaCaMn2(AsO4)3 M
BRADACZEKITE NaCuCuCu2(AsO4)3 M
ALLUAUDITE []NaMnFe+++2(PO4)3 M
JOHILLERITE NaCuMgMg2(AsO4)3 M
MAGHAGENDORFITE Na2MgFe++Fe+++(PO4)3 M
NICKENICHITE Na(Ca0,5Cu0,5)MgMg2(AsO4)3 M
HAGENDORFITE Na2MnFe++Fe+++(PO4)3 M
YAZGANITE []NaMgFe+++2(AsO4)3.H2O M
VARULITE Na2Mn(MnFe+++)(PO4)3 M
FERROROSEMARYITE []NaFe++(Fe+++Al)(PO4)3 M
QINGHEIITE NaNaMn(MgAl)(PO4)3 M
ROSEMARYITE []NaMn(Fe3+Al)(PO4)3 M
FERROQINGHEIITE NaNaFe2+(MgAl)(PO4)3 M
WYLLIEITE NaNaMn(Fe++Al)(PO4)3 M
FERROWYLLIEITE NaNaFe++(Fe++Al)(PO4)3 M
BOBFERGUSONITE []Na2Mn5Fe+++Al(PO4)6 M
MANITOBAITE (Na,Ca)3(Mn++,Fe++)5(Al,Fe+++)1,5(PO4)6 M
MARICITE NaFe++PO4 O
SCHAFERITE {Ca2Na}[Mg2](V+++++3)O12 C
PARABERZELIITE NaCaCaMg2(AsO4)3 M
PALENZONAITE {Ca2Na}[Mn++2](V+++++3)O12 C
BERZELIITE {Ca2Na}[Mg2](As+++++3)O12 C
MANGANBERZELIITE {Ca2Na}[Mn++2](As+++++3)O12 C
BRIANITE Na2CaMg(PO4)2 M
VITUSITE-(Ce) Na3(Ce,La,Nd)(PO4)2 O
OLGITE Na(Na,Sr)2(Ba,Sr)(PO4)2 H
BARIOOLGITE (Ba,Sr)(Na,Sr,REE)2Na(PO4)2 R
TUITE gamma-(Ca,Mg,Na)3(PO4)2 R
FERROMERRILLITE Ca9NaFe++(PO4)7 R
MERRILLITE Ca9Na(Mg,Fe)(PO4)7 R
STRONTIOWHITLOCKITE Sr7(Mg,Ca)3(PO4)6[PO3(OH)] R
WHITLOCKITE Ca9(Mg,Fe++)(PO4)6(PO3OH) R
CHLADNIITE Na12Ca5(Mg,Fe++)43(PO4)36 R
XENOPHYLLITE Na4Fe++7(PO4)6 A
STORNESITE-(Y) (Y,Ca)[]2Na6(Ca,Na)8(Mg,Fe)43(PO4)36 R
JOHNSOMERVILLEITE Na8Ca7(Fe++,Mg,Mn++)43(PO4)36 R
FILLOWITE Na12Ca4(Mn++,Fe++)44(PO4)36 M
GALILEIITE (Na,K)12(Fe++,Mn++,Cr)48(PO4)36 R
HARRISONITE Ca(Fe++,Mg)6(PO4)2(SiO4)2 R
KOSNARITE KZr++++2(PO4)3 R ps C
PANETHITE (Na,Ca,K)2(Mg,Fe++,Mn)2(PO4)2 M
STANFIELDITE Ca4(Mg,Fe++,Mn)5(PO4)6 M
RONNEBURGITE K2Mn++V4O12 M
TILLMANNSITE (Ag3Hg)+++(VO4,AsO4) Q
FILATOVITE K(Al,Zn)2(As+++++,Si)2O8 M
CALCIOHATERTITE NaNaCa(CaFe+++)(AsO4)3 M
ZHANGHUIFENITE Na3Mn++4Mg2Al(PO4)6 M
ZINCOBRADACZEKITE NaCuCuZn2(AsO4)3 M
HAGENDORFITE-(Na)(Na) Fe++Mn++(PO4)-(Na)(Na) M
MAGNESIOCANUTITE Na[]MnMg2[AsO4]2[AsO2(OH)2] M
ODANIELITE Na[]ZnZn2(AsO4)[AsO3(OH)]2 M
MANGANOBADALOVITE NaNaMn(MgFe+++)(AsO4)3 M
KHRENOVITE Na3Fe+++2(AsO4)3 M
KEPLERITE Ca9(Ca0,5[]0,5)Mg(PO4)7 R
ALLUAUDITE-Ca[] []4Ca4Mn++4Fe+++8(PO4)12 M
JOHANNGEORGENSTADTITE Ni++4,5(AsO4)3 M
HEDEGAARDITE (Ca,Na)9(Ca,Na)Mg(PO4)6(PO3OH) R
HATERTITE NaNaCa(Cu++Fe+++)(AsO4)3 M
DYRNAESITE-(La) Na8Ce++++(La,REE)2(PO4)6 O
FERROBOBFERGUSONITE []Na2Fe++5Fe+++Al(PO4)6 M
ANGARFITE NaFe+++5(PO4)4(OH)4.4H2O O
EDTOLLITE K2NaCu5Fe+++O2(AsO4)4 A
WOPMAYITE Ca6Na3[]Mn(PO4)3(PO3OH)4 R
CALCIOJOHILLERITE NaCaMg3(AsO4)3 M
ALLUAUDITE-Na[] []4Na4Mn++4Fe+++8(PO4)12 M
CAMANCHACAITE Na[]CaMg2(AsO4)2[AsO2(OH)2] M
CANUTITE Na[]MnMn2(AsO4)[AsO3(OH)]2 M
ERIKAPOHLITE ([]0,5Cu0,5)CuCaZn2(AsO4)3.H2O M
ALUMOEDTOLLITE K2NaCu5AlO2(AsO4)4 A
With only large cations
NAHPOITE Na2HPO4 M
MONETITE CaHPO4 A
SVENEKITE Ca(H2AsO4)2 A
WEILITE CaHAsO4 A
BIPHOSPHAMMITE (NH4,K)H2PO4 Q
ARCHERITE (K,NH4,)H2PO4 Q
PHOSPHAMMITE (NH4)2HPO4 M (?)
BUCHWALDITE NaCaPO4 O
SCHULTENITE PbHAsO4 M
WAKEFIELDITE-(Nd) (Nd,La,Ce)VO4 Q
XENOTIME-(Yb) (Yb,Y,Er)PO4 Q
WAKEFIELDITE-(Y) YVO4 Q
WAKEFIELDITE-(La) (La,Nd,Pr)VO4 Q
WAKEFIELDITE-(Ce) (Ce,La,Nd,Y,Pr,Sm)(V,As)O4 Q
PRETULITE Sc(PO4) Q
DREYERITE BiVO4 Q
CHERNOVITE-(Y) YAsO4 Q
XENOTIME-(Y) YPO4 Q
PUCHERITE BiVO4 O
XIMENGITE BiPO4 H
GASPARITE-(Ce) (Ce,La,Nd)AsO4 M
ROOSEVELTITE BiAsO4 M
MONAZITE-(Sm) (Sm,Gd,Ce,Th,Ca)(PO4) M
MONAZITE-(Nd) (Nd,Ce,Sm)(PO4) M
GASPARITE-(La) LaAsO4 M
MONAZITE-(Ce) (Ce,La,Nd,Th)PO4 M
CHERALITE CaTh(PO4)2 M
MONAZITE-(La) (La,Ce,Nd)PO4 M
TETRAROOSEVELTITE BiAsO4 Q
CHURSINITE Hg+Hg++(AsO4) M
CLINOBISVANITE BiVO4 M
BADALOVITE NaNaMg(MgFe+++)(AsO4)3 M
Phosphates, etc., with additional anions, without H2O
ABUITE CaAl2(PO4)2F2 O
ARSMIRANDITE Na18Cu12Fe+++O8(AsO4)8Cl5 M
With small and medium-sized cations
VAYRYNENITE MnBe(PO4)(OH,F) M
HERDERITE CaBe(PO4)F M
HYDROXYLHERDERITE CaBe(PO4)(OH) M
BERGSLAGITE CaBe(AsO4)(OH) M
BABEFPHITE BaBe(PO4)(F,O) Q
AXELITE Na14Cu7(AsO4)8F2Cl2 Q
With only medium-sized cations, (OH, etc.):RO4 about 1:1
ARSENOWAGNERITE Mg2(AsO4)F M
TAVORITE LiFe+++(PO4)(OH) A
AMBLYGONITE (Li,Na)Al(PO4)(F,OH) A
MONTEBRASITE LiAl(PO4)(OH,F) A
TRIPLITE (Mn,Fe++,Mg,Ca)2(PO4)(F,OH) M
ZWIESELITE Fe++,Mn)2(PO4)F M
WOLFEITE (Fe++,Mn++)2(PO4)(OH) M
HYDROXYLWAGNERITE Mg2(PO4)(OH) M
JOOSTEITE Mn++(Mn+++,Fe+++)(PO4)O M
SARKINITE Mn++2(AsO4)(OH) M
STANEKITE Fe+++(Mn++,Fe++,Mg)(PO4)O M
TRIPLOIDITE (Mn,Fe++)2(PO4)(OH) M
WAGNERITE (Mg,Fe++)2(PO4)F M
SATTERLYITE (Fe++,Mg,Fe+++)2(PO4)(OH) H
HOLTEDAHLITE Mg12(PO3OH,CO3)(PO4)5(OH,O)6 H
ALTHAUSITE Mg2(PO4)(OH,F,O) O
OLIVENITE Cu2AsO4(OH) M
ZINCOLIBETHENITE CuZn(PO4)(OH) O
LIBETHENITE Cu2(PO4)(OH) M
EVEITE Mn2(AsO4)(OH) O
AURIACUSITE Fe+++Cu++(AsO4,Sb+++++O4)(O,OH) O
ADAMITE Zn2(AsO4)(OH) O/M
ZINCOLIVENITE Cu(Zn,Cu)AsO4(OH) O
PARADAMITE Zn2(AsO4)(OH) A
TARBUTTITE Zn2(PO4)(OH) A
WILHELMKLEINITE ZnFe+++2(AsO4)2(OH)2 M
BARBOSALITE Fe++Fe+++2(PO4)2(OH)2 M
HENTSCHELITE Cu++Fe+++2(PO4)2(OH)2 M
LAZULITE (Mg,Fe)Al2(PO4)2(OH)2 M
SCORZALITE (Fe++,Mg)Al2(PO4)2(OH)2 M
TROLLEITE Al4(PO4)3(OH)3 M
NAMIBITE Cu++(BiO)2V+++++O4OH M
PHOSPHOELLENBERGERITE Mg14(PO4,AsO4)6(PO3OH,CO3)2(OH)6 H
URUSOVITE CuAl(AsO4)O M
THEOPARACELSITE Cu++3(OH)2As2O7 O
TURANITE Cu5(VO4)2(OH)4 O
STOIBERITE Cu5V+++++2O10 M
FINGERITE Cu11(VO4)6O2 A
AVERIEVITE Cu++5O2(VO4)2.n(CuCl) or Cu++5O2(VO4)2.n(CuCl2) or Cu++5O2(VO4)2.n(K,Rb,Cs)Cl M
RICHELLITE CaFe+++2(PO4)2(OH,F)2 am.
ZINCLIPSCOMBITE ZnFe+++2(PO4)2(OH)2 Q
LIPSCOMBITE (Fe++,Mn++)Fe+++2(PO4)2(OH)2 Q
KHORIXASITE (Bi0,67[]0,33)Cu(VO4)(OH) M
With only medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
ANGELELLITE Fe+++4(AsO4)2O3 A
PLIMERITE ZnFe+++4(PO4)3(OH)5 O
ROCKBRIDGEITE (Fe++,Mn)Fe+++4(PO4)3(OH)5 O
FRONDELITE Mn++Fe+++4(PO4)3(OH)5 O
AERUGITE Ni17As6O32 R
FERRIROCKBRIDGEITE (Fe+++0,67[]0,33)2(Fe+++)3(PO4)3(OH)4(H2O) O
FERROROCKBRIDGEITE (Fe++,Mn++)2(Fe+++)3(PO4)3(OH)4(H2O) O
With only medium-sized cations, (OH, etc.):RO4= 2:1
REICHENBACHITE Cu++5(PO4)2(OH)4 M
CORNWALLITE Cu5(AsO4)2(OH)4 M
PSEUDOMALACHITE Cu5(PO4)2(OH)4 M
ARSENOCLASITE Mn5(AsO4)2(OH)4 O
GATEHOUSEITE Mn++5(PO4)2(OH)4 O
PARWELITE (Mn,Mg)5Sb(As,Si)2O12 M
REPPIAITE Mn5(VO4)2(OH)4 M
LUDJIBAITE Cu5(PO4)2(OH)4 A
CORNUBITE Cu5(AsO4)2(OH)4 A
With only medium-sized cations, (OH, etc.):RO4 > 2:1
AUGELITE Al2(PO4)(OH)3 M
GRATTAROLAITE Fe+++O3(PO4) R
CORNETITE Cu3(PO4)(OH)3 O
CLINOCLASE Cu3(AsO4)(OH)3 M
ARHBARITE Cu2Mg(AsO4)(OH)3 A
GILMARITE Cu3(AsO4)(OH)3 A
ALLACTITE Mn7(AsO4)2(OH)8 M
ARGANDITE Mn++7(VO4,AsO4)2(OH)8 M
FLINKITE Mn++2Mn+++(AsO4)(OH)4 O
RAADEITE Mg7(PO4)2(OH)8 M
CHLOROPHOENICITE (Mn,Mg)3Zn2(AsO4)(OH,O)6 M
MAGNESIOCHLOROPHOENICITE (Mg,Mn)3Zn2(AsO4)(OH,O)6 M
GERDTREMMELITE (Zn,Fe++)(Al,Fe+++)2(AsO4)(OH)5 A
TURTMANNITE (Mn,Mg)22,5Mg3-3x[(V,As)O4]3[SiO4]3[AsO3]xO5-5x(OH)20+x R ps H
ARAKIITE (Zn,Mn++)(Mn++,Mg)12(Fe+++,Al)2(As+++O3)(As+++++O4)2(OH)23 M
CARLFRANCISITE Mn++3(Mn++,Mg,Fe+++,Al)42[As+++O3]2(As+++++O4)4[(Si,As+++++)O4]6[(As+++++,Si)O4]2(OH)42 R
DIXENITE Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 R
HEMATOLITE (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 R
KRAISSLITE (Mn++,Mg)24Zn3Fe+++(As+++O3)2(As+++++O4)3(SiO4)6(OH)18 H
MCGOVERNITE (Mn,Mg,Zn)22(AsO3)(AsO4)3(SiO4)3(OH)20 R
SYNADELPHITE Mn++9(As+++++O4)2(As+++O3)(OH)9.2H2O A ps O
HOLDENITE (Mn,Mg)6Zn3(AsO4)2(SiO4)(OH)8 O
KOLICITE Mn7Zn4(AsO4)2(SiO4)2(OH)8 O
SABELLIITE (Cu,Zn)2Zn[(As,Sb)O4](OH)3 R
JAROSEWICHITE Mn++3Mn+++(AsO4)(OH)6 O
THEISITE Cu5Zn5(As+++++,Sb+++++)2O8(OH)14 O
COPARSITE Cu4O2[(As,V)O4]Cl O
WATERHOUSEITE Mn++7(PO4)2(OH)4 M ps O
With medium-sized and large cations, (OH, etc.):RO4< 0.5:1
FLUORARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)F2 M
ARROJADITE-(BaNa) BaNa3(NaCa)Fe++13Al(PO4)11(PO3OH)(OH) M
ARROJADITE-(KFe) KNa3CaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(KNa) KNa5CaFe++13Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(PbFe) Na2PbCaFe++14Al(PO4)11(PO3OH)(OH)2 M
ARROJADITE-(SrFe) Na2SrCaFe++14Al(PO4)11(PO3OH)(OH)2 M
DICKINSONITE-(KMnNa) KNa4CaMn++14Al(PO4)12(OH)2 M
ARROJADITE-(BaFe) Na2BaCaFe++14Al(PO4)11(PO3OH)(OH)2 M
SAMUELSONITE (Ca,Ba)Ca8(Fe++,Mn++)4Al2(PO4)10(OH)2 M
GRIPHITE Na4Ca6(Mn,Fe++,Mg)19Li2Al8(PO4)24(F,OH)8 C
NABIASITE BaMn9[(V,As)O4]6(OH)2 C
FLUORARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORCARMOITE-(BaNa) (Ba[])(NaNa)Ca(Na2[])Mg13Al(PO4)11(PO3OH)F2 M
FLUORARROJADITE-(KNa) {KNa}{Na2}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)F2 M
FLUORARROJADITE-(BaNa) BaNa4CaFe13Al(PO4)11(PO3OH)F2 M
FERRIARROJADITE-(BaNa) {Ba[]}{Na2}{Ca}{Na2[]}{Fe++13}{Fe+++}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(NaFe) {Na2}{Fe++[]}{Ca}{Na2[]}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
ARROJADITE-(KFeNa) {KNa}{Fe++[]}{Ca}{Na3}{Fe++13}{Al}(PO4)11(HPO4)(OH)2 M
MANGANOARROJADITE-(KNa) KNa5MnFe13Al(PO4)11(PO3OH)(OH)2 M
With medium-sized and large cations, (OH, etc.):RO4 = 0.5:1
ALDOMARINOITE Sr2Mn+++(AsO4)2(OH) M
FEINGLOSITE Pb2(Zn,Fe++)[(As,S)O4]2.H2O M
BEARTHITE Ca2Al(PO4)2(OH) M
TSUMEBITE Pb2Cu(PO4)(SO4)(OH) M
TOKYOITE Ba2Mn+++(VO4)2(OH) M
GOEDKENITE (Sr,Ca)2Al(PO4)2(OH) M
GAMAGARITE Ba2(Fe+++,Mn+++)(VO4)2(OH) M
BRACKEBUSCHITE Pb2(Mn+++,Fe+++)(VO4)2(OH) M
BUSHMAKINITE Pb2(Al,Cu++)PO4(V+++++,Cr++++++)O4(OH) M
ARSENTSUMEBITE Pb2Cu(AsO4)(SO4)(OH) M
ARSENBRACKEBUSCHITE Pb2(Fe++,Zn)(AsO4)2(OH,H2O) M
CALDERONITE Pb2Fe+++(VO4)2(OH) M
MELONJOSEPHITE CaFe++Fe+++(PO4)2(OH) O
TANCOITE LiNa2Al(PO4)(PO3OH)(OH) O
CANOSIOITE Ba2Fe+++(AsO4)2(OH) M
With medium-sized and large cations, (OH,etc.):RO4 = 1:1
THADEUITE (Ca,Mn++)(Mg,Fe++,Mn+++)3(PO4)2(OH,F)2 O
PANASQUEIRAITE CaMg(PO4)(OH,F) M
TILASITE CaMg(AsO4)F M
MAXWELLITE (Na,Ca)(Fe+++,Al,Mg)(AsO4)(F,O) M
ISOKITE CaMg(PO4)F M
DURANGITE NaAl(AsO4)F M
LACROIXITE NaAl(PO4)F M
DRUGMANITE Pb2(Fe+++,Al)H(PO4)2(OH)2 M
KULANITE Ba(Fe++,Mn,Mg)2Al2(PO4)3(OH)3 A
PENIKISITE Ba(Mg,Fe++)2Al2(PO4)3(OH)3 A
JOHNTOMAITE Ba(Fe++,Ca,Mn++)2Fe3+++2(PO4)3(OH)3 M
CIRROLITE Ca3Al2(PO4)3(OH)3 (?)  
BJAREBYITE (Ba,Sr)(Mn++,Fe++,Mg)2Al2(PO4)3(OH)3 M
PERLOFFITE Ba(Mn,Fe++)2Fe+++2(PO4)3(OH)3 M
BERTOSSAITE (Li,Na)2CaAl4(PO4)4(OH,F)4 O
PALERMOITE (Sr,Ca)(Li,Na)2Al4(PO4)4(OH)4 O
CARMINITE PbFe+++2(AsO4)2(OH)2 O
SEWARDITE Ca2Fe+++2(AsO4)2(OH)2 O
GOTTLOBITE CaMg(VO4,AsO4)(OH).0,5H2O O
TANGEITE CaCu(VO4)(OH) O
DUFTITE PbCu(AsO4)(OH) O
HERMANNROSEITE CaCu(PO4,AsO4)(OH) O
GABRIELSONITE PbFe+++(As+++O3)O O
COBALTAUSTINITE Ca(Co,Cu++)(AsO4)(OH) O
AUSTINITE CaZn(AsO4)(OH) O
NICKELAUSTINITE Ca(Ni,Zn)(AsO4)(OH) O
ARSENDESCLOIZITE PbZn(AsO4)(OH) O
ADELITE CaMg(AsO4)(OH) O
CONICHALCITE CaCu++(AsO4)(OH) O
CECHITE Pb(Fe++,Mn)(VO4)(OH) O
PYROBELONITE PbMn++(VO4)(OH) O
DESCLOIZITE PbZn(VO4)(OH) O
MOTTRAMITE PbCu++(VO4)(OH) O
BAYLDONITE (Cu,Zn)3Pb(AsO4)2(OH)2 M
VESIGNIEITE Cu3Ba(VO4)2(OH)2 M
PAGANOITE (Ni,Co)Bi+++As+++++O5 A
JAGOWERITE BaAl2(PO4)2(OH)2 A
ATTAKOLITE (Ca,Sr)Mn++(Al,Fe+++)4[(Si,P)O4]H(PO4)3(OH)4 M
LENINGRADITE PbCu++3(VO4)Cl2 O
STRONTIOPERLOFFITE SrMn2+2Fe3+2(PO4)3(OH)3 M
CRIMSONITE PbFe+++2(PO4)2(OH)2 O
PLUMBOPERLOFFITE PbMn++2Fe+++2(PO4)3(OH)3 M
NATROPALERMOITE Na2SrAl4(PO4)4(OH)4 O
With medium-sized and large cations, (OH, etc.):RO4= 1:5:1
With medium-sized and large cations, (OH, etc.):RO4 = 2:1, 2.5:1
BRAZILIANITE NaAl3(PO4)2(OH)4 M
MEDENBACHITE Bi2Fe+++(Cu,Fe++)O2(OH)2(AsO4)2 A
NEUSTADTELITE Bi2Fe+++(Fe+++,Co++)O2(OH)2(AsO4)2 A
COBALTNEUSTADTELITE Bi2Fe+++(Co++,Fe+++)O(OH)3(AsO4)2 A
CURETONITE Ba(Al,Ti++++)(PO4)4(O,OH)F M
HEYITE Pb5Fe++2(VO4)2O4 M
JAMESITE Pb2ZnFe+++2(Fe+++2,8Zn1,2)(AsO4)4(OH)8[(OH)1,2O0,8] A
LULZACITE Sr2Fe++(Fe++,Mg)2Al4(PO4)4(OH)10 A
With medium-sized and large cations, (OH, etc.):RO4 = 3:1
KEMMLITZITE (Sr,Ce)Al3(AsO4)(SO4)(OH)6 R
SVANBERGITE SrAl3(PO4)(SO4)(OH)6 R
HINSDALITE (Pb,Sr)Al3(PO4,SO4)(OH,H2O)6 R
GALLOBEUDANTITE PbGa3[(AsO4),(SO4)]2(OH)6 R
CORKITE PbFe+++3(PO4)(SO4)(OH)6 R
BEUDANTITE PbFe+++3(AsO4)(SO4)(OH)6 R
WOODHOUSEITE CaAl3(PO4)(SO4)(OH)6 R
HIDALGOITE PbAl3(AsO4)(SO4)(OH)6 R
VISEITE Ca10Al24(SiO4)6(PO4)7O22F3.72H2O (?) C
EYLETTERSITE (Th,Pb)1-xAl3(PO4,SiO4)2(OH)6 R
SPRINGCREEKITE Ba(V+++,Fe+++)2(PO4)2(OH,H2O)6 R
SEGNITITE PbFe+++3H(AsO4)2(OH)6 R
PLUMBOGUMMITE PbAl3(PO4)2(OH)5.H2O R
PHILIPSBORNITE PbAl3(AsO4)2(OH)5.H2O R
KINTOREITE PbFe+++3(PO4)2(OH,H2O)6 R
GORCEIXITE BaAl3[(PO3(O,OH)]2(OH)6 R
DUSSERTITE BaFe+++3(AsO4)2(OH)5 R
CRANDALLITE CaAl3(PO3OH)(PO4)(OH)6 R
BENAUITE (Sr,Ba)(Fe+++,Al)3(PO4)2(SO4)2(OH,H2O)6 R
ARSENOGOYAZITE (Sr,Ca,Ba)Al3(AsO4,PO4)2(OH,F)5.H2O R
ARSENOGORCEIXITE HBaAl3(AsO4)2(OH)6 R
ARSENOCRANDALLITE (Ca,Sr)Al3[(As,P)O4]2(OH)5.H2O R
GOYAZITE SrAl3(PO3OH)(PO4)(OH)6 R
GRAULICHITE-(La) LaFe+++3(AsO4)2(OH)6 R
ARSENOFLORENCITE-(Ce) (Ce,La)Al3(AsO4,PO4)2(OH)6 R
FLORENCITE-(Sm) (Sm,Nd)Al3(PO4)2(OH)6 R
WAYLANDITE (Bi,Ca)Al3(PO4,SiO4)2(OH)6 R
ZAIRITE Bi(Fe+++,Al)3(PO4)2(OH)6 R
GRAULICHITE-(Ce) (Ce,Ba)(Fe+++,Al)3(AsO4)2(OH,H2O)6 A
FLORENCITE-(La) (La,Ce)Al3(PO4)2(OH)6 R
ARSENOFLORENCITE-(La) (La,Ce,Nd)Al3(AsO4)2(OH)6 R
FLORENCITE-(Ce) CeAl3(PO4)2(OH)6 R
FLORENCITE-(Nd) (Nd,Ce)Al3(PO4)2(OH)6 A
VIITANIEMIITE Na(Ca,Mn++)Al(PO4)(F,OH)3 M
PATTERSONITE PbFe+++3(PO4)2(OH,H2O)6 A
KIRYUITE NaMnAl(PO4)F3 M
GALLOPLUMBOGUMMITE Pb(Ga,Al)3-xGexH1-x(PO4)2(OH)6 (x between 0 and 1) R
WEILERITE BaAl3(AsO4)(SO4)(OH)6 R
ARSENOFLORENCITE-(Nd) NdAl3(AsO4)2(OH)6 R
With medium-sized and large cations, (OH, etc.):RO4 = 4:1
RETZIAN-(Ce) Mn2Ce(AsO4)(OH)4 O
RETZIAN-(La) (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 O
RETZIAN-(Nd) Mn2(Nd,Ce,La)(AsO4)(OH)4 O
KOLITSCHITE Pb[Zn0,5[]0,5]Fe3(AsO4)2(OH)6 M ps R
PAULKELLERITE Bi2Fe+++(PO4)O2(OH)2 M
BRENDELITE (Bi+++,Pb++)2(Fe+++,Fe++)O2(OH)(PO4) M
BETPAKDALITE-NaNa [Na2(H2O)16Na(H2O)6][Mo8As2Fe+++3O33(OH)4] M
With only large cations, (OH, etc.):RO4 = 0.33:1
CHLORAPATITE-M Ca5(PO4)3Cl M
MIMETITE Pb5(AsO4)3Cl H
VANADINITE Pb5(VO4)3Cl H
TURNEAUREITE Ca5(AsO4)3Cl H
SVABITE Ca5(AsO4)3F H
STRONADELPHITE Sr5(PO4)3(F,OH) H
PYROMORPHITE Pb5(PO4)3Cl H
PHOSPHOHEDYPHANE Ca2Pb3(PO4)3Cl H
MORELANDITE (Ba,Pb)3(Ca,Pb)2(AsO4,PO4)3Cl H
MIMETITE-M Pb5(AsO4)3Cl M ps H
KUANNERSUITE-(Ce) NaBa3(Ce,Nd,La)(PO4)3(F,Cl) R ps H
JOHNBAUMITE Ca5(AsO4)3(OH) H
HYDROXYLAPATITE-M Ca5(PO4)3(OH) M
CARLGIESECKEITE-(Nd) NaNdCa3(PO4)3F R ps H
ALFORSITE Ba5(PO4)3Cl H
MIYAHISAITE (Sr,Ca)2Ba3(PO4)3F H
BELOVITE-(La) Sr3Na(La,Ce)(PO4)3(F,OH) R
HYDROXYLAPATITE Ca5(PO4)3(OH) H
CHLORAPATITE Ca5(PO4)3Cl H
DELONEITE (Na,Ca,Ce)2Sr3(Ca,Ce)5(PO4)6(OH)F R
FLUORAPATITE Ca5(PO4)3F H
FLUORCAPHITE Ca(Sr,NaCa)(Ca,Sr,Ce)3(PO4)3F H
FLUORPHOSPHOHEDYPHANE Ca2Pb3(PO4)3F H
FLUORSTROPHITE Sr4Ca(PO4)3F H
HEDYPHANE Pb3Ca2(AsO4)3Cl H
BELOVITE-(Ce) Sr3Na(Ce,La)(PO4)3(F,OH) R
ARCTITE Na2Ca4(PO4)3F R
ZADOVITE BaCa6[(SiO4)(PO4)](PO4)2F R
ARADITE BaCa6[(SiO4)(VO4)](VO4)2F R
GAZEEVITE BaCa6(SiO4)2(SO4)2O R
HYDROXYLHEDYPHANE Ca2Pb3(AsO4)3(OH) R
HYDROXYLPYROMORPHITE Pb5(PO4)3(OH) H
STRACHERITE BaCa6(SiO4)2[(PO4)(CO3)]2F R
VANACKERITE Pb4Cd(AsO4)3(Cl,OH) R ps H
With only large cations, (OH, etc.):RO4 about 1:1
NACAPHITE Na2Ca(PO4)F O
PETITJEANITE Bi+++3(PO4)2O(OH) A
PREISINGERITE Bi3(AsO4)2O(OH) A
SCHUMACHERITE Bi3[(V,As,P)O4]2O(OH) A
SMRKOVECITE Bi2O(OH)(PO4) M
ATELESTITE Bi2O(OH)(AsO4) M
HECHTSBERGITE Bi2O(OH)(VO4) M
KOMBATITE Pb14(VO4)2O9Cl4 M
SAHLINITE Pb14(AsO4)2O9Cl4 M
HENEUITE CaMg5(PO4)3(CO3)(OH) A
NEFEDOVITE Na5Ca4(PO4)4F A
KUZNETSOVITE Hg3Cl(AsO4) C
ARTSMITHITE Hg+4Al(PO4)2-x(OH)1+3x (x = 0,26) M
SCHLEGELITE Bi7(MoO4)2(AsO4)3O4 O
ARIEGILATITE BaCa12(SiO4)4(PO4)2F2O R
DARGAITE BaCa12(SiO4)4(SO4)2O3 R
NABIMUSAITE KCa12(SiO4)4(SO4)2O2F R
ARAVAITE Ba2Ca18(SiO4)6(PO4)3(CO3)F3O R
Phosphates without additional anions, with H2O
BATAGAYITE CaZn2(Zn,Cu)6(PO4)4[PO3(OH)]3.12H2O M
DOMEROCKITE Cu4(AsO4)2(AsO3OH)(OH)3.H2O A
With small and large/medium cations
FRANSOLETITE H2Ca3Be2(PO4)4.4H2O M
PARAFRANSOLETITE Ca3Be2(PO4)2(PO3OH)2.4H2O A
EHRLEITE Ca2ZnBe(PO4)2(PO3OH).4H2O A
FAHEYITE (Mn,Mg)Fe+++2Be2(PO4)4.6H2O H
GAINESITE Na(Na,K)(Be,Li)(Zr,Zn)2(PO4)4.1-2H2O Q
MCCRILLISITE NaCs(Be,Li)Zr2(PO4)4.1-2H2O Q
SELWYNITE NaK(Be,Al)Zr2(PO4)4.2H2O Q
PAHASAPAITE (Ca5,5Li3,6K1,2Na0,2[]13,5)Li8[Be24P24O96].38H2O C
ARSENOHOPEITE Zn3(AsO4)2.4H2O O
HOPEITE Zn3(PO4)2.4H2O O
WARIKAHNITE Zn3(AsO4)2.2H2O A
PHOSPHOPHYLLITE Zn2(Fe++,Mn)(PO4)2.4H2O M
PARASCHOLZITE CaZn2(PO4)2.2H2O M
SCHOLZITE CaZn2(PO4)2.2H2O O
KEYITE ([]0,5Cu0,5)CuCdZn2(AsO4)3.H2O M
PUSHCHAROVSKITE K0,6Cu18(AsO4)(HAsO4)10(H2AsO4)4(OH)9,6.18,6H2O A
PROSPERITE CaZn2(AsO4)2.H2O M
GENGENBACHITE KFe+++3[(H2PO4)2|(HPO4)4].6H2O H
PARAHOPEITE Zn3(PO4)2.4H2O A
SERGEYSMIRNOVITE MgZn2(PO4)2.4H2O O
DAVIDLLOYDITE Zn3(AsO4)2.4H2O A
NIZAMOFFITE Mn++Zn2(PO4)2.4H2O O
APEXITE NaMg(PO4).9H2O A
BRANDAOITE [BeAl2(PO4)2(OH)2(H2O)4](H2O) A
REAPHOOKHILLITE MgZn2(PO4)2.4H2O A
With only medium-sized cations, RO4:H2O = 1:1
SERRABRANCAITE Mn+++(PO4).H2O M
HUREAULITE Mn5(PO4)2[PO3(OH)]2.4H2O M
MIGUELROMEROITE Mn5(H2O)4(AsO3OH)2(AsO4)2 M
NYHOLMITE Cd3Zn2(AsO3OH)2(AsO4)2.4H2O M
SAINFELDITE Ca5(H2O)4(AsO3OH)2(AsO4)2 M
VILLYAELLENITE (Mn,Ca)Mn2Ca2(H2O)4(AsO3OH)2(AsO4)2 M
FLUCKITE CaMn++H2(AsO4)2.2H2O A
KRAUTITE MnAs+++++O3(OH).H2O M
COBALTKORITNIGITE (Co,Zn)(As+++++O3)(OH).H2O A
KORITNIGITE Zn(As+++++O3)(OH).H2O A
YVONITE Cu(AsO3.OH).2H2O A
GEMINITE Cu++(AsO3OH).H2O A
SCHUBNELITE Fe+++2-x(V+++++,V++++)2O4(OH)4 A
RADOVANITE Cu2Fe+++(As+++O2)(As+++++O4)(OH)2.H2O O
KAZAKHSTANITE Fe+++5V++++3V+++++12O39(OH)9.9H2O M
KOLOVRATITE Hydrous vanadate of Ni and Zn (?)
IRHTEMITE Ca4MgH2(AsO4)4.4H2O M
BURGESSITE Co2(H2O)4[AsO3(OH)]2(H2O) M
GIFTGRUBEITE CaMn2Ca2(AsO4)2(AsO3OH)2.4H2O M
KRUPICKAITE Cu6[AsO3(OH)]6.8H2O M
MAGNESIOFLUCKITE CaMg(AsO3OH)2(H2O)2 A
MAGNESIOKORITNIGITE Mg(AsO3OH).H2O A
CHONGITE Ca3Mg2(AsO4)2(AsO3OH)2.4H2O M
With only medium-sized cations, RO4:H2O = 1:1.5
LANDESITE Fe+++Mn++2(PO4)2(OH).2H2O O
PHOSPHOFERRITE (Fe++,Mn)3(PO4)2.3H2O O
REDDINGITE Mn++3(PO4)2.3H2O O
GARYANSELLITE (Mg,Fe+++)3(PO4)2(OH,O).1,5H2O O
KRYZHANOVSKITE MnFe+++2(PO4)2(OH)2.H2O O
KAATIALAITE Fe+++As+++++3O9.6-8H2O M
LEOGANGITE Cu10(AsO4)4(SO4)(OH)6.8H2O M
CORREIANEVESITE Fe++Mn++2(PO4)2.3H2O O
With only medium-sized cations, RO4:H2O = 1:2
KOLBECKITE ScPO4.2H2O M
METAVARISCITE AlPO4.2H2O M
PHOSPHOSIDERITE Fe+++PO4.2H2O M
REDONDITE = A variety of Variscite Al(PO4).2H2O  
MANSFIELDITE AlAsO4.2H2O O
SCORODITE Fe+++AsO4.2H2O O
STRENGITE Fe+++PO4.2H2O O
VARISCITE AlPO4.2H2O O
YANOMAMITE InAsO4.2H2O O
PARASCORODITE Fe+++AsO4.2H2O R
LUDLAMITE (Fe++,Mg,Mn)3(PO4)2.4H2O M
STERLINGHILLITE Mn++3(AsO4)2.3H2O (?)
ROLLANDITE Cu3(AsO4)2.4H2O O
BONACINAITE Sc(AsO4).2H2O M
CASTELLAROITE Mn++3(AsO4)2.4,5H2O M
With only medium-sized cations, RO4:H2O about 1:2.5
CHUDOBAITE (Mg,Zn)5H2(AsO4)4.10H2O A
GEIGERITE Mn5(H2O)8(AsO3OH)2(AsO4)2.2H2O A
NEWBERYITE MgHPO4.3H2O O
BRASSITE MgHAsO4.4H2O O
ROSSLERITE MgHAsO4.7H2O M
PHOSPHORROSSLERITE MgHPO4.7H2O M
METASWITZERITE Mn3(PO4)2.4H2O M
SWITZERITE (Mn++,Fe++)3(PO4)2.7H2O M
VESELOVSKYITE (Zn,Cu,Co)Cu4[AsO3(OH)AsO4]2.9H2O A
PRADETITE CoCu4(AsO4)2(AsO3OH)2.9H2O A
KLAJITE MnCu4(AsO4)2(AsO3OH)2.9-10H2O A
LINDACKERITE (Cu,Co)5(AsO4)2(AsO3OH)2.10H2O A
ONDRUSITE CaCu4(AsO4)2(AsO3OH)2.10H2O A
BOBIERRITE Mg3(PO4)2.8H2O M
MANGANOHORNESITE (Mn++,Mg)3(AsO4)2.8H2O M
VIVIANITE Fe++3(PO4)2.8H2O M
PAKHOMOVSKYITE (Co,Mg)3(PO4)2.8H2O M
KOTTIGITE Zn3(AsO4)2.8H2O M
HORNESITE Mg3(AsO4)2.8H2O M
FERRISYMPLESITE Fe+++3(AsO4)2(OH)3.5H2O am.
ERYTHRITE Co3(AsO4)2.8H2O M
BARICITE (Mg,Fe++,Fe+++)3(PO4)2.8(H2O,OH) M
ARUPITE (Ni,Fe++)3(PO4)2.8H2O M
ANNABERGITE Ni3(AsO4)2.8H2O M
PARASYMPLESITE Fe++3(AsO4)2.8H2O M
SYMPLESITE Fe++3(AsO4)2.8H2O A
CATTIITE Mg3(PO4)2.22H2O A
KONINCKITE Fe+++PO4.3H2O Q
KANKITE Fe+++AsO4.3,5H2O M
STEIGERITE AlVO4.3H2O M
SCHODERITE Al2(PO4)(VO4).8H2O M
METASCHODERITE Al2(PO4)(VO4).6H2O M
ZIGRASITE MgZr(PO4)2.4H2O A
MALHMOODITE Fe+++Zr(PO4)2.4H2O M
SANTABARBARAITE Fe+++3(PO4)2(OH)3.5H2O am.
METAKOTTIGITE (Zn,Fe+++,Fe++)3(AsO4)2.8(H2O,OH) A
HLOUSEKITE (Ni,Co)Cu4(AsO4)2(AsO3OH)2.9H2O A
BABANEKITE (Cu,Zn,Co,Ni)3(AsO4)2.8H2O M
With large and medium-sized cations, RO4:H2O > 1:1
TASSIEITE (Na,[])Ca2(Mg,Fe++,Fe+++)2(Fe+++,Mg)2(Fe++,Mg)2(PO4)6.2H2O O
WICKSITE NaCa2(Fe++,Mn++)4MgFe+++(PO4)6.2H2O O
GRISCHUNITE NaCa2Mn++5Fe+++(AsO4)6.2H2O O
BEDERITE []Ca2Mn++2Fe+++2Mn++2(PO4)6.2H2O O
HAIGERACHITE KFe+++3(H2PO4)6(HPO4)2.4H2O M
ESPADAITE Na4Ca3Mg2[AsO3(OH)]2[AsO2(OH)2]10.7H2O O
LIRAITE NaCa2Mn++2[Fe+++Fe++]Mn++2(PO4)6(H2O)2 O
MANECKIITE (Na[])Ca2Fe++2(Fe+++Mg)Mn2(PO4)6.2H2O O
With large and medium-sized cations, RO4:H2O = 1:1
MESSELITE Ca2(Fe++,Mn)(PO4)2.2H2O A
TALMESSITE Ca2Mg(AsO4)2.2H2O A
ROSELITEBETA Ca2Co(AsO4)2.2H2O A
PARABRANDTITE Ca2Mn++(AsO4).2H2O A
COLLINSITE Ca2(Mg,Fe++)(PO4)2.2H2O A
FAIRFIELDITE Ca2(Mn,Fe++)(PO4)2.2H2O A
CASSIDYITE Ca2(Ni,Mg)(PO4)2.2H2O A
GAITITE Ca2Zn(AsO4)2.2H2O A
HILLITE Ca2(Zn,Mg)(PO4)2.2H2O A
BRANDTITE Ca2(Mn++,Mg)(AsO4)2.2H2O M
ROSELITE Ca2(Co++,Mg)(AsO4)2.2H2O M
RRUFFITE Ca2Cu(AsO4)2.2H2O M
WENDWILSONITE Ca2(Mg,Co)(AsO4)2.2H2O M
ZINCROSELITE Ca2Zn(AsO4)2.2H2O M
MAWBYITE Pb(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
TSUMCORITE Pb(Zn,Fe+++)2(AsO4)2(OH,H2O)2 M
THOMETZEKITE Pb(Cu,Zn)2(AsO4)2(OH,H2O)2 M/A (?)
SCHNEEBERGITE (Bi+++,Ca)(Co,Ni,Fe+++)2(AsO4)2[(H2O)(OH)] M
NICKELSCHNEEBERGITE (Bi+++,Ca)(Ni,Co,Fe+++)2(AsO4)2[(H2O)(OH)] M
MOUNANAITE PbFe+++2(VO4)2(OH,H2O)2 M
LOTHARMEYERITE Ca(Mn+++,Zn)2(AsO4)2(OH,H2O)2 M
KRETTNICHITE PbMn+++2(VO4)2(OH)2 M
FERRILOTHARMEYERITE Ca(Fe+++,Zn)2(AsO4)2(OH,H2O)2 M
COBALTTSUMCORITE Pb(Co,Fe+++,Ni)2(AsO4)2(H2O,OH)2 M
COBALTLOTHARMEYERITE Ca(Co,Fe+++,Ni)2(AsO4)2(OH,H2O)2 M
CABALZARITE Ca(Mg,Al,Fe+++)2(AsO4)2(H2O,OH)2 M
MANGANLOTHARMEYERITE Ca(Mn+++,[],Mg)2{AsO4,[AsO2(OH)2]}2(OH,H2O)2 M
NICKELLOTHARMEYERITE (Ca,Bi+++)(Ni,Fe+++,Co)2(AsO4)2(H2O,OH)2 M
GARTRELLITE PbCu(Fe,Cu)(AsO4)2(OH,H2O)2 A
ZINCGARTRELLITE Pb(Zn,Fe+++,Cu)2(AsO4)2(H2O,OH)2 A
RAPPOLDITE Pb(Co,Ni,Zn)2(AsO4)2.2H2O A ps M
PHOSPHOGARTRELLITE PbCuFe+++(PO4)2(OH,H2O)2 A
HELMUTWINKLERITE Pb(Zn,Cu)2(AsO4)2(OH,H2O)2 A
LUKRAHNITE Ca(Cu,Zn)(Fe+++,Zn)(AsO4)2.2(H2O,OH) A
POTTSITE (Pb3Bi)Bi(VO4)4.H2O. Q
NICKELTALMESSITE Ca2(Ni,Mg)(AsO4)2.2H2O A
YANCOWINNAITE PbCuAl(AsO4)2OH.H2O A
KALIOCHALCITE KCu2(SO4)2[(OH)(H2O)] M
NICKELTSUMCORITE Pb(Ni,Fe+++)2(AsO4)2(H2O,OH)2 M
DONDOELLITE Ca2Fe(PO4)2.2H2O A
NEOMESSELITE    
DOBSINAITE Ca2Ca(AsO4)2.2H2O M
With large and medium-sized cations, RO4:H2O < 1:1
WALENTAITE Fe+++3(P0,84As0,16O4)2(O,OH)6As+++2,56Ca0,42Na0,28Mn++0,35Fe++0,30O6,1(OH)0,9(H2O)5,2 O
ANAPAITE Ca2Fe++(PO4)2.4H2O A
PICROPHARMACOLITE H2Ca4Mg(AsO4)4.11H2O A
DITTMARITE (NH4)Mg(PO4).H2O O
NIAHITE (NH4)(Mn++,Mg,Ca)PO4.H2O O
FRANCOANELLITE H6(K,Na)3(Al,Fe+++)5(PO4)8.13H2O R
TARANAKITE K3Al5[PO3(OH)]6(PO4)2.18H2O R
SCHERTELITE (NH4)2MgH2(PO4)2.4H2O O
HANNAYITE (NH4)2Mg3H4(PO4)4.8H2O A
STRUVITE (NH4)MgPO4.6H2O O
STRUVITE-(K) KMgPO4.6H2O O
HAZENITE KNaMg2(PO4)2.14H2O O
RIMKOROLGITE (Mg,Mn)5(Ba,Sr,Ca)(PO4)4.8H2O M ps H
BAKHCHISARAITSEVITE Na2Mg5(PO4)4.7H2O M
FAHLEITE Zn5CaFe+++2(AsO4)6.14H2O O
SMOLYANINOVITE (Co,Ni,Mg,Ca)3(Fe+++,Al)2(AsO4)4.11H2O O
BARAHONAITE-(Fe) (Ca,Cu,Na,Fe+++,Al)6Fe+++(AsO4)4.6(H2O,OH,Cl) M
BARAHONAITE-(Al) (Ca,Cu,Na,Al)6Al(AsO4)4.6-6,5(H2O,OH) M
NATROWALENTAITE [Fe+++0,5Na0,5(H2O)6][NaAs+++2(Fe+++2,33W++++++0,67)(PO4)2O7] O
HALILSARPITE [Mg(H2O)6][CaAs+++2(Fe+++2,67Mo++++++0,33)(AsO4)2O7] O
With only large cations
STERCORITE H(NH4)Na(PO4).4H2O A
SWAKNOITE (NH4)2Ca(HPO4)2.H2O O
MUNDRABILLAITE (NH4)2Ca(HPO4)2.H2O M
NABAPHITE NaBaPO4.9H2O C
NASTROPHITE Na(Sr,Ba)(PO4).9H2O C
HAIDINGERITE CaHAsO4.H2O O
VLADIMIRITE Ca4(AsO4)2(AsO3OH).4H2O M
FERRARISITE Ca5H2(AsO4)4.9H2O A
MACHATSCHKIITE (Ca,Na)6(As+++++O4)(As+++++O3OH)3(PO4,SO4).15H2O R
PHAUNOUXITE Ca3(AsO4).11H2O A
RAUENTHALITE Ca3(AsO4)2.10H2O M/A
RHABDOPHANE-(La) (La,Ce)PO4.H2O H
RHABDOPHANE-(Nd) (Nd,Ce,La)PO4.H2O H
SMIRNOVSKITE (Th,Ca)(PO4).nH2O H
BROCKITE (Ca,Th,Ce)(PO4).H2O H
TRISTRAMITE (Ca,U++++,Fe+++)(PO4,SO4).2H2O H
GRAYITE (Th,Pb,Ca)PO4.H2O ps H
RHABDOPHANE-(Ce) (Ce,La)PO4.H2O H
PHARMACOLITE CaHAsO4.2H2O M
CHURCHITE-(Y) YPO4.2H2O M
ARDEALITE Ca2(SO4)(HPO4).4H2O M
BRUSHITE CaHPO4.2H2O M
MCNEARITE NaCa5H4(AsO4)5.4H2O A
DORFMANITE Na2HPO4.2H2O O
BARIOSINCOSITE (Ba,Sr)(V++++OPO4)2.4H2O Q
SINCOSITE CaV++++2(PO4)2(OH)4.3H2O Q
CATALANOITE Na2PO3(OH).8H2O O
GUERINITE Ca5H2(AsO4)4.9H2O M
NINGYOITE (U,Ca,Ce)2(PO4)2.1-2H2O O ps H
AIRDITE Sr(V++++O)2(PO4)2.4H2O M
CAESIUMPHARMACOSIDERITE CsFe4[(AsO4)3(OH)4].4H2O C
JEANKEMPITE Ca5(AsO4)2(AsO3OH)2(H2O)7 A
RHABDOPHANE-(Y) (Y,La,Nd)PO4.H2O H
Phosphates, etc. with additional anions, with H2O
MEJILLONESITE NaMg2(PO3OH)(PO4)(OH).H5O2 O
With small (and occasionally larger) cations
BEARSITE Be2(AsO4)(OH).4H2O M
MORAESITE Be2(PO4)(OH).4H2O M
ROSCHERITE Ca2Be4(Mn,Fe++)5(PO4)6(OH)4.6H2O M/A
RUIFRANCOITE Ca2([],Mn)2(Fe+++,Mn,Mg)4Be4(PO4)6(OH)6.4H2O M
GUIMARAESITE Ca2(Zn,Mg,Fe++)5Be4(PO4)6(OH)4.6H2O M
GREIFENSTEINITE Ca2Be4(Fe++,Mn)5(PO4)6(OH)4.6(H2O) M
FOOTEMINEITE Ca2Be4(Mn++,Fe++)5(PO4)6(OH)4.6H2O A
ATENCIOITE Ca2Mg2Fe++2-3Be4(PO4)6(OH)4.6H2O A
ZANAZZIITE Ca2Be4(Mg,Fe++)5(PO4)6(OH)4.6(H2O) M
URALOLITE Ca2Be4(PO4)3(OH)3.5H2O M
WEINEBENEITE Ca[Be3(PO4)2(OH)2].4H2O M
TIPTOPITE [(Li,Na,Ca,[])6](OH)2(H2O)(K2)(Be6P6O24) H
VESZELYITE (Cu,Zn)3(PO4)(OH)3.2H2O M
KIPUSHITE (Cu,Zn)5Zn(PO4)2(OH)6.H2O M
PHILIPSBURGITE Cu5Zn(AsO4)(PO4)(OH)6.H2O M
SPENCERITE Zn4(PO4)2(OH)2.3H2O M
GLUCINE CaBe4(PO4)2(OH)4.0,5H2O (?)
IANBRUCEITE [Zn2(OH)(H2O)(AsO4)](H2O)2 M
OKRUSCHITE Ca2Mn++5Be4(AsO4)6(OH)4.6H2O M
GOLDHILLITE Cu5Zn(AsO4)2(OH)6.H2O M
With only medium-sized cations, (OH, etc.):RO4< 1:1
DESTINEZITE Fe+++2(PO4)(SO4)(OH).6H2O A
DIADOCHITE Fe+++2(PO4)(SO4)(OH).5H2O A
PITTICITE Hydrous ferric arsenate sulfate am.
VASHEGYITE Al11(PO4)9(OH)6.38H2O or Al6(PO4)5(OH)3.23H2O O
SCHOONERITE [ZnMnFe++2Fe+++(PO4)3(OH)2(H2O)7].2H2O O
SINKANKASITE H2MnAl(PO4)2(OH).6H2O A
MITRYAEVAITE Al11(PO4,SO3OH)10F3.30H2O A
SANJUANITE Al2(PO4)(SO4)(OH).9H2O M (?)
SARMIENTITE Fe+++2(AsO4)(SO4)(OH).5H2O M
BUKOVSKYITE Fe+++2(AsO4)(SO4)(OH).7H2O M
ZYKAITE Fe+++4(AsO4)3(SO4)(OH).15H2O O
GINIITE Fe++Fe+++4(PO4)4(OH)2.2H2O M
SASAITE (Al,Fe+++)6[(PO4),(SO4)]5(OH)3.35-36H2O O
MCAUSLANITE HFe++3Al2(PO4)4F.18H2O A
GOLDQUARRYITE CuCd2Al3(PO4)4F2.12H2O A
BIRCHITE CdCu2(SO4)(PO4)2.5H2O O
BRAITHWAITEITE NaCu++5(Sb+++++Ti4++++)O2(AsO4)4(AsO3OH)2(H2O)8 A
SCHMIDITE [Zn2(Fe+++,Mn++)2Fe+++(PO4)3(OH)3(H2O)6].2H2O  
WILDENAUERITE Zn(Fe+++,Mn++)2MnFe+++(PO4)3(OH)3(H2O)6.2H2O O
WILHELMGUMBELITE [ZnFe++Fe+++3(PO4)3(OH)4(H2O)5].2H2O O
ARANGASITE Al2(PO4)(SO4)F.7,5?2O M
With only medium-sized cations, (OH, etc.):RO4 = 1:1 and < 2:1
NISSONITE Cu2Mg2(PO4)2(OH)2.5H2O M
EUCHROITE Cu2(AsO4)(OH).3H2O O
LEGRANDITE Zn2(AsO4)(OH).H2O M
STRASHIMIRITE Cu8(AsO4)4(OH)4.5H2O M
WHITMOREITE Fe++Fe+++2(PO4)2(OH)2.4H2O M
ARTHURITE Cu++Fe+++2(AsO4,PO4,SO4)2(O,OH)2.4H2O M
BENDADAITE Fe++Fe+++2(AsO4)2(OH)2.4H2O M
COBALTARTHURITE (Co++,Mg)Fe+++2(AsO4)2(OH)2.4H2O M
EARLSHANNONITE (Mn++,Fe++)Fe+++2(PO4)2(OH)2.4H2O M
KUNATITE CuFe+++2(PO4)2(OH)2.4H2O M
OJUELAITE ZnFe+++2(AsO4)2(OH)2.4H2O M
KLEEMANITE ZnAl2(PO4)2(OH)2.3H2O M
CORALLOITE Mn++Mn+++2(AsO4)2(OH)2.4H2O M
BERMANITE Mn++Mn+++2(PO4)2(OH)2.4H2O M
KOVDORSKITE Mg2(PO4)(OH).3H2O M
FERRISTRUNZITE Fe+++Fe+++2(PO4)2(OH)3.5H2O A
FERROSTRUNZITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
METAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O M
METAVIVIANITE Fe++Fe+++2(PO4)2(OH)2.6H2O A
STRUNZITE Mn++Fe+++2(PO4)2(OH)2.6H2O A ps M
BERAUNITE Fe+++6(PO4)4O(OH)4.6H2O M
PSEUDOLAUEITE Mn++Fe+++2(PO4)2(OH)2.7-8H2O M
USHKOVITE MgFe+++2(PO4)2(OH)2.8H2O A
SIGLOITE Fe+++Al2(PO4)2(OH)3.7H2O A
PARAVAUXITE Fe++Al2(PO4)2(OH)2.8H2O A
NORDGAUITE Mn++Al2(PO4)2(F,OH)2.5H2O A
MANGANGORDONITE (Mn++,Fe++)Al2(PO4)2(OH)2.8H2O A
LAUEITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
KASTNINGITE (Mn++,Fe++,Mg)Al2(PO4)2(OH)2.8H2O A
STEWARTITE Mn++Fe+++2(PO4)2(OH)2.8H2O A
GORDONITE MgAl2(PO4)2(OH)2.8H2O A
FERROLAUEITE Fe++Fe+++2(PO4)2(OH)2.8H2O A
MAGHREBITE MgAl2(AsO4)2(OH)2.8H2O A
TINTICITE Fe+++11(PO4,VO4)8(OH)8.13H2O A
VAUXITE Fe++Al2(PO4)2(OH)2.6H2O A
VANTASSELITE Al4(PO4)3(OH)3.9H2O O
CACOXENITE (Fe+++,Al)25(PO4)17O6(OH)12.75H2O H
GORMANITE Fe++3Al4(PO4)4(OH)6.2H2O A
SOUZALITE (Mg,Fe++)3(Al,Fe+++)4(PO4)4(OH)6.2H2O M
KINGITE Al3(PO4)2(OH,F)3.9H2O A
ALLANPRINGITE Fe+++3(PO4)2(OH).5H2O M
WAVELLITE Al3(PO4)2(OH,F)3.5H2O O
KRIBERGITE Al5(PO4)3(SO4)(OH)4.4H2O A
MAPIMITE Zn2Fe+++3(AsO4)3(OH)4.10H2O M
OGDENSBURGITE Ca2(Zn,Mn)Fe+++4(AsO4)4(OH)6.6H2O O ps H
NEVADAITE (Cu++,Al,V+++)2-3Al4(PO4)4(OH)F4.11H2O M
CLONCURRYITE Cu0,5Al2(VO)0,5(PO4)2(F,OH)2.5H2O M
ZINCOBERAUNITE ZnFe+++5(PO4)4(OH)5.6H2O O
ZINCOSTRUNZITE ZnFe+++2(PO4)2(OH)2.6,5H2O A
TVRDYITE Fe++Fe+++2Al3(PO4)4(OH)5(H2O)4.2H2O M
FLUORWAVELLITE Al3(PO4)2(F,OH)3.5H2O O
CESARFERREIRAITE Fe++Fe+++2(AsO4)2(OH)2.8H2O A
KUMMERITE Mn++Fe+++Al(PO4)2(OH)2.8H2O A
MAGNESIOBERMANITE MgMn+++2(PO4)2(OH)2.4H2O M
FERROBERAUNITE Fe++Fe+++5(PO4)4(OH)5.6H2O M
With only medium-sized cations, (OH, etc.):RO4= 2:1
CHENEVIXITE Cu2Fe+++2(AsO4)2(OH)4 M
LUETHEITE Cu2Al2(AsO4)2(OH)4 M
AKROCHORDITE Mn++4Mg(AsO4)2(OH)4.4H2O M
GUANACOITE Cu2(Mg,Cu)Mg2(AsO4)2(OH)4.4H2O M
TURQUOISE Cu++(Al,Fe+++)6(PO4)4(OH)8.4H2O A
PLANERITE Al6(PO4)2(PO3OH)2(OH)8.4H2O A
AFMITE Al3(OH)4(H2O)3(PO4)(PO3OH)H2O A
AHEYLITE (Fe++,Zn)Al6(PO4)4(OH)8.4H2O A
CHALCOSIDERITE Cu++(Fe+++,Al)6(PO4)4(OH)8.4H2O A
FAUSTITE (Zn,Cu++)Al6(PO4)4(OH)8.4H2O A
ERNSTITE (Mn++1-xFe+++x)Al(PO4)(OH)2-xOx M
CHILDRENITE Fe++Al(PO4)(OH)2.H2O M
EOSPHORITE MnAl(PO4)(OH)2.H2O M
PENBERTHYCROFTITE [Al6(AsO4)3(OH)9(H2O)5].8H2O M
GALEACLOLUSITE Al6(AsO4)3(OH)9(H2O)4.8H2O O
BETTERTONITE Al6(AsO4)3(OH)9.16H2O M
With only medium-sized cations, (OH, etc.):RO4 = 3:1
SENEGALITE Al2(PO4)(OH)3.H2O O
FLUELLITE Al2(PO4)F2(OH).7H2O O
BULACHITE Al6(AsO4)3(OH)9(H2O)4.2H2O O
ZAPATALITE Cu3Al4(PO4)3(OH)9.4H2O Q
CERULEITE CuAl4[AsO4]2(OH)8(H2O)4 M
ALDERMANITE [Mg(H2O)6][Na(H2O)2Al3(PO4)2(OH,F)6].H2O O
JUANITAITE (Cu,Ca,Fe++)10Bi(AsO4)4(OH)11.H2O Q
IANGREYITE Ca2Al7(PO4)2(PO3OH)2(OH,F)15.8H2O R
With only medium-sized cations, (OH,etc.):RO4 > 3:1
HOTSONITE Al5(PO4)(SO4)(OH)10.8H2O A
ROSIERESITE [Pb,Cu,Al,(PO4),H2O] (?) am.
BOLIVARITE Al2(PO4)(OH)34H2O amorphous
EVANSITE Al3(PO4)(OH)6.6H2O am.
LISKEARDITE [(Al,Fe)32(AsO4)18(OH)42(H2O)22].52H2O O (?)
RUSAKOVITE (Fe+++,Al)5(VO4,PO4)2(OH)9.3H2O (?)
LIROCONITE Cu2Al(AsO4)(OH)4.4H2O M
SIELECKIITE Cu3Al4(PO4)2(OH)12.2H2O A
CHALCOPHYLLITE Cu++18Al2(AsO4)3(SO4)3(OH)27.33H2O R
TIBERIOBARDIITE {Cu9Al[SiO3(OH)]2(OH)12(H2O)6}(SO4)1,5.10H2O R
PARNAUITE Cu9(AsO4)2(SO4)(OH)10.7H2O O
GLADIUSITE (Fe++,Mg)4Fe+++2(PO4)(OH)11.H2O M ps O
KERNOWITE Cu2Fe+++(AsO4)(OH)4.4H2O M
With large and medium-sized cations, (OH, etc.):RO4< 0.5:1
ZDENEKITE Na(Pb,Ca)Cu++5(AsO4)4Cl.5H2O Q
SHUBNIKOVITE Ca2Cu++8(AsO4)6Cl(OH).7H2O O (?)
SAMPLEITE NaCaCu5(PO4)4Cl.5H2O O
LAVENDULAN NaCaCu5(AsO4)4Cl.5H2O O
LEMANSKIITE NaCaCu5(AsO4)4Cl.5H2O Q
With large and medium-sized cations, (OH, etc.):RO4 < 1:1
MINYULITE KAl2(PO4)2F.4H2O O
SPHENISCIDITE (NH4,K)(Fe+++,Al)2(PO4)2(OH).2H2O M
TINSLEYITE KAl2(PO4)2(OH).2H2O M
LEUCOPHOSPHITE KFe+++2(PO4)2(OH).2H2O M
KALUGINITE (Mn++,Ca)MgFe+++(PO4)2(OH).4H2O O
WHITEITE-(CaMnMn) CaMnMn2Al2[PO4]4(OH)2.8H2O M
WHITEITE-(MnMnMg) Mn++Mn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(MnFeMg) (Mn++,Ca)(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMnMg) CaMn++Mg2Al2(PO4)4(OH)2.8H2O M
WHITEITE-(CaFeMg) Ca(Fe++,Mn++)Mg2Al2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaFeFe) {Ca}{Fe++}{Fe++2}{Fe+++2}(PO4)4(OH)2.8H2O M
KECKITE CaMn(Fe+++,Mn)2Fe+++2(PO4)4(OH)3.7H2O M
JAHNSITE-(NaMnMg) {(Na,Ca)}{(Mn++,Fe+++)}{(Mg,Fe+++)2}{Fe+++2}(PO4)4(OH)2.8H2O M
JAHNSITE-(NaFeMg) NaMg2Fe+++3(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMn) (Mn++,Ca)Mn++(Mn++,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMn) CaMn++Mn++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnMg) CaMn++(Mg,Fe++)2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnFe) CaMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
WHITEITE-(CaMgMg) CaMg3Al2(PO4)4(OH)2.8H2O M
RITTMANNITE (Mn++,Ca)Mn++(Fe++,Mn++)2(Al,Fe+++)2(PO4)4(OH)2.8H2O M
WHITEITE-(MnMnMn) Mn++Mn++Mn++2Al2(PO4)4(OH)2.8H2O M
MANGANOSEGELERITE (Mn++,Ca)(Mn++,Fe++,Mg)Fe+++(PO4)2(OH).4H2O O
SEGELERITE CaMgFe+++(PO4)2(OH).4H2O O
OVERITE CaMgAl(PO4)2(OH).4H2O O
WILHELMVIERLINGITE CaMn++Fe+++(PO4)2(OH).2H2O O
JUONNIITE CaMgSc(PO4)2(OH).4H2O O
CALCIOFERRITE Ca4Fe++(Fe+++,Al)4(PO4)6(OH)4.13H2O M
KINGSMOUNTITE Ca3MnFeAl4(PO4)6(OH)4.12H2O M
MONTGOMERYITE Ca4MgAl4(PO4)6(OH)4.12H2O M
ZODACITE Ca4Mn++Fe+++4(PO4)6(OH)4.12H2O M
ROBERTSITE Ca6Mn+++9(PO4)9O6(H2O)6.3H2O M
SAILAUFITE NaCaMn+++3O2(AsO4)2(CO3).3H2O M
PARAROBERTSITE Ca2Mn+++3(PO4)3O2.3H2O M
MITRIDATITE Ca2Fe+++3(PO4)3O2.3H2O M
KOLFANITE Ca2Fe+++3O2(AsO4)3.2H2O M
ARSENIOSIDERITE Ca2Fe+++3(AsO4)3O2.3H2O M
MANTIENNEITE (H2O,K)2(Mg,Fe++)2(Al,Fe+++)2Ti(PO4)4(O,F)2.14H2O O
PAULKERRITE (H2O,K)2(Mg,Mn++)2(Fe+++,Al)2Ti(PO4)4(O,F)2.14H2O O
BENYACARITE (H2O,K)2(Mn++,Fe++)2(Fe+++,Ti)2Ti(PO4)4(O,F)2.14H2O O
XANTHOXENITE Ca4Fe+++2(PO4)4(OH)2.3H2O A
MAHNERTITE (Na,Ca,K)Cu++3(AsO4)2Cl.5H2O Q
ANDYROBERTSITE KCdCu5(AsO4)4[As(OH)2O2].2(H2O) M
CALCIOANDYROBERTSITE KCaCu5(AsO4)4[As(OH)2O2].2(H2O) M
ENGLISHITE K3Na2Ca10Al15(PO4)21(OH)7.26H2O O
BOUAZZERITE Mg5,5Bi3Fe+++7(AsO4)9O6(OH)2.43H2O M
AMMONIOTINSLEYITE (NH4)Al2(PO4)2(OH),2H2O M
FANFANIITE Ca4MnAl4(PO4)6(OH)4.12H2O M
JAHNSITE-(CaFeMg) CaFe++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(CaMnZn) CaMn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe) Mn++Mn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnFe++) MnMn++Fe++2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnMg) Mn++Mn++Mg2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(MnMnZn) Mn++Mn++Zn2Fe+++2(PO4)4(OH)2.8H2O M
JAHNSITE-(NaMnMn) NaMn++Mn++Fe+++Fe+++2(PO4)4(OH)2.8H2O M
LUNOKITE (Mn++,Ca)(Mg,Fe++,Mn++)Al(PO4)2(OH).4H2O O
With large and medium-sized cations, (OH, etc.):RO4 = 1:1
JOHNWALKITE K(Mn++,Fe+++,Fe++)2(Nb,Ta)(PO4)2O2(H2O,OH)2 O
OLMSTEADITE KFe++2(Nb,Ta)(PO4)2O2.2H2O O
GATUMBAITE CaAl2(PO4)2(OH)2.H2O M
CAMGASITE CaMg(AsO4)(OH).5H2O M
MEURIGITE-K KFe+++8(PO4)6(OH)7.6,5H2O M
MEURIGITE-Na Na(Fe+++,Al)8(PO4)6(OH)7.6,5H2O M
PHOSPHOFIBRITE [K0,5(H2O)3][(Fe+++,Cu)8(PO4)6(OH)7(H2O)4] M
JUNGITE Ca2Zn4Fe+++8(PO4)9(OH)9.16H2O O
WYCHEPROOFITE NaAlZr(PO4)2(OH)2.H2O A
ERCITITE Na(Mn+++,Fe+++)(PO4)(OH).2H2O M
MRAZEKITE Bi+++2Cu++3(PO4)2O2(OH)2.2H2O M
ATTIKAITE Ca3Cu2Al(AsO4)2(OH)2.2H2O O
With large and medium-sized cations, (OH, etc.):RO4 > 1:1 and < 2:1
PHARMACOSIDERITE KFe+++4(AsO4)3(OH)4.6-7H2O C/Q
BARIOPHARMACOSIDERITE BaFe+++4(AsO4)3(OH)5.5H2O Q ps C
HYDRONIUMPHARMACOSIDERITE (H3O,K)(Fe+++,Al)4(AsO4)3(OH)4.4H2O C
NATROPHARMACOSIDERITE (Na,K)2Fe+++4(AsO4)3(OH)5.7H2O Q ps C
PHARMACOALUMITE KAl4(AsO4)3(OH)4.6,5H2O C
BARIOPHARMACOALUMITE Ba0,5Al4(AsO4)3(OH)4.4H2O C
NATROPHARMACOALUMITE (Na,K,H3O)Al4(AsO4)3(OH)4.4H2O C
BURANGAITE (Na,Ca)2(Fe++,Mg)2Al10(PO4)8(OH,O)12.4H2O M
DUFRENITE Fe++Fe+++4(PO4)3(OH)5.2H2O M
GAYITE NaMn++Fe+++5(PO4)4(OH)6.2H2O M
MATIOLIITE Na(Mg,Fe++)Al5(PO4)4(OH)6.2H2O M
NATRODUFRENITE Na(Fe+++,Fe++)(Fe+++,Al)5(PO4)4(OH)6.2H2O M
KIDWELLITE NaFe+++9(PO4)6(OH)10.5H2O M
BLEASDALEITE (Ca,Fe+++)2Cu5(Bi+++,Cu++)(PO4)4(H2O,OH,Cl)13 M ps Q
MATULAITE Fe+++Al7(PO4)4(PO3OH)2(OH)8(H2O)8.8H2O M
KRASNOVITE Ba(Al,Mg)(PO4,CO3)(OH)2.H2O O
RICHELSDORFITE Ca2Cu5Sb(AsO4)4Cl(OH)6.6H2O M
BIMBOWRIEITE NaMgFe+++5(PO4)4(OH)6.2H2O M
BARIUMZINCALUMOPHARMACOSIDERITE (Ba,K)0,5(Zn,Cu)0,5(Al,Fe)4(AsO4)3(OH)5.5H2O Q
HYDRONIUMPHARMACOALUMITE (H3O)Al4(AsO4)3(OH)4.4,5H2O C
PLUMBOPHARMACOSIDERITE Pb0,5Fe+++4(AsO4)3(OH)4.5H2O C
STRONTIOPHARMACOSIDERITE Sr0,5Fe4[(AsO4)3(OH)4].4H2O C
THALLIUMPHARMACOSIDERITE TlFe4[(AsO4)3(OH)4].4H2O  
With large and medium-sized cations, (OH, etc.):RO4 = 2:1
FOGGITE CaAl(PO4)(OH)2.H2O O
CYRILOVITE NaFe+++3(PO4)2(OH)4.2H2O Q
MILLISITE (Na,K)CaAl6(PO4)4(OH)9.3H2O Q
WARDITE NaAl3(PO4)2(OH)4.2H2O Q
AGARDITE-(Y) (Y,Ca)Cu6(AsO4)3(OH)6.3H2O H
ZALESIITE CaCu++6(AsO4)2(AsO3OH)(OH)6.3H2O H
PLUMBOAGARDITE (Pb,REE,Ca)Cu6(AsO4)3(OH)6.3H2O H
PETERSITE-(Y) (Y,Ce,Nd,Ca)Cu++6(PO4)3(OH)6.3H2O H
MIXITE BiCu++6(AsO4)3(OH)6.3H2O H
CALCIOPETERSITE CaCu6[(PO4)2(PO3OH)](OH)6.3H2O H
AGARDITE-(Nd) (Nd,La,Y)Cu6(AsO4)3(OH)6.3H2O H
AGARDITE-(La) LaCu++6(AsO4)3(OH)6.3H2O H
AGARDITE-(Ce) (Ce,Ca,La)Cu6(AsO4)3(OH)6.3H2O H
GOUDEYITE (Al,Y)Cu6(AsO4)3(OH)6.3H2O H
WALLKILLDELLITE Ca4Mn++6As+++++4O16(OH)8.18H2O H
KUKSITE (Pb,Ca)3Zn3Te++++++O6(PO4,VO4)2 O
CHEREMNYKHITE Zn3Pb3Te++++O6(VO4,AsO4)2 O
DUGGANITE Pb3Zn3Te(As,V,Si)2(O,OH)14 H
WALLKILLDELLITE-Fe (Ca,Cu)4Fe6[(As,Si)O4]4(OH)8.18H2O H
ANGASTONITE CaMgAl2(PO4)2(OH)2.7H2O A
FLUOROWARDITE NaAl3(PO4)2F2(OH)2.2H2O Q
PETERSITE-(Ce) Cu6Ce(PO4)3(OH)6.3H2O H
PETERSITE-(La) Cu6La(PO4)3(OH)6.3H2O H
PETERSITE-(Nd)    
With large and medium-sized cations, (OH, etc.):RO4 > 2:1
MORINITE NaCa2Al2(PO4)2(F,OH)5.2H2O M
ESPERANZAITE NaCa2Al2(As+++++O4)2F4(OH).H2O M
TYROLITE CaCu5(AsO4)2(CO3)(OH)4.6H2O O
BETPAKDALITE-CaCa MgCa2Fe+++3(Mo++++++8O28)(AsO4)2(OH).23H2O M
BETPAKDALITE-NaCa (Na,Ca)3Fe+++2(As2O4)(MoO4)6.15H2O M
MELKOVITE CaFe+++H6(MoO4)4(PO4).6H2O M
PHOSPHOVANADYLITE-Ca Ca[V++++4P2O10(OH)6].12H2O C
PHOSPHOVANADYLITE-Ba (Ba,Ca,K,Na)0,66[P2(V++++,Al)4(O,OH)16].12H2O C
YUKONITE Ca3Fe+++(AsO4)2(OH)3.5H2O am.
UDUMINELITE Ca3Al8(PO4)2O12.2H2O  
DELVAUXITE CaFe+++4(PO4,SO4)2(OH)8.4-6H2O (?) am.
SANTAFEITE (Na,Ca,Sr)3(Mn++,Fe+++)2Mn++++2(VO4)4(OH,O)5.2H2O O
BETPAKDALITE-CaMg [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe+++3O36(OH)] M
MENDOZAVILITE-KCa [K2(H2O)15Ca(H2O)6][Mo8P2Fe+++3O34(OH)3] M
BETPAKDALITE-FeFe [Fe+++2(H2O)15(OH)2Fe+++(H2O)6][Mo8As2Fe+++3O37] M
With only large cations
NATROPHOSPHATE Na7(PO4)2F.19H2O C
ISOCLASITE Ca2(PO4)(OH).2H2O M
LERMONTOVITE U++++(PO4)(OH).H2O O
VYACHESLAVITE U++++(PO4)(OH).2.5H2O O
With CO3, SO4, SiO4
GIRVASITE NaCa2Mg3(PO4)3(CO3)(H2O)6 M
VOGGITE Na2Zr(PO4)(CO3)(OH).2H2O M
PEISLEYITE Na3Al16(SO4)2(PO4)10(OH)17.20H2O M
KRASNOITE Ca3Al7,7Si3P4O23,5(OH)12,1F2.8H2O R ps H
PERHAMITE (Ca,Sr)3Al7,7Si3P4O23,5(OH)14,1.8H2O R ps H
SARYARKITE-(Y) Ca(Y,Th)Al5(SiO4)2(PO4,SO4)2(OH)7.6H2O H
MICHEELSENITE (Ca,Y)3Al(PO3OH,CO3)(CO3)(OH)6.12H2O H
MICHEELSENITE (Ca2Y)Al(PO3OH)(CO3)(OH)6.12H2O H
PARWANITE (Na,K)(Mg,Ca)4Al8(CO3)(PO4)8(OH)7.30H2O M ps H
SKORPIONITE Ca3Zn2(CO3)(PO4)2(OH)2.H2O M
Uranyl phosphates and arsenates
DYMKOVITE (Ni,Mg)(UO2)2(As+++O3).7H2O M
UO2:RO4 = 1:2
WALPURGITE Bi4(UO2)(AsO4)2O4.2H2O A
ORTHOWALPURGITE (UO2)Bi4O4(AsO4)2.2H2O O
PHOSPHOWALPURGITE Bi4(UO2)(PO4,AsO4)2O4.2H2O A
HALLIMONDITE Pb2(UO2)(AsO4)2 A
PARSONSITE Pb2(UO2)(PO4)2.2H2O A
ULRICHITE CaCu++(UO2)(PO4)2.4H2O M
LAKEBOGAITE NaCa(Fe+++,Al)2H(UO2)2(PO4)4(OH)2.8H2O M
UO2:RO4 = 1:1
SALEEITE Mg(UO2)2(PO4)2.10H2O M ps Q
URANOCIRCITE Ba[(UO2)(PO4)]2(H2O)10 O
URANOSPINITE Ca[(UO2)(AsO4)]2(H2O)11 O
ZEUNERITE Cu++(UO2)2(AsO4)2.10-16H2O Q
TORBERNITE Cu++(UO2)2(PO4)2.8-12H2O Q
NOVACEKITE I Mg(UO2)2(AsO4)2.10-12H2O Q
METARAUCHITE (Ni,Co)(UO2)2(AsO4)2.8H2O A
KAHLERITE Fe++(UO2)2(AsO4)2.10-12H2O Q
HEINRICHITE Ba[(UO2)(AsO4)]2(H2O)10 M
AUTUNITE Ca(UO2)2(PO4)2.10-12H2O Q
XIANGJIANGITE (Fe+++,Al)(UO2)4(PO4)2(SO4)2(OH).22H2O Q
RAUCHITE (Ni,Mg)(UO2)2(AsO4)2.10H2O A
METAURANOCIRCITE II Ba[(UO2)(PO4)]2(H2O)7 M
PRZHEVALSKITE (H3O)(UO2)(AsO4).3H2O Q (?)
PRZHEVALSKITE Pb(UO2)2(PO4)2.4H2O O
METAURANOSPINITE Ca(UO2)2(AsO4)2.8H2O Q
METAURANOCIRCITE I Ba(UO2)2(PO4)2.6-8H2O Q
METATORBERNITE Cu++(UO2)2(PO4)2.8H2O Q
METASALEEITE Mg(UO2)2(PO4)2.8H2O Q
BASSETITE Fe++(UO2)2(PO4)2.8H2O M
METAKIRCHHEIMERITE Co(UO2)2(AsO4)2.8H2O Q (?)
METAKAHLERITE Fe++(UO2)2(AsO4)2.8H2O Q
METAHEINRICHITE Ba[(UO2)(AsO4)]2(H2O)7 M
METAAUTUNITE Ca(UO2)2(PO4)2.2-6H2O Q
LEHNERITE Mn++U++++++(PO4)2O.8H2O M
METAZEUNERITE Cu++(UO2)2(AsO4)2.8H2O Q
METANOVACEKITE Mg(UO2)2(AsO4)2.4-8H2O Q
URAMPHITE (NH4)(UO2)(PO4).3H2O O (?)
NATROURANOSPINITE (Na2,Ca)(UO2)2(AsO4)2.5H2O Q
METAANKOLEITE K2(UO2)2(PO4)2.6H2O Q
CHERNIKOVITE (H3O)2(UO2)2(PO4)2.6H2O Q
ABERNATHYITE K2(UO2)2(AsO4)2.8H2O Q
URAMARSITE (NH4,H3O)2(UO2)(AsO4,PO4)2.6H2O Q
TROGERITE (H3O)(UO2)(AsO4).3H2O Q
CHISTYAKOVAITE Al(UO2)2(AsO4)2(F,OH).6,5H2O M
THREADGOLDITE Al(UO2)2(PO4)2(OH).8H2O M
ARSENURANOSPATHITE HAl(UO2)4(AsO4)4.40H2O Q
URANOSPATHITE Al0,5-1(UO2)2(PO4)2F.20-21H2O O ps Q
VOCHTENITE (Fe++,Mg)Fe+++[(UO2)(PO4)]4(OH).12-13H2O M
COCONINOITE Fe+++2Al2(UO2)2(PO4)4(SO4)(OH)2.20H2O M (?)
RANUNCULITE HAl(UO2)PO4(OH)3.4H2O M ps O
TRIANGULITE Al3(UO2)4(PO4)4(OH)5.5H2O A
FURONGITE Al4[(UO2)4(PO4)6](OH)2(H2O)19,5H2O A
SABUGALITE H0,5Al0,5(UO2)2(PO4)2.8H2O M ps Q
METANATROAUTUNITE Na2(UO2)2(PO4)2.6-8H2O Q
NOVACEKITE II Mg(UO2)2(AsO4)2.10H2O Q
NOVACEKITE = See Novacekite I or Novacekite II Mg(UO2)2(AsO4)2.10-12H2O Q
UO2:RO4 = 3:2
FRANCOISITE-(Ce) (Ce,Nd,Ca)(UO2)3(PO4)2O(OH).6H2O M
FRANCOISITE-(Nd) (Nd,Y,Sm,Ce)(UO2)3(PO4)2O(OH).6H2O M
PHURALUMITE Al2[(UO2)3(PO4)2O(OH)](OH)3(H2O)9 M
UPALITE Al(UO2)3(PO4)2O(OH).7H2O M
ARSENURANYLITE Ca(UO2)4(AsO4)2(OH)4.6H2O O
YINGJIANGITE (K2,Ca)(UO2)7(PO4)4(OH)6.6H2O O
DEWINDTITE Pb3[H(UO2)3O2(PO4)2]2.12H2O O
PHOSPHURANYLITE KCa(H3O)3(UO2)7(PO4)4O4.8H2O O
DUMONTITE Pb2(UO2)3O2(PO4)2.5H2O M
HUGELITE Pb2(UO2)3(AsO4)2O2.5H2O M
ARSENOVANMEERSSCHEITE U++++++(UO2)3(AsO4,PO4)2(OH)2.4H2O O
METAVANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.2H2O O
VANMEERSSCHEITE U++++++(UO2)3(PO4)2(OH)6.4H2O O
ALTHUPITE ThAl(UO2)7(PO4)4(OH)5.15H2O A
MUNDITE Al(UO2)3(PO4)2(OH)3,5.5H2O O
PHURCALITE Ca2(UO2)3O2(PO4)2.7H2O O
BERGENITE Ba4Ca2(UO2)6(PO4)6O6.16H2O M
Unclassified
MOREAUITE Al3(UO2)(PO4)3(OH)2.13H2O M
ASSELBORNITE (BiO)3(Pb,Ba)(UO2)4(OH)7(AsO4)2.4H2O C
METALODEVITE Zn(UO2)2(AsO4)2.10H2O Q
SREINITE (BiO)3Pb(UO2)4(OH)7(PO4,AsO4)2.4H2O C
KAMITUGAITE PbAl(UO2)5[(P,As)O4]2(OH)9.9.5H2O A
Polyphosphates, Polyarsenates, [4]-Polyvanadates
Polyphosphates, etc., without OH and H2O; dimers of corner-sharing RO4 tetrahedra
BLOSSITE Cu2V+++++2O7 O
ZIESITE Cu2V+++++2O7 M
CHERVETITE Pb2V2O7 M
PETEWILLIAMSITE (Ni,Co)2(As2O7) M
Polyphosphates, etc., with OH only
Polyphosphates, etc., with H2O only
FIANELITE Mn++2V+++++(V+++++,As+++++)O7.2H2O M
CANAPHITE CaNa2P2O7.4H2O M
PINTADOITE Ca2V2O7.9H2O (?)
WOOLDRIDGEITE Na2CaCu++2(P2O7)2.10H2O O
KANONEROVITE Mn++Na3P3O10.12H2O M
HYLBROWNITE Na3MgP3O10.12H2O M ps O
RUDLINGERITE Mn++2V+++++As+++++O7.2H2O M
Polyphosphates, etc., with OH and H2O
MARTYITE (Zn,Co)3(V2O7)(OH)2.2H2O R ps H
VOLBORTHITE Cu++3V+++++2O7(OH)2.2H2O M
Ino-[4]-vanadates
ALVANITE ZnAl4(VO3)2(OH)12(H2O)2 M
ANKINOVICHITE (Ni,Zn)Al4(VO3)2(OH)12.2H2O M
Phosphates, etc. unclassified
RENARDITE Pb(UO2)4(PO4)2(OH)4.7H2O O
PHARMAZINCITE KZnAsO4 H
PHOXITE (NH4)2Mg2(C2O4)(PO3OH)2(H2O)4 M
PICAITE NaCa[AsO3OH][AsO2(OH)2] M
PICCOLIITE NaCaMn+++2(AsO4)2O(OH) O
PIECZKAITE Mn5(PO4)3Cl H
PLINIUSITE Ca5(VO4)3F H
POLYARSITE Na7CaMgCu2(AsO4)4F2Cl M
POPOVITE Cu5O2(AsO4)2 R
PRACHARITE CaSb+++++2(As+++2O5)2O2.10H2O R
RAMAZZOITE [Mg8Cu12(PO4)(CO3)4(OH)24(H2O)20][(H0,33SO4)3(H2O)36] C
PEATITE-(Y) Li4Na12(Y,Na,Ca,HREE)12(PO4)12(CO3)4(F,OH)8 O ps C
NIELSBOHRITE K(UO2)3(AsO4)(OH)4.H2O O
RAMIKITE-(Y) Li4Na12(Y,Ca,HREE)6Zr6(PO4)12(CO3)4O4(OH,F)4 A ps C
PUTTAPAITE Pb2Mn++2ZnCr+++4O2(AsO4)4(OH)6.12H2O M
MORASKOITE Na2Mg(PO4)F O
MANGANFLURLITE ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O ZnMn++3Fe+++(PO4)3(OH)2(H2O)7.2H2O M
MATYHITE Ca9(Ca0,5[]0,5)Fe++(PO4)7 R
MELANARSITE K3Cu7Fe+++O4(AsO4)4 M
MENGEITE Ba(Mg,Mn++)Mn+++4(PO4)4(OH)4.4H2O A
MICHALSKIITE Fe+++1,33Cu++2(MgFe+++)2(VO4)6 Fe+++1,33Cu++2(MgFe+++)2(VO4)6 O
MINJIANGITE Ba[Be2PeO8] H
OKIEITE Mg3[V10O28].28H2O A
MONTENEROITE Cu++Mn++2(AsO4)2.8H2O M
PARAFINIUKITE Ca2Mn3(PO4)3Cl H
NIASITE Ni++4,5(AsO4)3 Q
STEINMETZITE Zn2Fe+++(PO4)2(OH).3H2O A
NISHANBAEVITE KAl2O(AsO4)(SO4) O
RIOSECOITE Ca2Mg(AsO3OH)3(H2O)2 A
OZEROVAITE Na2KAl3(AsO4)4 O
PANSNERITE K3Na3(Fe+++,Al)6(AsO4)8 O
MOLINELLOITE Cu(H2O)(OH)V++++O(V+++++O4) A
YAROSHEVSKITE Cu9O2(VO4)4Cl2 A
VARGITE Cu2Mn3(AsO4)2(OH)4(H2O)4 M
VASILSEVERGINITE Cu9O4(AsO4)2(SO4)2 M
VYSOKYITE U++++[As+++++O2(OH)2]4.4H2O A
WHITECAPSITE H16Fe2++5Fe+++14Sb+++6(AsO4)18O16.120H2O H
WHITEROCKITE CaMgMn+++3O2(PO4)2(CO3)F.5H2O M
SMAMITE Ca2Sb(OH)4[H(AsO4)2].6H2O A
WRIGHTITE K2Al2O(AsO4)2 O
VANDERHEYDENITE Zn6(PO4)2(SO4)(OH)4.7H2O M
YURGENSONITE K2SnTiO2(AsO4)2 O
YURMARINITE Na7(Fe+++,Mg,Cu)4(AsO4)6 R
ZIMINAITE Fe+++6(VO4)6 A
ZUBKOVAITE Ca3Cu3(AsO4)4 M
MAGNESIOHATERTITE (Na,Ca)2Ca(Mg,Fe+++)2(AsO4)3 M
ENGELHAUPTITE KCu3(V2O7)(OH)2Cl H
WILANCOOKITE (Ba5Li2[])Ba6Be24P24O96.26H2O C
TANGDANITE Ca2Cu9(AsO4)4(SO4)0.5(OH)9.9H2O M
RUDABANYAITE (Ag2Hg2)(AsO4)Cl C
SHCHUROVSKYITE K2CaCu6O2(AsO4)4 M
SLAVKOVITE Cu13(AsO4)6(AsO3OH)4.23H2O A
STAROVAITE KCu5O(VO4)3 A
STEPITE U++++(AsO3OH)2.4H2O Q
STERGIOUITE CaZn2(AsO4)2.4H2O M
VANINIITE Ca2Mn++3Mn+++2O2(AsO4)4.2H2O M
STRONTIOHURLBUTITE SrBe2(PO4)2 M
VANDERMEERSCHEITE K2[(UO2)2V2O8].2H2O M
TAPIAITE Ca5Al2(AsO4)4(OH)4.12H2O M
THORASPHITE Th2H(PO4,AsO4)3.6H2O O
TREBISKYITE Na3Mg2[TiV9O28].22H2O M
TSANGPOITE Ca5(PO4)2(SiO4) H
UDINAITE NaMg4(VO4)3 Q
ROSSIANTONITE Al3(PO4)(SO4)2(OH)2(H2O)10.4H2O A
STOFFLERITE CaAl2Si2O8 Q
ESDANAITE-(Ce) NaMnCe(PO4)2.4H2O O
FORETITE Cu2Al2(AsO4)(OH,O,H2O)6 A
DMISOKOLOVITE K3Cu5AlO2(AsO4)4 M
DOKUCHAEVITE Cu8O2(VO4)3Cl3 A
ERICLAXMANITE Cu4O(AsO4)2 A
EPIFANOVITE NaCaCu5(PO4)4[AsO2(OH)2].7H2O M
CURRIERITE Na4Ca3MgAl4(AsO3OH)12.9H2O H
ERIKJONSSONITE (Pb32O21)[(V,Si,Mo,As)O4]4Cl9 M
CUATROCAPAITE-(NH4) (NH4)3(NaMg[])(As2O3)6Cl6.16H2O R
EVSEEVITE Na2Mg(AsO4)F O
FALSTERITE Ca2MgMn++2(Fe++0,5Fe+++0,5)4Zn4(PO4)8(OH)4(H2O)14 M
FERRAIOLOITE MgMn++4(Fe++0,5Al+++0,5)4Zn4(PO4)8(OH)4(H2O)20 M
FERRIBUSHMAKINITE Pb2Fe+++(PO4)(VO4)(OH) M
FERRIVAUXITE Fe+++Al2(PO4)2(OH)3.5H2O A
FLURLITE Zn4Fe+++(PO4)3(OH)2(H2O)7.2H2O M
ACHYROPHANITE (K,Na)3(Fe+++,Ti,Al,Mg)5O2(AsO4)5 O
BOHUSLAVITE Fe+++4(PO4)3(SO4)(OH).nH2O (n between 15 and 24) A
LOMBARDOITE Ba2Mn+++(AsO4)2(OH) M
ALEUTITE [Cu5O2](AsO4)(VO4).(Cu,K,Pb,Rb,Cs,)Cl M
ANATOLYITE Na6(Ca,Na)(Mg,Fe+++)3Al(AsO4)6 R
ARMELLINOITE-(Ce) Ca4Ce++++(AsO4)4.H2O Q
ARSENATROTITANITE NaTi(AsO4)O M
CZOCHRALSKIITE Na4Ca3Mg(PO4)4 O
BARROTITE Cu9Al(HSiO4)2[(SO4)(HAsO4)0,5](OH)12.8H2O R
ANASTASENKOITE CaFe++(P2O7) A
CAMARONESITE Fe+++2(PO3OH)2(SO4)(H2O)4.1-2H2O R
CARDITE Zn5,5(AsO4)2(AsO3OH)(OH)3.3H2O O
CHERNOVITE-(Ce) (Ce,Y)(AsO4) Q
CHINCHORROITE Na2Mg5(As2O7)2(AsO3OH)2(H2O)10 A
CROCOBELONITE CaFe+++2O(PO4)2 O
CUATROCAPAITE-(K) K3(NaMg[])(As2O3)6Cl6.16H2O R
ARSENUDINAITE NaMg4(AsO4)3 Q
LAPEYREITE Cu3O[AsO3(OH)]2.0,75H2O O
KARPENKOITE Co3(V2O7)(OH)2.2H2O R ps H
KATIARSITE KTiO(AsO4) O
KAYROBERTSONITE [MnAl2(PO4)2(OH)2(H2O)4].2H2O A
KENNGOTTITE Mn++3Fe+++4(PO4)4(OH)6(H2O)2 M
KOKSHAROVITE CaMg2Fe+++4(VO4)6 A
KAPUNDAITE (Na,Ca)2Fe+++4(PO4)4(OH)3.5H2O A
LANGBANSHYTTANITE Pb2Mn2Mg(AsO4)2(OH)4.6H2O A
KOBOKOBOITE Al6(PO4)4(OH)6.11H2O A
LASNIERITE (Ca,Sr)(Mg,Fe++)2Al(P[O,F]4)3 O
LEFONTITE Fe2Al2Be(PO4)2(OH)6 O
LEHMANNITE Na18Cu12TiO8(AsO4)8FCl5 M
ALCANTARILLAITE [Fe+++0,5(H2O)4][CaAs+++2(Fe+++2,5W++++++0,5)(AsO4)2O7] O
LIMOUSINITE BaCa[Be4P4O16].6H2O M
LIVERSIDGEITE Zn6(PO4)4.7H2O A
FULBRIGHTITE Ca(VO)2(AsO4)2.4H2O A
GRANDAITE Sr2Al(AsO4)2(OH) M
KOZYREVSKITE Cu4O(AsO4)2 O
GORYAINOVITE Ca2(PO4)Cl O
KAMPELITE Ba6Mg3Sc8(PO4)12(OH)6.7H2O O
GRIGORIEVITE Cu3Fe+++2Al2(VO4)6 A
GURIMITE Ba3(VO4)2 R
HILARIONITE Fe+++2(SO4)(AsO4)(OH).6H2O M
HONZAITE Ni2(AsO3OH)2.5H2O M
HORAKITE (Bi7O7OH)[(UO2)4(PO4)2(AsO4)2(OH)2] M
JASONSMITHITE Mn++4ZnAl(PO4)4(OH)(H2O)7.3,5H2O M
GALLISKIITE Ca4Al2(PO4)2F8.5H2O A
JORGKELLERITE Na3Mn+++3(PO4)2(CO3)O2.5H2O R
JOTEITE Ca2CuAl[AsO4][AsO3(OH)]2(OH)2.5H2O A
JUANSILVAITE Na5Al3[AsO3(OH)]4[AsO2(OH)2]2(SO4)2.4H2O M
KAINOTROPITE Cu4Fe+++O2(V2O7)(VO4) O
KAMARIZAITE Fe+++3(AsO4)2(OH)3.3H2O O
IWATEITE Na2BaMn++(PO4)2 R
DENDORAITE-(NH4) (NH4)2NaAl(C2O4)(PO3OH)2(H2O)2 M
NABATEAITE Fe2P2O7 A
LISANITE CaNiP2O7 A
OBERWOLFACHITE SrFe+++3(AsO4)(SO4)(OH)6  
MIKEHOWARDITE Fe+++4(V+++++O4)4(H2O)2.H2O A
MILKOVOITE Cu4O(PO4)(AsO4) O
MOABITE NiFe+++(PO4)O O
BEERSHEVAITE CaFe+++3(PO4)3O M
PHOSPHOCYCLITE-(Fe) Fe++2(P4O12) M
PHOSPHOCYCLITE-(Ni) Ni2(P4O12) M
SAMRAITE Ni2P2O7 M
KARLDITMARITE Cu9O4(PO4)2(SO4)2 A
YAKUBOVICHITE CaNi2Fe+++(PO4)3 O
RELIANCEITE-(K) K4Mg(V++++O)2(C2O4)(PO3OH)4(H2O)10 M
DONOWENSITE a(H2O)3Fe+++2(V2O7)2 A
SHASUITE CaNi3(P2O7)2 M
CUPRODONGCHUANITE Pb4CuZn2(PO4)4(OH)2 A
DONGCHUANITE Pb4ZnZn2(PO4)4(OH)2 A
PROTOCASEYITE [Al4(OH)6(H2O)12][V10O28].8H2O A
* SILICATES, Germanates
Nesosilicates
ATELISITE-(Y) Y4Si3O8(OH)8 Q
BRIDGMANITE MgSiO3 O
Nesosilicates without additional anions; cations in tetrahedral [4] coordination
EUCRYPTITE LiAlSiO4 R
PHENAKITE Be2SiO4 R
WILLEMITE Zn2SiO4 R
LIBERITE Li2BeSiO4 M
Nesosilicates without additional anions; cations in [4] and greater coordination
TRIMERITE Ca,Mn2Be3(SiO4)3 M
LARSENITE PbZnSiO4 O
ESPERITE PbCa2Zn3(SiO4)3 M
RONDORFITE Ca8Mg(SiO4)4Cl2 C
Nesosilicates without additional anions; cations in octahedral [6] coordination
FAYALITE Fe++2SiO4 O
FORSTERITE Mg2SiO4 O
GLAUCOCHROITE CaMnSiO4 O
KIRSCHSTEINITE CaFe++SiO4 O
LAIHUNITE Fe++Fe+++2(SiO4)2 M
LIEBENBERGITE (Ni,Mg)2SiO4 O
TEPHROITE Mn++2SiO4 O
MONTICELLITE CaMgSiO4 O
BRUNOGEIERITE Fe++2Ge++++O4 C
RINGWOODITE (Mg,Fe++)2SiO4 C
CHESNOKOVITE Na2SiO2(OH)2.8H2O O
AHRENSITE Fe2SiO4 C
Nesosilicates without additional anions; cations in [6] and/or greater coordination
ADRIANITE Ca12(Al4Mg3Si7)O32Cl6 C
LARNITE Ca2SiO4 M
CALCIOOLIVINE Ca2SiO4 O
MERWINITE Ca3Mg(SiO4)2 M
BREDIGITE Ca7Mg(SiO4)4 O ps H
SCHORLOMITE {Ca3}[Ti2](SiFe+++2)O12 C
KNORRINGITE {Mg3}[Cr+++2](Si3)O12 C
MAJORITE {Mg3}[SiMg](Si3)O12 C
MOMOIITE {Mn++3}[V+++2](Si3)O12 C
MORIMOTOITE {Ca3}[TiFe++](Si3)O12 C
WADALITE Ca12Al010Si4O32Cl6 C
ERINGAITE {Ca3}[Sc2](Si3)O12 C
SPESSARTINE {Mn++3}[Al2](Si3)O12 C
TOTURITE {Ca3}[Sn++++2](SiFe+++2)O12 C
UVAROVITE {Ca3}[Cr+++2](Si3)O12 C
KIMZEYITE {Ca3}[Zr2](SiAl2)O12 C
PYROPE {Mg3}[Al2](Si3)O12 C
CALDERITE {Mn++3}[Fe+++2](Si3)O12 C
GROSSULAR {Ca3}[Al2](Si3)O12 C
ANDRADITE {Ca3}[Fe+++2](Si3)O12 C
KERIMASITE {Ca3}[Zr2](SiFe+++2)O12 C
ELTYUBYUITE Ca12Fe+++10Si4O32Cl6 C
GOLDMANITE {Ca3}[V+++2](Si3)O12 C
HENRITERMIERITE {Ca3}[Mn+++2](Si2)([])O8(OH)4 Q
HOLTSTAMITE Ca3(Al,Mn+++)2(SiO4)2(OH)4 Q
HUTCHEONITE Ca3Ti2(SiAl2)O12 C
KATOITE Ca3Al2(SiO4)3-x(OH)4x (x = 1,5-3) C
ALMANDINE {Fe++3}[Al2](Si3)O12 C
COFFINITE U(SiO4)1-x(OH)4x Q
HAFNON HfSiO4 Q
STETINDITE-(Ce) Ce++++SiO4 Q
THORITE (Th,U)SiO4 Q
ZIRCON (Zr,Hf)SiO4 Q
HUTTONITE ThSiO4 M
EULYTINE Bi4(SiO4)3 C
REIDITE ZrSiO4 Q
IRINARASSITE {Ca3}[Sn++++2](SiAl2)O12 C
KHOHARITE Mg3Fe+++2(SiO4)3 C
MENZERITE-(Y) {Y2Ca}[Mg2](Si3)O12 C
MONTENEVEITE Ca3Sb+++++2(Fe+++2Fe++)O12 C
NIKMELNIKOVITE Ca12Fe++Fe+++3Al3(SiO4)6(OH)20 R
Nesosilicates with additional anions (O,OH,F,H2O); cations in tetrahedral [4] coordination
BERYLLITE Be3SiO4(OH)2.H2O O (?)
EUCLASE BeAlSiO4(OH) M
SVERIGEITE NaMnMgSn++++Be2Si3O12(OH) O
HODGKINSONITE MnZn2SiO4(OH)2 M
GERSTMANNITE (Mg,Mn)2ZnSiO4(OH)2 O
CLINOHEDRITE CaZnSiO4.H2O M
STRINGHAMITE CaCuSiO4.2H2O M
KATOPTRITE (Mn,Mg)13(Al,Fe+++)4Sb+++++2Si2O28 M
YEATMANITE Mn++9Zn6Sb+++++2Si4O28 A
SPHAEROBERTRANDITE Be3SiO4(OH)2 M ps O
Nesosilicates with additional anions; cations in [4], [5] and/or only [6] coordination
SILLIMANITE Al2SiO5 O
ANDALUSITE Al2SiO5 O
KANONAITE (Mn+++,Al)AlSiO5 O
KYANITE Al2SiO5 A
KRIESELITE (Al,Ga)2(Ge,Al)O4(F,OH)2 O
MULLITE Al4+2xSi2-2xO10-x (x about 0,4) O
BOROMULLITE Al8BO4AlO4(SiO4)2O3 O
YODERITE (Mg,Al,Fe+++)8Si4(O,OH)20 M
ZINCOSTAUROLITE (Zn,Li,Fe,Mg)2Al9(Si,Al)4O22(OH)2 M
STAUROLITE (Fe++,Mg,Zn)2Al9(Si,Al)4O22(OH)2 M ps O
MAGNESIOSTAUROLITE []4Mg4Al16(Al2[]2)Si8O40[(OH)2O6] M
TOPAZ Al2SiO4(F,OH)2 O
NORBERGITE Mg3(SiO4)(F,OH)2 O
REINHARDBRAUNSITE Ca5(SiO4)2(OH,F)2 M
ALLEGHANYITE Mn++5(SiO4)2(OH)2 M
CHONDRODITE (Mg,Fe++)5(SiO4)2(F,OH)2 M
HYDROXYLCHONDRODITE Mg5(SiO4)2(OH)2 M
KUMTYUBEITE Ca5(SiO4)2F2 M
HUMITE (Mg,Fe++)7(SiO4)3(F,OH)2 O
MANGANHUMITE (Mn++,Mg)7(SiO4)3(OH)2 O
CLINOHUMITE (Mg,Fe++)9(SiO4)4(F,OH)2 M
HYDROXYLCLINOHUMITE Mg9(SiO4)4(OH,F)2 M
SONOLITE Mn++9(SiO4)4(OH,F)2 M
LEUCOPHOENICITE Mn++7(SiO4)3(OH)2 M
RIBBEITE (Mn++,Mg)5(SiO4)2(OH)2 O
JERRYGIBBSITE Mn++9(SiO4)4(OH)2 O
WELINITE Mn++3(W++++++,Mg)0,7SiO4(O,OH)3 H
FRANCISCANITE Mn++3V+++++(SiO4)(O,OH)7 H
OREBROITE Mn++3(Sb+++++,Fe+++)Si(O,OH)7 H
ELLENBERGERITE Mg6TiAl6Si8O28(OH)10 H
CHLORITOID (Fe++,Mg,Mn)2Al4Si2O10(OH)4 M/A
MAGNESIOCHLORITOID MgAl2SiO5(OH)2 A
OTTRELITE (Mn,Fe++,Mg)2Al4Si2O10(OH)4 M/A
OLMIITE CaMn++SiO3(OH)2 O
POLDERVAARTITE CaCaSiO3(OH)2 O
CHEGEMITE Ca7(SiO4)3(OH)2 O
BARWOODITE Mn++6(Nb+++++,[])2(SiO4)2(O,OH)6 H
SCORTICOITE Mn6(Sb,[])2(SiO4)2O3(OH)3 R
FLUORCHEGEMITE Ca7(SiO4)3F2 O
Nesosilicates with additional anions; cations in > [6] +- [6] coordination
NELTNERITE CaMn+++6SiO12 Q
ABSWURMBACHITE Cu++Mn+++6SiO12 Q
BRAUNITE Mn++Mn+++6SiO12 Q
BRAUNITE-II Ca(Mn+++,Fe+++)14SiO24 Q
LANGBANITE (Mn++,Ca)4(Mn+++,Fe+++)9Sb+++++Si2O24 R
MALAYAITE CaSnSiO5 M
NATROTITANITE (Na,Ca,Y,REE)TiSiO4(O,F) M
TITANITE CaTiSiO5 M
VANADOMALAYAITE CaVOSiO4 M
FERRICERITE-(La) (La,Ce,Ca)9Fe+++(SiO4)3(SiO3OH)4(OH)3 R ps H
ALUMINOCERITE-(Ce) (Ce,Ca,La,Nd)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 R
CERITE-(Ce) Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 R
YFTISITE-(Y) (Y,Dy,Er)4(Ti,Sn++++)O(SiO4)2(F,OH)6 O
MIEITE-(Y) Y4Ti(SiO4)2O[F,(OH)]6 O
TRIMOUNSITE-(Y) (Y,Dy,Er,Yb,Gd,Ho,Tb,Sm)2Ti2SiO9 M
SITINAKITE Na2K(Ti,Nb)4O4(SiO4)2(O,OH).4H2O Q
KITTATINNYITE Ca4Mn++2Mn+++4Si4O16(OH)8.18H2O H
NATISITE Na2(TiO)SiO4 Q
PARANATISITE Na2(TiO)SiO4 O
TORNEBOHMITE-(La) (La,Ce)2Al(SiO4)2(OH) M
TORNEBOHMITE-(Ce) (Ce,La)2Al(SiO4)2(OH) M
KULIOKITE-(Y) (Y,Yb,Er,Dy,Lu,Gd,Tm,Ho)4Al(SiO4)2(OH)2F5 A
CHANTALITE CaAl2SiO4(OH)4 Q
MOZARTITE CaMn+++SiO4(OH) O
VUAGNATITE CaAlSiO4(OH) O
HATRURITE Ca3SiO5 R
JASMUNDITE Ca11(SiO4)4O2S Q
AFWILLITE Ca3[SiO3(OH)]2.2H2O M
BULTFONTEINITE Ca2SiO2(OH,F)4 A
ZOLTAIITE BaV+++12(Ti,V++++)2(Si2O8)O19 R
TRANQUILLITYITE Fe++8(Zr,Y)2Ti3Si3O24 H
EDGREWITE Ca9(SiO4)4F2 M
GATEDALITE ZrMn++2Mn+++4SiO12 Q
HYDROXYLEDGREWITE Ca9(SiO4)4(OH)2 M
TAIPINGITE-(Ce) Ce+++7Ca2Mg(SiO4)3[SiO3(OH)]4F3 R
Nesosilicates with CO3, SO4, PO4, etc.
IIMORIITE-(Y) Y2(SiO4)(CO3) A
TUNDRITE-(Nd) Na3(Nd,La)4(Ti,Nb)2(SiO4)2(CO3)3O4(OH).2H2O A
TUNDRITE-(Ce) Na2(Ce,La,Nd)2(Ti,Nb)(O,OH)2(SiO4)(CO3)2 A
SPURRITE Ca5(SiO4)2(CO3) M
TERNESITE Ca5(SiO4)2SO4 O
FLUORBRITHOLITE-(Ce) (Ce,Ca)5(SiO4)3F H
TRITOMITE-(Y) Y5(SiO4,BO4)3(O,OH,Cl) R (?)
TRITOMITE-(Ce) Ce5(SiO4,BO4)3(OH,O) R
MATTHEDDLEITE Pb5(SiO4)1,5(PO4)1,5Cl H
HYDROXYLELLESTADITE Ca5(SiO4)1,5(SO4)1,5OH M ps H
FLUORELLESTADITE Ca5(SiO4)1,5(SO4)1,5F H
FLUORBRITHOLITE-(Y) (Y,Ca,Ce,Nd)5(SiO4)3(F,O) H
CHLORELLESTADITE Ca5(SiO4)1,5(SO4)1,5Cl O
BRITHOLITE-(Y) (Y,Ca)5(SiO4,PO4)3(OH,F) H
BRITHOLITE-(Ce) (Ce,Ca)5(SiO4,PO4)3(OH,F) H
FLUORCALCIOBRITHOLITE (Ca,Ce,La,Nd)5(SiO4,PO4)3(F,O) H
KIHLMANITE-(Ce) Ce2TiO2[SiO4](HCO3)2(H2O) A
SILICOCARNOTITE Ca5[(SiO4)(PO4)](PO4) O
Nesosilicates with BO3 triangles and/or B[4], Be[4] tetrahedra, cornersharing with SiO4
GRANDIDIERITE (Mg,Fe++)Al3(BO4)(SiO4)O O
OMINELITE (Fe++,Mg)Al3BSiO9 O
NIOBOHOLTITE (Nb0,6[]0,4)Al6BSi3O18 O
SZKLARYITE []Al6BAs+++3O15 O
MAGNESIODUMORTIERITE (Mg,Ti,-)(Al,Mg)2Al4Si3O18-y(OH)yB (y=2-3) O
HOLTITE Al6(Al,Ta)(Si,Sb)3BO15(O,OH)2 O
DUMORTIERITE Al7(BO3)(SiO4)3O3 O
TITANOHOLTITE (Ti0,75[]0,25)Al6BSi3O18 O
GARRELSITE Ba3NaSi2B7O16(OH)4 M
HINGGANITE-(Y) BeYSiO4(OH) M
HOMILITE Ca2(Fe++,Mg)B2Si2O10 M
DATOLITE Ca2B2Si2O8(OH)2 M
HINGGANITE-(Yb) (Yb,Y)BeSiO4(OH) M
MINASGERAISITE-(Y) CaY2Be2Si2O10 M
GADOLINITE-(Ce) (Ce,La,Nd,Y)2Fe++Be2Si2O10 M
CALCYBEBOROSILITE-(Y) (Y,Ca)2([],Fe++)(B,Be)2[SiO4]2(OH,O)2 M
GADOLINITE-(Y) Y2Fe++Be2Si2O10 M
HINGGANITE-(Ce) BeCeSiO4(OH) M
STILLWELLITE-(Ce) (Ce,La,Ca)BSiO5 R
CAPPELENITE-(Y) Ba(Y,Ce)6Si3B6O24F2 R
HUNDHOLMENITE-(Y) (Y,REE,Ca,Na)15(Al,Fe+++)(CaxAs+++1-x)(Si,As+++++)Si6B3(O,F)48 (x = 0,78) R
OKANOGANITE-(Y) Na(Y,Ce,Nd,Ca,Na)15Fe+++(Si3B3O18)(SiO4)4F10(OH)4 R
PROSHCHENKOITE-(Y) (Y,REE,Ca,Na,Mn)15(Fe++,Mn)Ca(P,Si)Si6B3O34F14 R
VICANITE-(Ce) (Ca,REE,Th)15Fe+++(SiO4)3(Si3B3O18)(BO3)(As+++++O4)(As+++O3)x(NaF3)1-xF7.0,2H2O (x=0.4) R
JADARITE NaLiB3SiO7(OH) M
HINGGANITE-(Nd) Nd2[]Be2Si2O8(OH)2 M
LAPTEVITE-(Ce) Ca6(Fe++,Mn++)Y3REE7(SiO4)3(PO4)(B3Si3O18)(BO3)F11 H
GADOLINITE-(Nd) Nd2Fe++Be2O2(SiO4)2 M
ARRHENIUSITE-(Ce) CaMg[(Ce7Y3)Ca5](SiO4)3(Si3B3O18)(AsO4)(BO3)F11 R
Uranyl neso- and polysilicates
SODDYITE (UO2)2(SiO4)(H2O)2 O
CUPROSKLODOWSKITE (H3O)2Cu(UO2)2(SiO4)2.2H2O A
OURSINITE (Co,Mg)(UO2)2Si6(OH)2.6H2O O
SKLODOWSKITE (H3O)2Mg(UO2)2(SiO4)2.2H2O M
BOLTWOODITE (K,Na)(UO2)SiO3(OH).1,5H2O M
URANOPHANE-Beta Ca(UO2)2SiO3(OH)2.5H2O M
URANOPHANE Ca(UO2)2(SiO3OH)2.5H2O M
KASOLITE Pb(UO2)SiO4.H2O M
NATROBOLTWOODITE (Na,K)(UO2)SiO3(OH).1,5H2O O
SWAMBOITE-(Nd) Nd0.33[(UO2)(SiO3OH)].2,5(H2O) M
HAIWEEITE Ca(UO2)2Si5O12(OH)2.4,5H2O O
METAHAIWEEITE Ca(UO2)2Si6O15.nH2O M (?)
COUTINHOITE (Th,Ba)0,5(UO2)2Si5O13.1-3,5H2O O
WEEKSITE K2(UO2)2(Si5O13).4H2O M
CALCIOURSILITE Ca4(UO2)4(Si2O5)5(OH)6.15H2O  
MAGNIOURSILITE Mg4(UO2)4(Si2O5)5(OH)6.20H2O  
URANOSILITE U++++++Si7O17 O
Sorosilicates
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] coordination
Si2O7 groups, without non-tetrahedral anions; cations in tetrahedral [4] and greater coordination
JEFFREYITE (Ca,Na)2(Be,Al)Si2(O,OH)7 O ps Q
OKAYAMALITE Ca2B2SiO7 Q
HARDYSTONITE Ca2ZnSi2O7 Q
GUGIAITE Ca2BeSi2O7 Q
CEBOLLITE Ca2(Mg,Fe++,Al)Si2(O,OH)7 O
ALUMOAKERMANITE NaCa(Al,Fe+++)Si2O7 Q
AKERMANITE Ca2MgSi2O7 Q
GEHLENITE Ca2Al(AlSi)O7 Q
BARYLITE BaBe2Si2O7 O ps H
ANDREMEYERITE BaFe++2Si2O7 M (?)
MELILITE (Ca,Na)2(Al,Mg)(Si,Al)2O7 Q
BENNESHERITE Ba2Fe++Si2O7 Q
HYDROXYLGUGIAITE (Ca,[])2(Be,Si)[(Si,Be)2O5(OH)2] Q
Si2O7 groups, without non-tetrahedral anions; cations in octahedral [6] and greater coordination
KEIVIITE-(Y) (Y,Yb)2Si2O7 M
KEIVIITE-(Yb) (Yb,Y)2Si2O7 M
THORTVEITITE (Sc,Y)2Si2O7 M
YTTRIALITE-(Y) (Y,Th)2Si2O7 H (?)
GITTINSITE CaZrSi2O7 M
PARAKELDYSHITE Na2ZrSi2O7 A
KELDYSHITE Na2-xHxZrSi2O7.nH2O A
KHIBINSKITE K2ZrSi2O7 M ps R
RANKINITE Ca3Si2O7 M
BARYSILITE Pb8Mn(Si2O7)3 R
EDGARBAILEYITE Hg+6Si2O7 M
KRISTIANSENITE Ca2ScSn(Si2O7)(Si2O6OH) A
PERCLEVEITE-(Ce) (Ce,La,Nd)2(Si2O7) Q
PERCLEVEITE-(La) La2Si2O7 Q
Si2O7 groups, with additional anions; cations in tetrahedral [4] and greater coordination
BERTRANDITE Be4Si2O7(OH)2 O
HEMIMORPHITE Zn4Si2O7(OH)2.H2O O
JUNITOITE CaZn2Si2O7.H2O O
AXINITE-(Fe) Ca2Fe++Al2BO3Si4O12(OH) A
TINZENITE Ca2Mn++4Al4[B2Si8O30](OH)2 A
AXINITE-(Mg) Ca2MgAl2BO3Si4O12(OH) A
AXINITE-(Mn) Ca2Mn++Al2BO3Si4O12(OH) A
VISTEPITE (Mn++,Ca)4Sn++++B2(SiO7)(Si3O9)(OH)2 A
BORALSILITE Al16(BO4)6(SiO4)2O5 M
WERDINGITE (Mg,Fe)2Al12(Al,Fe)2Si4B2(B,Al)2O37 A
Si2O7 groups, with additional anions; cations in octahedral [6] and greater coordination
WADSLEYITE (Mg,Fe++)2SiO4 O
LAWSONITE CaAl2Si2O7(OH)2.H2O O
ITOIGAWAITE SrAl2Si2O7(OH)2.H2O O
HENNOMARTINITE SrMn+++2Si2O7(OH)2.H2O O
NOELBENSONITE BaMn+++2(Si2O7)(OH)2.H2O O
ILVAITE CaFe++2Fe+++Si2O7O(OH) O
MANGANILVAITE CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) M
SUOLUNITE Ca2Si2O5(OH)2.H2O O
JAFFEITE Ca4(Si3O7)(OH)6 H
FRESNOITE Ba2TiSi2O8 Q
HIORTDAHLITE-I Na4Ca8Zr2(Nb,Mn,Ti,Fe,Mg,Al)2(Si2O7)4O3F5 A
WOHLERITE Na4Ca8(Zr,Nb)4(Si2O7)4(O,OH,F)8 M
NORMANDITE NaCa(Mn++,Fe++)(Zr,Ti)(Si2O7)OF M
NIOCALITE Ca14Nb2(Si2O7)4(O6F2) M
MOXUANXUEITE Na2Ca4ZrCa(Si2O7)2F4 A
JANHAUGITE Na6Mn++6Ti4(Si2O7)4[O2(OH,F,O)6] M
CUSPIDINE Ca4(Si2O7)(F,OH)2 M
BURPALITE Na8Ca4Zr4(Si2O7)4F8 M
LAVENITE (Na,Ca)8(Mn++,Fe++)4(Zr,Ti)4(Si2O7)4(O,OH,F)8 M
BAGHDADITE Ca12(Zr,Ti)4(Si2O7)4(O,F)8 M
HIORTDAHLITE-II (Na,Ca)4Ca8Zr2(Y,Zr,REE,Na)2(Si2O7)4(O3F5) A
MOSANDRITE-(Ce) (Ca3REE)[(H2O)2Ca0,5[]0,5]Ti(Si2O7)2(OH)2(H2O)2 M
NACARENIOBSITE-(Ce) Na3Ca3(Ce,La,Pr,Nd)(Nb,Ti)(Si2O7)2OF3 M
HAINITE-(Y) Na2Ca4(Y,REE)Ti(Si2O7)2OF3 A
ROSENBUSCHITE (Ca,Na)12(Zr,Ti)4(Si2O7)4(O4F4) A